Feed Composition For Aquatic Organisms

  • Published: Jul 17, 2008
  • Earliest Priority: Jan 10 2007
  • Family: 3
  • Cited Works: 0
  • Cited by: 35
  • Cites: 0
  • Additional Info: Full text Published

Feed composition for aquatic organisms

All patent and non-patent references cited in the application, or in the present application, are also hereby incorporated by reference in their entirety.

Field of invention

The present invention relates to a specialized feed for aquatic organisms, especially larvae or juvenile forms of farmed aquatic organisms.

Background of invention

Aquaculture is the cultivation of the natural produce of water such as fish or shellfish, algae and other aquatic organisms. Subsets of aquaculture include Marine culture (aquaculture in the ocean); Algaculture (the production of kelp/seaweed and other algae); Fish farming; and the growing of cultured pearls.

The current boom in aquaculture started in the 1960s as prices for fish began to climb. Wild fish capture was reaching its peak and the human population was continuing to rise. Today, commercial aquaculture exists on an unprecedented, huge scale. In 2003, the total world production of fisheries product was 132.2 million tonnes of which aquaculture contributed 41.9 million tonnes or about 31% of the total world production. The growth rate of world wide aquaculture is very fast (> 10% per year for most species) while the contribution to the total from wild fisheries has been essentially flat for the last decade. In the US, approximately 90% of all the shrimp consumed is farmed and imported.

Providing a suitable feed for aquacultured organisms is essential and depends on the species farmed, their size and especially on their developmental stage. While extensive farms mainly rely on the natural productivity of the ponds/pools, more intensively managed farms rely on artificial feeds, typically as a supplement to the organisms that naturally occur in the pond/pool or are themselves as part of the diet of the farmed species. The various developmental stages the farmed organisms go through on their way to reaching maturity typically require different types of feed and food supplements. The stage at which the farmed organisms are the most sensitive and dependent upon the feed supplied is during the larval stage, i.e. the stage immediately following hatching of the organism from the egg. There is a constant demand for new specialised feed to produce larvae for aquacultural farming. These larvae may be of crustacean, shell, fish or other origin. Currently these larvae are given live feed. The live feed used for first feeding today is Artemia (brine shrimp of aquatic crustaceans of the genus Artemia) which is very expensive and may account for 60% of total larvae costs. The use of Artemia is based on natural production and thus shows seasonal variations in availability and quality. Rotifers (a phylum of microscopic, and near-microscopic pseudocoelomate animals) are used as feed for some fish larvae. This production is based on stocks, but production is laborious and large scale productions are shown to be inhomogeneous and unreliable. Algae is the third group of live feed that is used for larvae production. Even though algae is not as expensive as Artemia and Rotifers, large scale production and use is unreliable. Extremely high and unpredictable mortality in the early life-stages of the farmed species are together with direct and indirect costs relating to the purchase and production of live feed are today major limitations to a further expansion of production of especially marine species in aquaculture

Therefore a formulated feed substitute that can replace or supplement the expensive, laborious and irreproducible feed based on live organisms would be very beneficial and may be combined with the demand for the introduction of sophisticated feeds with optimal nutrition and technology.

Summary of invention A formulated feed composition will i) remove live feed issues, such as removing the labour intensive production of live feed and by lowering costs, as purchase and production of live feed may account for as much as 65% of the production costs for marine larvae, ii) give improved production stability, iii) may give lower mortality and iv) offer the opportunity to tailor make early stage feed.

The present invention provides a feed composition for use in the farming/breeding of aquatic species. The feed may be used as a supplemental and / or substitute feed for sensitive organisms such as larvae and juvenile forms of farmed aquatic organisms.

The present invention furthermore discloses the method of manufacturing the feed composition as herein described. Brief description of drawings Figure 1 Feed composition tested on shrimp larvae Figure 2 Feed composition tested on mussels Figure 3 A list of preferred algal-strains

Detailed description of the invention

Definitions

%: if nothing else has been stated all the %-values in the present document is weight- by-weght%.

Amino acids: Any synthetic or naturally occurring amino carboxylic acid, including any amino acid occurring in peptides and polypeptides including proteins and enzymes synthesized in vivo. Bioactive agent: Any agent, drug, compound, composition of matter or mixture which provides a beneficial pharmacological effect that can be demonstrated in-vivo or in vitro. This includes beneficial pharmacological effects which can be demonstrated in an individual on a diet comprising an edible food, a food supplement, such as a composition of vitamins, a nutrient, or a nutriceutical comprising the bioactive agent. Also, the beneficial pharmacological effect can be observed in an individual being administered a medicament (drug), a combination of medicaments, a vaccine, or other beneficial agents comprising the bioactive agent.

Bioactive agents comprising a survival enhancing activity: Survival enhancement is an important parameter when e.g. treating an individual for a disease, or when rearing aquatic species or raising fish in industrial fish farms. Bioactive agents comprising a survival enhancing effect are able to improve the survival. Thus such a bioactive agent is also called a survival enhancing agent.

Feed or food: Used herein these terms include feed or food additives, feed or food supplements, feed or food premixes. Fatty acid nomenclature: The shortest descriptions of fatty acids include only the number of carbon atoms and double bonds in them (e.g., C18:0 or 18:0). C18:0 means that the carbon chain of the fatty acid consists of 18 carbon atoms, and there are no (zero) double bonds in it, whereas C18:1 describes an 18-carbon chain with one double bond in it. Each double bond can be in either a cis- or trans- conformation and in a different position with respect to the ends of the fatty acid; therefore, not all C18:1 s, for example, are identical. If there is one or more double bonds in the fatty acid, it is no longer considered saturated, rather mono- or polyunsaturated. The position of the double bond is indicated by the number n as illustrated by the following example; 24:1 n-9 is CH3(CH2)7CH=CH(CH2)13COOH. High quality fish meal: High quality fish meal is characterized by having a high digestability. Experimental analysis demonstrate that more than 93% of protein from high quality fish meal is absorbed in the gasto-intestinal tract of mink (Skrede, A., 1979. Utilization of fish and animal byproducts in mink nutrition: IV. Fecal excretion and digestibility of nitrogen and amino acids in mink fed cod fillet or meat-and bone-meal. Acta. Agric. Scand. 29, 241 -257). Moisture: in one embodiment the moisture content of the feed composition is the water content of the feed composition.

Polypeptide: the term "polypeptide" as used herein covers proteins, peptides and polypeptides, wherein said proteins, peptides or polypeptides may or may not have been post-translationally modified. Post-translational modification may for example be phosphorylation, methylation, glucosylation,

Prebiotics: ingredients or compounds that have a beneficial effect on the microflora in the host itself.

Probiotics: specific live microorganisms that have a beneficial effect on the host. Synbiotics: mixtures of probiotics and prebiotics.

The invention relates to feed for marine larvae and the production of same. The invention can shorten the time and/or completely eliminate the need for live feed (Artemia, rotifers, algae, phytoplankton and other) from the time of hatching of the larvae, and thus in its most preferred embodiment constitutes a substitute feed. Marine larvae include shrimp and other crustaceans, mollusk, echinoderm and fish larvae.

The invention may be characterized by the composition of the feed, both in regards to chemical, physical and biological features hereof. These features may be subdivided into several parameters, and the present invention may thus be described by eight parameters each of which cover multiple factors. These parameters include: Nutrition, Uptake, Particle size, Consistency (includes Sharpness), Floatation, Leakage and Effect. The method of production has a major influence on several of these parameters, and is thus also an object of the present invention. Fish feed composition

In one preferred embodiment the fish feed composition is made of the ingredients listed table 1.

Table 1 : fish feed composition (weight/weight %):

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that one of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that two of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that three of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that four of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that five of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that six of the ingredients are missing. In another embodiment the fish feed composition is made from the ingredients according to table 1 except that seven of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that eight of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that nine of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that ten of the ingredients are missing.

In another embodiment the fish feed composition is made from the ingredients according to table 1 except that more than ten of the ingredients are missing.

In another embodiment the present invention relates to a fish feed composition comprising High quality fish meal in the range from 30 to 60%, such as from 30-31 %, for example 31 -32%, such as from 32-33%, for example 33-34%, such as from 34- 35%, for example 35-36%, such as from 36-37%, for example 37-38%, such as from 38-39%, for example 39-40%, such as from 40-41%, for example 41 -42%, such as from 42-43%, for example 43-44%, such as from 44-45%, for example 45-46%, such as from 46-47%, for example 47-48%, such as from 48-49%, for example 49- 50%, such as from 50-51%, for example 51 -52%, such as from 52-53%, for example 53-54%, such as from 54-55%, for example 55-56%, such as from 56-57%, for example 57-58%, such as from 58-59%, for example 59-60%.

In another embodiment the present invention relates to a fish feed composition comprising krill meal in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1.0- 1.25%, for example from 1.25%-1.5%, such as from 1.5-1.75%, for example from

1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5- 2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0- 4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0- 7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5- 8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising corn starch such as Suprex in the range from 0-10%, such as from 0- 0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from

0.75%-1.0%, such as from 1.0-1.25%, for example from 1 .25%-1.5%, such as from 1.5- 1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0- 3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5- 4.75%, for example from 4.75%-5.0%, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0- 6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from

8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0- 9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising algae meal in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising mineral mix in the range from 0-5%, such as from 0-0.1%, for example from 0.1 -0.2%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4-0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7-0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%, such as from 1.0-1.1%, for example from 1.1 -1.2%, such as from 1 .2-1 .3%, for example from 1.3-1.4%, such as from 1.4-1.5%, for example from 1.5-1.6%, such as from 1.6-1.7%, for example from 1.7-1.8%, such as from 1 .8-1 .9%, for example from 1.9-2.0%, such as from 2.0-2.2%, for example from 2.2-2.4%, such as from 2.4-2.6%, for example from 2.6-2.8%, such as from 2.8-3.0%, for example from 3.0-3.2%, such as from 3.2-3.4%, for example from 3.4-3.6%, such as from 3.6-3.8%, for example from 3.8-4.0%, such as from 4.0-4.2%, for example from 4.2-4.4%, such as from 4.4-4.6%, for example from 4.6-4.8%, such as from 4.8-5.0%.

In another embodiment the present invention relates to a fish feed composition comprising a vitamin mix in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%. In another embodiment the present invention relates to a fish feed composition comprising betafin (betain) in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1.0-1.25%, for example from 1.25%- 1.5%, such as from 1 .5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising raw wheat in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising dicalsiumphosphate in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1.0-1.25%, for example from 1.25%-1.5%, such as from 1 .5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising Inositol in the range from 0-1%, such as from 0-0.01 %, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from 0.04-0.05%, for example from 0.05-0.06%, such as from 0.06-0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1%, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14-0.15%, for example from 0.15-0.16%, such as from

0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4- 0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7-0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%.

In another embodiment the present invention relates to a fish feed composition comprising yeast extract in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%- 10.0%.

In another embodiment the present invention relates to a fish feed composition comprising cholesterol in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising vitamin c in the range from 0-2%, such as from 0-0.01%, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from

0.04-0.05%, for example from 0.05-0.06%, such as from 0.06-0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1%, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14-0.15%, for example from 0.15-0.16%, such as from 0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.20-0.21%, for example from 0.21 -0.22%, such as from 0.22-0.23%, for example from 0.23-0.24%, such as from 0.24-0.25%, for example from 0.25-0.26%, such as from 0.26-0.27%, for example from 0.27-0.28%, such as from 0.28-0.29%, for example from 0.29-0.30%, such as from 0.30-0.32%, for example from 0.32-0.34%, such as from 0.34-0.36%, for example from 0.36-0.38%, such as from 0.38-0.40%, for example from 0.40-0.5%, such as from 0.5-0.6%, for example from 0.6- 0.7%, such as from 0.7-0.8%, for example from 0.8-0.9%, such as from 0.9-1 .0%, for example from 1.0-1.1 %, such as from 1 .1 -1 .2%, for example from 1.2-1.3%, such as from 1.3-1.4%, for example from 1.4-1.5%, such as from 1.5-1.6%, for example from 1.6-1.7%, such as from 1.7-1.8%, for example from 1 .8-1.9%, such as from 1.9-2.0%.

In another embodiment the present invention relates to a fish feed composition comprising Soya Lecitin in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising fish oil in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1.0- 1.25%, for example from 1.25%-1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5- 2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0- 4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from

4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0- 7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5- 8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising stickwater in the range from 0-20%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1 .5-1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1 .25%- 1 1.5%, such as from 1 1.5-1 1 .75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%- 15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%-16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%- 18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%. In another embodiment the present invention relates to a fish feed composition comprising Astaxanthin in the range from 0-1%, such as from 0-0.01%, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from 0.04-0.05%, for example from 0.05-0.06%, such as from 0.06-0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1 %, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14-0.15%, for example from 0.15-0.16%, such as from 0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4- 0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7-0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%.

In another embodiment the present invention relates to a fish feed composition comprising fish hydrolysate such as Primex in the range from 0-10%, such as from 0- 0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from

0.75%- 1.0%, such as from 1.0-1.25%, for example from 1 .25%- 1.5%, such as from 1.5- 1 .75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0- 3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5- 4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0- 6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from

8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0- 9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In another embodiment the present invention relates to a fish feed composition comprising gelatin in the range from 0-20%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1.0- 1.25%, for example from 1.25%-1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5- 2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0- 4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0- 7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5- 8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%- 10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1 .25%- 1 1 .5%, such as from 1 1.5-1 1 .75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%- 15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%-16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%- 18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

In another embodiment the present invention relates to a fish feed composition comprising an immune stimulant such as macro guard in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1 .0-1 .25%, for example from 1.25%-1 .5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

In one embodiment the chemical composition of the ingredients in the fish feed composition according to the present invention is as listed in table 2.

Table 2: Chemical composition of fish feed ingredients

In one preferred embodiment the present invention relates to a fish feed composition comprising 60% of protein, 13.5% lipid, 13.5% ash, 7% moisture and 6% carbohydrate, wherein the %-values are weight -by-weigh%.

In another preferred embodiment the fish feed composition comprises from 40 to 80% of protein, such as from 40-41%, for example 41 -42%, such as from 42-43%, for example 43-44%, such as from 44-45%, for example 45-46%, such as from 46-47%, for example 47-48%, such as from 48-49%, for example 49-50%, such as from 50- 51%, for example 51 -52%, such as from 52-53%, for example 53-54%, such as from 54-55%, for example 55-56%, such as from 56-57%, for example 57-58%, such as from 58-59%, for example 59-60%, such as from 60-61 %, for example 61 -62%, such as from 62-63%, for example 63-64%, such as from 64-65%, for example 65- 66%, such as from 66-67%, for example 67-68%, such as from 68-69%, for example 69-70%, such as from 70-71%, for example 71 -72%, such as from 72-73%, for example 73-74%, such as from 74-75%, for example 75-76%, such as from 76-77%, for example 77-78%, such as from 78-79%, for example 79-80%.

In another preferred embodiment the fish feed composition comprises from 0-20% lipid, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1 .0%, such as from 1.0-1.25%, for example from 1.25%- 1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%- 10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1 .25%-1 1.5%, such as from 1 1 .5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%- 14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%- 19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

In another preferred embodiment the fish feed composition comprises from 1 -20% of ash, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1 .0%, such as from 1.0-1.25%, for example from 1.25%- 1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%- 10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1 .0-1 1.25%, for example from 1 1 .25%-1 1.5%, such as from 1 1 .5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%- 14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%- 19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%. In another preferred embodiment the fish feed composition comprises from 1 -20% of moisture, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5- 0.75%, for example from 0.75%-1.0%, such as from 1.0-1.25%, for example from 1.25%- 1.5%, such as from 1.5-1.75%, for example from 1 .75%-2.0%, such as from 2.0- 2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from

2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5- 6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0- 8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1.25%-1 1 .5%, such as from 1 1.5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%- 12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%- 19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

In another preferred embodiment the fish feed composition comprises from 1 -20% of carbohydrate, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5- 0.75%, for example from 0.75%-1.0%, such as from 1.0-1.25%, for example from 1.25%-1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0- 2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5- 6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0- 8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1.25%-1 1 .5%, such as from 1 1.5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%- 12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%- 19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

In one preferred embodiment the fish feed according to the present invention has an amino acid composition according to table 3.

Table 3: amino acid content of fish feed composition

In one preferred embodiment the present invention relates to a fish feed composition with an Alanine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1-9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example

14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N. In one preferred embodiment the present invention relates to a fish feed composition with an Arginine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1.7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 11.1 -1 1.2 g/16 g N, such as from 1 1.2-11.3 g/16 g N, for example 1 1.3-11.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1.7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example

12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with an Aspartic acid content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1 .0 g/16 g N, such as from 1 .0-1 .1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1.5-1.6 g/16 g N, such as from 1.6-1.7 g/16 g N, for example 1.7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1 .9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1 .0 g/16 g N, such as from 1 1 .0-1 1.1 g/16 g N, for example 11.1 -1 1.2 g/16 g N, such as from 1 1.2-11.3 g/16 g N, for example 1 1 .3-1 1.4 g/16 g N, such as from 1 1.4-1 1 .5 g/16 g N, for example 1 1 .5-1 1 .6 g/16 g N, such as from 1 1 .6-1 1.7 g/16 g N, for example 1 1.7-1 1 .8 g/16 g N, such as from 1 1.8- 1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4-13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6- 13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Cystein content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1 .3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1-7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example

12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Glutamic acid content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1 .0 g/16 g N, such as from 1 .0-1 .1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1.6-1.7 g/16 g N, for example 1.7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1 .9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1 .0 g/16 g N, such as from 1 1 .0-1 1.1 g/16 g N, for example 1 1.1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1.4-1 1.5 g/16 g N, for example 1 1.5-1 1.6 g/16 g N, such as from 1 1 .6-1 1.7 g/16 g N, for example 1 1.7-1 1 .8 g/16 g N, such as from 1 1.8- 1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4-13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6- 13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Glycine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1.1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example

12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Histidine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1 .3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with an lsoleucine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1 .4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1-8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Leucine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1.1-1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Lysine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1.1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1 .3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1.1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1.7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1-13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example

14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Methionine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Phenylalanine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1 .0 g/16 g N, such as from 1 .0-1 .1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1.6-1.7 g/16 g N, for example 1.7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1 .9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1 .0 g/16 g N, such as from 1 1 .0-1 1.1 g/16 g N, for example 1 1.1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1 .3-1 1.4 g/16 g N, such as from 1 1.4-1 1.5 g/16 g N, for example 1 1.5-1 1.6 g/16 g N, such as from 1 1 .6-1 1.7 g/16 g N, for example 1 1.7-1 1 .8 g/16 g N, such as from 1 1.8- 1 1 .9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example

13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4-13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6- 13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N. In one preferred embodiment the present invention relates to a fish feed composition with a Proline content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1.7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 11.1 -1 1.2 g/16 g N, such as from 1 1.2-11.3 g/16 g N, for example 1 1.3-11.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1.7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example

12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Serine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1 .3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1.5-1.6 g/16 g N, such as from 1.6-1.7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example 11.1 -1 1.2 g/16 g N, such as from 1 1.2-11.3 g/16 g N, for example 1 1.3-11.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1.7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Threonine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Tryptophan content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1 .4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Tyrosine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1-12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N. In one preferred embodiment the present invention relates to a fish feed composition with a Taurine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1-5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1 -8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the present invention relates to a fish feed composition with a Valine content (amino acid g/16 g N) in the range from 0-20 g/16 g N, such as from 0-0.1 g/16 g N, for example 0.1 -0.2 g/16 g N, such as from 0.2-0.3 g/16 g N, for example 0.3-0.4 g/16 g N, such as from 0.4-0.5 g/16 g N, for example 0.5-0.6 g/16 g N, such as from 0.6-0.7 g/16 g N, for example 0.7-0.8 g/16 g N, such as from 0.8-0.9 g/16 g N, for example 0.9-1.0 g/16 g N, such as from 1.0-1.1 g/16 g N, for example 1 .1 -1.2 g/16 g N, such as from 1.2-1.3 g/16 g N, for example 1.3-1.4 g/16 g N, such as from 1.4-1.5 g/16 g N, for example 1 .5-1 .6 g/16 g N, such as from 1 .6-1 .7 g/16 g N, for example 1 .7-1.8 g/16 g N, such as from 1.8-1.9 g/16 g N, for example 1.9-2.0 g/16 g N, such as from 2.0-2.1 g/16 g N, for example 2.1 -2.2 g/16 g N, such as from 2.2-2.3 g/16 g N, for example 2.3-2.4 g/16 g N, such as from 2.4-2.5 g/16 g N, for example 2.5-2.6 g/16 g N, such as from 2.6-2.7 g/16 g N, for example 2.7-2.8 g/16 g N, such as from 2.8-2.9 g/16 g N, for example 2.9-3.0 g/16 g N, such as from 3.0-3.1 g/16 g N, for example 3.1 -3.2 g/16 g N, such as from 3.2-3.3 g/16 g N, for example 3.3-3.4 g/16 g N, such as from 3.4-3.5 g/16 g N, for example 3.5-3.6 g/16 g N, such as from 3.6-3.7 g/16 g N, for example 3.7-3.8 g/16 g N, such as from 3.8-3.9 g/16 g N, for example 3.9-4.0 g/16 g N, such as from 4.0-4.1 g/16 g N, for example 4.1 -4.2 g/16 g N, such as from 4.2-4.3 g/16 g N, for example 4.3-4.4 g/16 g N, such as from 4.4-4.5 g/16 g N, for example 4.5-4.6 g/16 g N, such as from 4.6-4.7 g/16 g N, for example 4.7-4.8 g/16 g N, such as from 4.8-4.9 g/16 g N, for example 4.9-5.0 g/16 g N, such as from 5.0-5.1 g/16 g N, for example 5.1 -5.2 g/16 g N, such as from 5.2-5.3 g/16 g N, for example 5.3-5.4 g/16 g N, such as from 5.4-5.5 g/16 g N, for example 5.5-5.6 g/16 g N, such as from 5.6-5.7 g/16 g N, for example 5.7-5.8 g/16 g N, such as from 5.8-5.9 g/16 g N, for example 5.9-6.0 g/16 g N, such as from 6.0-6.1 g/16 g N, for example 6.1 -6.2 g/16 g N, such as from 6.2-6.3 g/16 g N, for example 6.3-6.4 g/16 g N, such as from 6.4-6.5 g/16 g N, for example 6.5-6.6 g/16 g N, such as from 6.6-6.7 g/16 g N, for example 6.7-6.8 g/16 g N, such as from 6.8-6.9 g/16 g N, for example 6.9-7.0 g/16 g N, such as from 7.0-7.1 g/16 g N, for example 7.1 -7.2 g/16 g N, such as from 7.2-7.3 g/16 g N, for example 7.3-7.4 g/16 g N, such as from 7.4-7.5 g/16 g N, for example 7.5-7.6 g/16 g N, such as from 7.6-7.7 g/16 g N, for example 7.7-7.8 g/16 g N, such as from 7.8-7.9 g/16 g N, for example 7.9-8.0 g/16 g N, such as from 8.0-8.1 g/16 g N, for example 8.1-8.2 g/16 g N, such as from 8.2-8.3 g/16 g N, for example 8.3-8.4 g/16 g N, such as from 8.4-8.5 g/16 g N, for example 8.5-8.6 g/16 g N, such as from 8.6-8.7 g/16 g N, for example 8.7-8.8 g/16 g N, such as from 8.8-8.9 g/16 g N, for example 8.9-9.0 g/16 g N, such as from 9.0-9.1 g/16 g N, for example 9.1 -9.2 g/16 g N, such as from 9.2-9.3 g/16 g N, for example 9.3-9.4 g/16 g N, such as from 9.4-9.5 g/16 g N, for example 9.5-9.6 g/16 g N, such as from 9.6-9.7 g/16 g N, for example 9.7-9.8 g/16 g N, such as from 9.8-9.9 g/16 g N, for example 9.9-10.0 g/16 g N, such as from 10.0-10.1 g/16 g N, for example 10.1 -10.2 g/16 g N, such as from 10.2-10.3 g/16 g N, for example 10.3-10.4 g/16 g N, such as from 10.4-10.5 g/16 g N, for example 10.5-10.6 g/16 g N, such as from 10.6-10.7 g/16 g N, for example 10.7-10.8 g/16 g N, such as from 10.8-10.9 g/16 g N, for example 10.9-1 1.0 g/16 g N, such as from 1 1.0-1 1.1 g/16 g N, for example

1 1 .1 -1 1.2 g/16 g N, such as from 1 1.2-1 1.3 g/16 g N, for example 1 1.3-1 1.4 g/16 g N, such as from 1 1 .4-1 1.5 g/16 g N, for example 1 1.5-1 1 .6 g/16 g N, such as from 1 1.6- 1 1 .7 g/16 g N, for example 1 1.7-1 1.8 g/16 g N, such as from 1 1 .8-1 1.9 g/16 g N, for example 1 1.9-12.0 g/16 g N, such as from 12.0-12.1 g/16 g N, for example 12.1 -12.2 g/16 g N, such as from 12.2-12.3 g/16 g N, for example 12.3-12.4 g/16 g N, such as from 12.4-12.5 g/16 g N, for example 12.5-12.6 g/16 g N, such as from 12.6-12.7 g/16 g N, for example 12.7-12.8 g/16 g N, such as from 12.8-12.9 g/16 g N, for example 12.9-13.0 g/16 g N, such as from 13.0-13.1 g/16 g N, for example 13.1 -13.2 g/16 g N, such as from 13.2-13.3 g/16 g N, for example 13.3-13.4 g/16 g N, such as from 13.4- 13.5 g/16 g N, for example 13.5-13.6 g/16 g N, such as from 13.6-13.7 g/16 g N, for example 13.7-13.8 g/16 g N, such as from 13.8-13.9 g/16 g N, for example 13.9-14.0 g/16 g N, such as from 14.0-14.1 g/16 g N, for example 14.1 -14.2 g/16 g N, such as from 14.2-14.3 g/16 g N, for example 14.3-14.4 g/16 g N, such as from 14.4-14.5 g/16 g N, for example 14.5-14.6 g/16 g N, such as from 14.6-14.7 g/16 g N, for example 14.7-14.8 g/16 g N, such as from 14.8-14.9 g/16 g N, for example 14.9-15.0 g/16 g N, such as from 15-16 g/16 g N, for example 16-17 g/16 g N, such as from 17-18 g/16 g N, for example 18-19 g/16 g N, such as from 19-20 g/16 g N.

In one preferred embodiment the fish feed according to the present invention has an lipid profile according to table 4.

Table 4: Lipid profile of fish feed composition

In one preferred embodiment the present invention relates to a fish feed composition with a 14:0 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/10O g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/100 g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1.5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1-3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/100 g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-11.8 g/100 g lipid, such as from 11.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/100 g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 16:0 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1.4-1.5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/10O g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:0 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-11.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1-13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:0 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/10O g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-11.6 g/100 g lipid, such as from 11.6-11.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/10O g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 16:1 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/100 g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1-6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/10O g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:1 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/100 g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:1 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/100 g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 22:1 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0- 0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/10O g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 24:1 n-9 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/100 g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1-9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 16:2 n-4 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid. In one preferred embodiment the present invention relates to a fish feed composition with a 16:3 n-4 content (g/1 OO g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1.7-1.8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/10O g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 16:4 n-1 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1.5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/10O g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/100 g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/10O g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 11.0-1 1.1 g/10O g lipid, for example 11.1-1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/10O g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:2 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/100 g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1.5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1-3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/100 g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-11.8 g/100 g lipid, such as from 11.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/100 g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:3 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1.4-1.5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/10O g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:2 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-11.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1-13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:3 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/10O g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-11.6 g/100 g lipid, such as from 11.6-11.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/10O g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:4 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/100 g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1-6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/10O g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 22:4 n-6 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/100 g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:3 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/100 g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 18:4 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/10O g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/10O g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:3 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/100 g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1-9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 20:4 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/100 g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid. In one preferred embodiment the present invention relates to a fish feed composition with a 20:5 n-3 content (g/1 OO g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1.7-1.8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/10O g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/10O g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1.3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 21 :5 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1.1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1.5 g/100 g lipid, for example 1.5- 1.6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/10O g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/100 g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 11.0-1 1.1 g/10O g lipid, for example 11.1-1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/10O g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 22:5 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1.0 g/100 g lipid, such as from 1.0- 1 .1 g/100 g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1 .4-1 .5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1-3.2 g/100 g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/100 g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/100 g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-11.8 g/100 g lipid, such as from 11.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/10O g lipid, for example 12.1 -12.2 g/100 g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/100 g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/10O g lipid.

In one preferred embodiment the present invention relates to a fish feed composition with a 22:6 n-3 content (g/100 g lipid) in the range from 0-20 g/100 g lipid, such as from 0-0.1 g/10O g lipid, for example 0.1 -0.2 g/100 g lipid, such as from 0.2-0.3 g/100 g lipid, for example 0.3-0.4 g/100 g lipid, such as from 0.4-0.5 g/100 g lipid, for example 0.5- 0.6 g/100 g lipid, such as from 0.6-0.7 g/100 g lipid, for example 0.7-0.8 g/100 g lipid, such as from 0.8-0.9 g/100 g lipid, for example 0.9-1 .0 g/100 g lipid, such as from 1.0- 1 .1 g/10O g lipid, for example 1 .1 -1 .2 g/100 g lipid, such as from 1 .2-1 .3 g/100 g lipid, for example 1.3-1.4 g/100 g lipid, such as from 1.4-1.5 g/100 g lipid, for example 1.5- 1 .6 g/100 g lipid, such as from 1.6-1.7 g/100 g lipid, for example 1 .7-1 .8 g/100 g lipid, such as from 1.8-1.9 g/100 g lipid, for example 1 .9-2.0 g/100 g lipid, such as from 2.0- 2.1 g/10O g lipid, for example 2.1 -2.2 g/100 g lipid, such as from 2.2-2.3 g/100 g lipid, for example 2.3-2.4 g/100 g lipid, such as from 2.4-2.5 g/100 g lipid, for example 2.5- 2.6 g/100 g lipid, such as from 2.6-2.7 g/100 g lipid, for example 2.7-2.8 g/100 g lipid, such as from 2.8-2.9 g/100 g lipid, for example 2.9-3.0 g/100 g lipid, such as from 3.0- 3.1 g/10O g lipid, for example 3.1 -3.2 g/10O g lipid, such as from 3.2-3.3 g/100 g lipid, for example 3.3-3.4 g/100 g lipid, such as from 3.4-3.5 g/100 g lipid, for example 3.5- 3.6 g/100 g lipid, such as from 3.6-3.7 g/100 g lipid, for example 3.7-3.8 g/100 g lipid, such as from 3.8-3.9 g/100 g lipid, for example 3.9-4.0 g/100 g lipid, such as from 4.0- 4.1 g/10O g lipid, for example 4.1 -4.2 g/100 g lipid, such as from 4.2-4.3 g/100 g lipid, for example 4.3-4.4 g/100 g lipid, such as from 4.4-4.5 g/100 g lipid, for example 4.5- 4.6 g/100 g lipid, such as from 4.6-4.7 g/100 g lipid, for example 4.7-4.8 g/100 g lipid, such as from 4.8-4.9 g/100 g lipid, for example 4.9-5.0 g/100 g lipid, such as from 5.0- 5.1 g/10O g lipid, for example 5.1 -5.2 g/10O g lipid, such as from 5.2-5.3 g/100 g lipid, for example 5.3-5.4 g/100 g lipid, such as from 5.4-5.5 g/100 g lipid, for example 5.5- 5.6 g/100 g lipid, such as from 5.6-5.7 g/100 g lipid, for example 5.7-5.8 g/100 g lipid, such as from 5.8-5.9 g/100 g lipid, for example 5.9-6.0 g/100 g lipid, such as from 6.0- 6.1 g/10O g lipid, for example 6.1 -6.2 g/100 g lipid, such as from 6.2-6.3 g/100 g lipid, for example 6.3-6.4 g/100 g lipid, such as from 6.4-6.5 g/100 g lipid, for example 6.5- 6.6 g/100 g lipid, such as from 6.6-6.7 g/100 g lipid, for example 6.7-6.8 g/100 g lipid, such as from 6.8-6.9 g/100 g lipid, for example 6.9-7.0 g/100 g lipid, such as from 7.0- 7.1 g/10O g lipid, for example 7.1 -7.2 g/100 g lipid, such as from 7.2-7.3 g/100 g lipid, for example 7.3-7.4 g/100 g lipid, such as from 7.4-7.5 g/100 g lipid, for example 7.5- 7.6 g/100 g lipid, such as from 7.6-7.7 g/100 g lipid, for example 7.7-7.8 g/100 g lipid, such as from 7.8-7.9 g/100 g lipid, for example 7.9-8.0 g/100 g lipid, such as from 8.0- 8.1 g/10O g lipid, for example 8.1 -8.2 g/100 g lipid, such as from 8.2-8.3 g/100 g lipid, for example 8.3-8.4 g/100 g lipid, such as from 8.4-8.5 g/100 g lipid, for example 8.5- 8.6 g/100 g lipid, such as from 8.6-8.7 g/100 g lipid, for example 8.7-8.8 g/100 g lipid, such as from 8.8-8.9 g/100 g lipid, for example 8.9-9.0 g/100 g lipid, such as from 9.0- 9.1 g/10O g lipid, for example 9.1 -9.2 g/100 g lipid, such as from 9.2-9.3 g/100 g lipid, for example 9.3-9.4 g/100 g lipid, such as from 9.4-9.5 g/100 g lipid, for example 9.5- 9.6 g/100 g lipid, such as from 9.6-9.7 g/100 g lipid, for example 9.7-9.8 g/100 g lipid, such as from 9.8-9.9 g/100 g lipid, for example 9.9-10.0 g/100 g lipid, such as from 10.0-10.1 g/10O g lipid, for example 10.1 -10.2 g/100 g lipid, such as from 10.2-10.3 g/100 g lipid, for example 10.3-10.4 g/100 g lipid, such as from 10.4-10.5 g/100 g lipid, for example 10.5-10.6 g/100 g lipid, such as from 10.6-10.7 g/100 g lipid, for example 10.7-10.8 g/100 g lipid, such as from 10.8-10.9 g/100 g lipid, for example 10.9-1 1.0 g/10O g lipid, such as from 1 1.0-1 1.1 g/10O g lipid, for example 1 1 .1 -1 1.2 g/100 g lipid, such as from 1 1 .2-1 1.3 g/100 g lipid, for example 1 1 .3-1 1.4 g/100 g lipid, such as from 1 1.4-1 1.5 g/100 g lipid, for example 1 1.5-1 1.6 g/100 g lipid, such as from 1 1 .6-1 1.7 g/100 g lipid, for example 1 1.7-1 1 .8 g/100 g lipid, such as from 1 1.8-1 1.9 g/100 g lipid, for example 1 1 .9-12.0 g/100 g lipid, such as from 12.0-12.1 g/100 g lipid, for example 12.1 -12.2 g/10O g lipid, such as from 12.2-12.3 g/100 g lipid, for example 12.3-12.4 g/100 g lipid, such as from 12.4-12.5 g/100 g lipid, for example 12.5-12.6 g/100 g lipid, such as from 12.6-12.7 g/100 g lipid, for example 12.7-12.8 g/100 g lipid, such as from 12.8-12.9 g/10O g lipid, for example 12.9-13.0 g/100 g lipid, such as from 13.0-13.1 g/10O g lipid, for example 13.1 -13.2 g/100 g lipid, such as from 13.2-13.3 g/100 g lipid, for example 13.3-13.4 g/100 g lipid, such as from 13.4-13.5 g/100 g lipid, for example 13.5-13.6 g/100 g lipid, such as from 13.6-13.7 g/100 g lipid, for example 13.7-13.8 g/100 g lipid, such as from 13.8-13.9 g/100 g lipid, for example 13.9-14.0 g/100 g lipid, such as from 14.0-14.1 g/100 g lipid, for example 14.1 -14.2 g/100 g lipid, such as from 14.2-14.3 g/10O g lipid, for example 14.3-14.4 g/100 g lipid, such as from 14.4-14.5 g/10O g lipid, for example 14.5-14.6 g/100 g lipid, such as from 14.6-14.7 g/100 g lipid, for example 14.7-14.8 g/100 g lipid, such as from 14.8-14.9 g/100 g lipid, for example 14.9-15.0 g/100 g lipid, such as from 15-16 g/100 g lipid, for example 16-17 g/100 g lipid, such as from 17-18 g/100 g lipid, for example 18-19 g/100 g lipid, such as from 19-20 g/100 g lipid.

In another preferred embodiment the fish feed composition comprises the following lipid profile (gram per 100 g lipid): sum of PUFA is 24.7 g per 100 g lipid and/or sum of total FA is 66 gram per 100 g lipid.

Nutrition and feed ingredients

Dietary nutrients are essential for the construction of living tissues. They are also a source of stored energy for digestion, absorption, growth, reproduction and other life processes. It is an object of the present invention to provide a feed composition that ensures growth and survival of aquatic organisms, especially sensitive organisms such as marine larvae. Therefore, the feed composition must comprise a series of ingredients such as a balanced set of nutrients (protein and lipid sources, mineral, vitamins and so on) binders, attractants, special nutrients, and immunestimulants. Often such feed compositions will comprise the appropriate levels of the various nutrients as required for each species, for example (of dry weight) the feed may comprise protein (18-50%), lipid (10-25%), carbohydrate (15-20%), ash (< 8.5%), phosphorus (< 1.5%), water (< 10%), and trace amounts of vitamins, minerals and other supplements.

In another preferred embodiment the fish feed composition comprises the appropriate levels of the various nutrients as required for each species, for example (of dry weight) the feed may comprise protein (18-70%), lipid (5-25%), carbohydrate (10-30%), ash (5- 15%), water (< 12%), and trace amounts of vitamins, minerals and other supplements.

Protein. -energy ratio

The optimum protein :energy ratio is defined by the following equation:

Digestible protein (weight %)/Digestible energy (kcal/g) = protein :energy ratio (mg/kcal)

Digestible protein and energy can be estimated from ingredient composition of the diet.

The present invention relates in one embodiment to a fish feed composition with a protein :energy ratio in the range from about 50 mg/kcal to about 200 mg/kcal; for example from about 50 mg/kcal to about 190 mg/kcal, such as from about 50 mg/kcal to about 180 mg/kcal, for example from about 50 mg/kcal to about 170 mg/kcal, such as from about 50 mg/kcal to about 160 mg/kcal, for example from about 50 mg/kcal to about 150 mg/kcal, such as from about 50 mg/kcal to about 140 mg/kcal, for example from about 50 mg/kcal to about 130 mg/kcal, such as from about 50 mg/kcal to about 120 mg/kcal, for example from about 50 mg/kcal to about 1 10 mg/kcal, such as from about 50 mg/kcal to about 100 mg/kcal, for example from about 50 mg/kcal to about 90 mg/kcal, such as from about 50 mg/kcal to about 80 mg/kcal, for example from about 50 mg/kcal to about 70 mg/kcal, such as from about 50 mg/kcal to about 60 mg/kcal, for example from about 60 mg/kcal to about 200 mg/kcal, such as from about 70 mg/kcal to about 200 mg/kcal, for example from about 80 mg/kcal to about 200 mg/kcal, such as from about 90 mg/kcal to about 200 mg/kcal, for example from about 100 mg/kcal to about 200 mg/kcal, such as from about 1 10 mg/kcal to about 200 mg/kcal, for example from about 120 mg/kcal to about 200 mg/kcal, such as from about 130 mg/kcal to about 200 mg/kcal, for example from about 140 mg/kcal to about 200 mg/kcal, such as from about 150 mg/kcal to about 200 mg/kcal, for example from about 160 mg/kcal to about 200 mg/kcal, such as from about 170 mg/kcal to about 200 mg/kcal, for example from about 180 mg/kcal to about 200 mg/kcal, such as from about 190 mg/kcal to about 200 mg/kcal, for example from about 50 mg/kcal to about 60 mg/kcal, such as from about 60 mg/kcal to about 70 mg/kcal, for example from about 70 mg/kcal to about 80 mg/kcal, such as from about 80 mg/kcal to about 90 mg/kcal, for example from about 90 mg/kcal to about 100 mg/kcal, such as from about 100 mg/kcal to about 1 10 mg/kcal, for example from about 1 10 mg/kcal to about 120 mg/kcal, such as from about 120 mg/kcal to about 130 mg/kcal, for example from about 130 mg/kcal to about 140 mg/kcal, such as from about 140 mg/kcal to about 150 mg/kcal, for example from about 150 mg/kcal to about 160 mg/kcal, such as from about 160 mg/kcal to about 170 mg/kcal, for example from about 170 mg/kcal to about 180 mg/kcal, such as from about 180 mg/kcal to about 190 mg/kcal, for example from about 190 mg/kcal to about 200 mg/kcal.

Energy requirement

In one preferred embodiment the present invention relates to a fish feed composition comprising from 500 kcal/kg diet to 5000 kcal/kg diet, such as from 500 to 600 kcal/kg, for example from 600 to 700 kcal/kg, from 700 to 800 kcal/kg, for example from 800 to 900 kcal/kg, from 900 to 1000 kcal/kg, for example from 1000 to 1 100 kcal/kg, from 1 100 to 1200 kcal/kg, for example from 1200 to 1300 kcal/kg, from 1300 to 1400 kcal/kg, for example from 1400 to 1500 kcal/kg, from 1500 to 1600 kcal/kg, for example from 1600 to 1700 kcal/kg, from 1700 to 1800 kcal/kg, for example from 1800 to 1900 kcal/kg, from 1900 to 2000 kcal/kg, for example from 2000 to 2100 kcal/kg, from 2100 to 2200 kcal/kg, for example from 2200 to 2300 kcal/kg, from 2300 to 2400 kcal/kg, for example from 2400 to 2500 kcal/kg, from 2500 to 2600 kcal/kg, for example from 2600 to 2700 kcal/kg, from 2700 to 2800 kcal/kg, for example from 2800 to 2900 kcal/kg, from 2900 to 3000 kcal/kg, for example from 3000 to 3100 kcal/kg, from 3100 to 3200 kcal/kg, for example from 3200 to 3300 kcal/kg, from 3300 to 3400 kcal/kg, for example from 3400 to 3500 kcal/kg, from 3500 to 3600 kcal/kg, for example from 3600 to 3700 kcal/kg, from 3700 to 3800 kcal/kg, for example from 3800 to 3900 kcal/kg, from 3900 to 4000 kcal/kg, for example from 4000 to 4100 kcal/kg, from 4100 to 4200 kcal/kg, for example from 4200 to 4300 kcal/kg, from 4300 to 4400 kcal/kg, for example from 4400 to 4500 kcal/kg, from 4500 to 4600 kcal/kg, for example from 4600 to 4700 kcal/kg, from 4700 to 4800 kcal/kg, for example from 4800 to 4900 kcal/kg, from 4900 to 5000 kcal/kg.

Protein source Aquatic environments are generally rich in protein and poor in carbohydrate and it is of importance that a feed composition reflects the demands of the organisms to which it is given. To create an optimum diet, the ratio of protein to energy must be determined separately for each species. Excess energy relative to protein content in the diet may result in high lipid deposition. Because aquatic species feed to meet their energy requirements, diets with excessive energy levels may result in decreased feed intake and reduced weight gain. Similarly, a diet with inadequate energy content can result in reduced weight gain because the fish cannot eat enough feed to satisfy their energy Well formulated feed compositions have a well-balanced energy to protein ratio. Therefore the feed composition must comprise at least one source of protein. Furthermore, because protein is the most expensive part of aquatic feeds, it is important to accurately determine the protein requirements for each species and size of cultured aquatic species. Proteins are formed by linkages of individual amino acids and although over 200 amino acids occur in nature, only about 20 amino acids are common. Of these, 10 are essential (indispensable) amino acids that cannot be synthesized by e.g. fish. The 10 essential amino acids that must be supplied by the diet are: methionine, arginine, threonine, tryptophan, histidine, isoleucine, lysine, leucine, valine and phenylalanine. Of these, lysine and methionine are often the first limiting amino acids. Feeds prepared with plant (soybean meal) protein typically are low in methionine; therefore, extra methionine must be added to soybean-meal based diets in order to promote optimal growth and health. It is important to know and match the protein requirements and the amino acid requirements of each species reared. Protein levels in aquaculture feeds generally average 18-20% for marine shrimp, 28- 32% for catfish, 32-38% for tilapia, 38-42% for hybrid striped bass. Protein requirements usually are lower for herbivorous fish (plant eating) and omnivorous fish (plant-animal eaters) than they are for carnivorous (flesh-eating) fish, and are higher for fish reared in high density (recirculating aquaculture) than low density (pond aquaculture) systems. Protein requirements generally are higher for smaller /younger species / members of a species. As the animals grow larger, their protein requirements usually decrease. Protein requirements also vary with rearing environment, water temperature and water quality, as well as the genetic composition and feeding rates of the fish. Protein is used for growth if adequate levels of fats and carbohydrates also are present in the diet. If not, protein may be used for energy and life support rather than growth.

A source of protein may be in the form of live or dead (e.g. dried, frozen or freezedried) organisms or a product obtained from live or dead organisms. The product may comprise a fractionated part of the organisms from which it is derived or be purified here from. The protein source may furthermore be wholly or partly derived by synthetic means such as proteins and/or peptides synthesized or moderated/adapted from their naturally occurring counterparts.

Whole organisms may be part of the feed examples of such whole organisms include but are not limited to: yeast, bacteria, microalgae, macroalgae, phytoplankton or zooplanton, artemia, rotifers, worms such as tubifex worms, daphnia, krill, and so forth. The organisms may be included in the feed in a live form (such as in a cyst or spore stage) or in a dead form and may be whole or fractioned in several ways. The feed may also comprise micro organisms such as probiotic elements (bacteria such as bacillus species, lactobacillus species, saccharomyces species and schizosaccharomyces species.) which may colonize the gut and facilitate uptake of the other nutrients of the feed.

The feed of the present invention may thus comprise meal, solubles or silage from any type of animal. Preferably, the feed comprises a protein source / stems from an animal originating from an aquatic environment such as fish, squid, krill, and others. The at least one protein source may thus be fish meal which is a commercial product consisting of the waste from fisheries after the human-consumable material is removed, or from whole fish which may or may not be suitable for human consumption. The fish are ground, cooked and processed to yield three products: presscake, fish solubles and oil. The final fish meal product may be simple presscake meal, full meal (all the soluble are added back into the presscake), or some combination of presscake and soluble. Fish meal may thus be a brown powder or cake obtained by pressing the whole fish or fish trimmings to remove the fish oil. Fish meal used for feed may be stabilized with an antioxidant such as ethoxquin to prevent the fish oil from becoming rancid. Fish meal may have different ash contents and corresponding protein contents depending on whether or not a large amount of bone is removed prior to the fish meal processing. If large amounts of bone are removed the resulting meal has significantly reduced ash content, and a corresponding increase in protein. This meal is ideal in situations where a lower mineral content is needed. This type of meal furthermore has the advantage of a much smaller particle size.

The amino acid quality of fish is excellent, but excessive heating during the drying process can reduce digestibility of the protein fraction and complex some of the amino acids, so that they are not available. The composition of the fish meal can vary depending upon what substrate is used and the method used to prepare the meal. If fish that have been allowed to degrade prior to being processed are used in preparing fish meal, then the resultant fish meal will be of lower quality. It is an object of the present invention to provide a feed comprising a high quality fish meal.

The fish meal may thus comprise meal from a variety of fish or be derived from a single type of fish such as tuna fish meal, whitefish meal (may originate from one or more of the following: cod, haddock, hake, flounder, pollack, and other), redfish meal (from e.g. ocean perch) anchovy meal, herring meal, menhaden meal, salmon meal and others.

Other protein sources may be squid meal, krill meal, fish hydrosylate, skim milk powder, legumes, wheat gluten and mixtures of essential amino acids comprising for example, lysine and methionine among any of the other many naturally occurring amino acids, and peptide mixes. High in many valuable nutrients, krill and krill meal is often used as a diet component and has, apart from good protein content, strong attractive, nutritional and immune enhancing properties. Preferably the feed composition comprises krill meal.

Preferably the present invention comprises at least one protein source such as high quality fish meal, krill meal, squid meal or fish hydrosylate. More preferably, the present invention comprises at least two, such as three or more protein sources such as yeast extract, fish meal, krill meal, squid meal or fish hydrosylate, live organisms as listed above or a commercial peptide or an amino acid mixture.

In an embodiment of the present invention the one or more protein sources comprise between 5 and 95% of the feed, such as between 10 and 90%, such as between 15 and 80%, such as between 20 and 75% such as between 25 and 70%, such as between 30 and 65%, such as between 35 and 60%, such as between 40 and 55%, such as between 45 and 50%, or between 30 and 50%, such as between 35 and 45% such as around 40%, or such as between 50 and 70%, such as between 55 and 65% such as around 60% of the feed composition.

In another preferred embodiment of the present invention the one or more protein sources comprise between 18 and 70% of the feed, such as from 18 to 20%, for example 20 to 22%, such as from 22 to 24%, for example 24 to 26%, such as from 26 to 28%, for example 28 to 30%, such as from 30 to 32%, for example 32 to 34%, such as from 34 to 36%, for example 36 to 38%, such as from 38 to 40%, for example 40 to 42%, such as from 42 to 44%, for example 44 to 46%, such as from 46 to 48%, for example 48 to 50%, such as from 50 to 52%, for example 52 to 54%, such as from 54 to 56%, for example 56 to 58%, such as from 58 to 60%, for example 60 to 62%, such as from 62 to 64%, for example 64 to 66%, such as from 66 to 68%, for example 68 to 70%.

In one embodiment the protein source can be selected from the group consisting of Casein, gelatine, Whole egg protein, Tuna muscle meal, fish protein concentrate, amino acids mix, Cod muscle, fishmeal, soy proteinate, White fishmeal

An absolute requirement for 10 amino acids (arginine, histidine, isoleucine, leucine, lysine, methionine, phenylalanine, threonine, tryptophan, and valine) has been demonstrated in all fish species examined so far. For many fish species, growth rates produced by diets with large amounts of free amino acids are inferior to diets of similar amino acid composition in which the nitrogen component is protein. Thus amino acid requirements obtained in this way are based on growth rates below the optimum.

For most indispensable amino acids, deficiency is manifest as a reduction in weight gain. In certain species of fish, however, a deficiency of methionine or tryptophan leads to pathologies, because these amino acids are not only incorporated into proteins but also used for the synthesis of other essential compounds.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Arginine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%. The present invention relates in one embodiment to a fish feed composition wherein the percentage of Histidine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1.5%, such as from 1.5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of lsoleucine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Leucine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Lysine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Methionine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Phenylalanine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1%, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1%, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1 %, for example from 1.1 to 1 .2%, such as from 1.2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1 .5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1 .8%, such as from 1.8 to 1.9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1%, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1 %, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to

5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1%, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1 %, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Threonine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Tryptophan of dietary protein is in the range from 0.1 to 10%, such as from 0.1 to 9.5%, for example from 1.0 to 9.0%, such as from 0.1 to 8.5%, for example from 1.0 to 8.0%, such as from 0.1 to 7.5%, for example from 1.0 to 7.0%, such as from 0.1 to 6.5%, for example from 1.0 to 6.0%, such as from 0.1 to 5.5%, for example from 1.0 to 5.0%, such as from 0.1 to 4.5%, for example from 1.0 to 4.0%, such as from 0.1 to 3.5%, for example from 1.0 to 3.0%, such as from 0.1 to 2.5%, for example from 1.0 to 2.0%, such as from 0.1 to 1.5%, for example from 1.0 to 1.0%, such as from 0.1 to 0.5%, for example from 0.5 to 10%, such as from 1.0 to 10%, for example from 1.5 to 10%, such as from 2.0 to 10%, for example from 2.5 to 10%, such as from 3.0 to 10%, for example from 3.5 to 10%, such as from 4.0 to 10%, for example from 4.5 to 10%, such as from 5.0 to 10%, for example from 5.5 to 10%, such as from 6.0 to 10%, for example from 6.5 to 10%, such as from 7.0 to 10%, for example from 7.5 to 10%, such as from 8.0 to 10%, for example from 8.5 to 10%, such as from 9.0 to 10%, for example from 9.5 to 10%, such as from 0.1 to 1%, for example from 1 to 2%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1 .1 %, such as from 1 .1 to 1 .2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1 .6%, for example from 1.6 to 1 .7%, such as from 1 .7 to 1 .8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Valine of dietary protein is in the range from 0.5 to 20 %, such as from 0.5 to 18%, for example from 0.5 to 16%, such as from 0.5 to 14%, for example from 0.5 to 12%, such as from 0.5 to 10%, for example from 0.5 to 8%, such as from 0.5 to 6%, for example from 0.5 to 4%, such as from 0.5 to 2%, for example from 2 to 20%, such as from 4 to 20%, for example from 6 to 20%, such as from 8 to 20%, for example from 10 to 20%, such as from 12 to 20%, for example from 14 to 20%, such as from 16 to 20%, for example from 18 to 20%, such as from 0.5 to 1 %, for example from 1 to 1 .5%, such as from 1 .5 to 2%, for example from 2 to 2.5%, such as from 2 to 3%, for example from 3 to 4%, such as from 4 to 5%, for example from 5 to 6%, such as from 6 to 7%, for example from 7 to 8%, such as from 8 to 9%, for example from 9 to 10%, such as from 10 to 1 1 %, for example from 1 1 to 12%, such as from 12 to 13%, for example from 13 to 14%, such as from 14 to 15%, for example from 15 to 16%, such as from 16 to 17%, for example from 17 to 18%, such as from 18 to 19%, for example from 19 to 20%, such as from 1.0 to 1.1%, for example from 1.1 to 1.2%, such as from 1 .2 to 1.3%, for example from 1.3 to 1.4%, such as from 1.4 to 1.5%, for example from 1.5 to 1.6%, such as from 1.6 to 1.7%, for example from 1.7 to 1.8%, such as from 1.8 to 1 .9%, for example from 1.9 to 2.0%, such as from 2.0 to 2.1%, for example from 2.1 to 2.2%, such as from 2.2 to 2.3%, for example from 2.3 to 2.4%, such as from 2.4 to 2.5%, for example from 2.5 to 2.6%, such as from 2.6 to 2.7%, for example from 2.7 to 2.8%, such as from 2.8 to 2.9%, for example from 2.9 to 3.0%, such as from 3.0 to 3.1 %, for example from 3.1 to 3.2%, such as from 3.2 to 3.3%, for example from 3.3 to 3.4%, such as from 3.4 to 3.5%, for example from 3.5 to 3.6%, such as from 3.6 to 3.7%, for example from 3.7 to 3.8%, such as from 3.8 to 3.9%, for example from 3.9 to 4.0%, such as from 4.0 to 4.1%, for example from 4.1 to 4.2%, such as from 4.2 to 4.3%, for example from 4.3 to 4.4%, such as from 4.4 to 4.5%, for example from 4.5 to 4.6%, such as from 4.6 to 4.7%, for example from 4.7 to 4.8%, such as from 4.8 to 4.9%, for example from 4.9 to 5.0%, such as from 5.0 to 5.1%, for example from 5.1 to 5.2%, such as from 5.2 to 5.3%, for example from 5.3 to 5.4%, such as from 5.4 to 5.5%, for example from 5.5 to 5.6%, such as from 5.6 to 5.7%, for example from 5.7 to 5.8%, such as from 5.8 to 5.9%, for example from 5.9 to 6.0%, such as from 6.0 to 6.1 %, for example from 6.1 to 6.2%, such as from 6.2 to 6.3%, for example from 6.3 to 6.4%, such as from 6.4 to 6.5%, for example from 6.5 to 6.6%, such as from 6.6 to 6.7%, for example from 6.7 to 6.8%, such as from 6.8 to 6.9%, for example from 6.9 to 7.0%, such as from 7.0 to 7.1%, for example from 7.1 to 7.2%, such as from 7.2 to 7.3%, for example from 7.3 to 7.4%, such as from 7.4 to 7.5%, for example from 7.5 to 7.6%, such as from 7.6 to 7.7%, for example from 7.7 to 7.8%, such as from 7.8 to 7.9%, for example from 7.9 to 8.0%.

Lipid source

Lipids play diverse and important roles in nutrition and health. Many lipids are absolutely essential for life. In living organisms, lipids are used for energy storage, serve as structural components of cell membranes, and are important hormones or contain essential fatty acids. Lipids are high-energy nutrients that can be utilized to partially substitute for protein in aquaculture feeds. Lipids supply about twice the energy as proteins and carbohydrates. Lipids typically comprise about 15% of fish diets, supply essential fatty acids (EFA) and serve as transporters for fat-soluble vitamins. A recent trend in aquaculture feeds is to use higher levels of lipids in the diet. Although increasing dietary lipids can help reduce the high costs of diets by partially sparing protein in the feed, problems such as excessive fat deposition in the liver can decrease the health and market quality of the farmed species.

Simple lipids include fatty acids and triacylglycerols. Fish and other aquatic species typically require fatty acids of the omega 3 and 6 (n-3 and n-6) families. Fatty acids can be: a) saturated fatty acids (SFA, no double bonds), b) polyunsaturated fatty acids (PUFA, >2 double bonds), or c) highly unsaturated fatty acids (HUFA; > 4 double bonds). Marine fish oils are naturally high (>30%) in omega 3 HUFA, and are excellent sources of lipids for the manufacture of feed compositions for aquatic species.

It is an object of the present invention to provide a feed composition comprising at least one source of lipids. Lipids may be obtained from a several sources, examples hereof include and are not limited to: Fish oil, Vegetable oil, Lecithin, Cholesterol, and any long chain unsaturated fatty acids and the calcium salts hereof.

Fish oil is oil derived from the tissues of oily fish. Oily fishes include menhaden, herring, eel, anchovies, mackerel, salmon, sardines, trout, tuna and more. Fish oil naturally contains the HUFA / Omega-3 fatty acids eicosapentaenoic acid (EPA: 20:5n-3) and docosahexaenoic acid (DHA: 22:6n-3) the levels of which are especially high in fatty fish like mackerel, lake trout, herring, sardines, albacore tuna and salmon. Fish oil may be isolated from a single species of fish or may be derived from a mixture of different fish species. Depending on the species reared either n-3, n-6 or a combination of n-3 and n-6 fatty acids ensure the optimal conditions for growth and health. An example of a preferred N-6 / omega 6 fatty acid is arachidonic acid.

Vegetable oils and fats are substances composed of triglycerides, derived from plants. Examples hereof include and are not limited to canola (rapeseed), sunflower, palm, soybean, peanut, cottonseed, olive and linseed. Of these, canola, sunflower and linseed oil are common sources of lipids in feed compositions for aquatic species.

Lecithin is mostly a mixture of glycolipids, triglycerides, and phospholipids (e.g. phosphatidylcholine, phosphatidylethanolamine, and phosphatidylinositol). However, in biochemistry, lecithin is usually used as a synonym for pure phosphatidylcholine, a phospholipid which is the major component of a phosphatide fraction which may be isolated from either egg yolk or soy beans from which it is mechanically or chemically extracted using hexane. Lecithin is commercially available in high purity as a food supplement and for medical uses. Preferably the source of lecithin is soy bean.

Cholesterol is a sterol and a lipid found in the cell membranes of all body tissues, and transported in the blood plasma of all animals. Lesser amounts of cholesterol are also found in plant membranes. Thus both animals and plants may be a source of cholesterol. It is an object of the present invention to provide at least one lipid source, such as two, three or more lipid sources, examples of the preferred lipid sources being: phospholipids and/or lecithins derived from plant sources, cholesterol and/or fish oil.

The lipids of the feed composition according to the present invention constitute between 0.5 to 50% of the feed (by % inclusion) such as between 1 and 45%, such as between 1 .5 and 40% such as between 2 and 35%, such as between 2.5 and 30%, such as between 3 and 25%, such as between 3.5 and 30%, such as between 4 and 25%, or between 4.5 and 20%, such as between 5 and 15%, such as between 5.5 and 10%, such as between 6 and 9%, such as between 6.5 and 8%, such as around 7%, or such as between 2 and 10%, such as between 3 and 9% such as between 4 and 8%, such as between 5 and 7% such as around 6% of the feed composition.

In another preferred embodiment the lipids of the feed composition according to the present invention constitute from 5 to 25% of the feed, such as from 5 to 6%, for example from 6-7%, such as from 7 to 8%, for example from 8-9%, such as from 9 to 10%, for example from 10-1 1 %, such as from 1 1 to 12%, for example from 12-13%, such as from 13 to 14%, for example from 14-15%, such as from 15 to 16%, for example from 16-17%, such as from 17 to 18%, for example from 18-19%, such as from 19 to 20%, for example from 20-21 %, such as from 21 to 22%, for example from 22-23%, such as from 23 to 24%, for example from 24-25%.

Dietary lipids are important sources of energy and of essential fatty acids (EFA) that are needed for normal growth and development. They also assist in the absorption of fat-soluble vitamins. Dietary lipids, mainly in the form of triacylglycerols, are hydrolyzed by digestive enzymes to a mixture of free fatty acids and 2-monoglycerides. These compounds are then absorbed and either used for the synthesis of various cellular components or catabolized for energy.

In one embodiment the dietary lipids contain both saturated and unsaturated fatty acids. Fatty acids may be designated by numbering either from the methyl or carboxyl terminal. The notation from the methyl terminal is most convenient for many nutritional purposes and is used here. It involves three numbers given in sequence, the first denoting the number of carbon atoms; the second, following a colon, the number of double bonds; and the third, designated as (n-) indicates the number of carbon atoms between the methyl terminal and the first double bond. The term polyunsaturated fatty acid (PUFA) normally refers to fatty acids with 18 or more carbon atoms and two or more double bonds.

The present invention relates in one preferred embodiment to a fish feed composition comprising one or more of the dietary lipids described herein above.

Essential fatty acids

In common with other vertebrates, fish cannot synthesize either 18:2(n-6) or 18:3(n-3) de novo. Hence one or both of these fatty acids must be supplied preformed in the diet, depending on the EFA requirements. In addition, fish vary considerably in their ability to convert 18-carbon unsaturated fatty acids to longer-chain, more highly unsaturated fatty acids of the same series. The EFA requirement of the fish is thus related, to some extent, to their ability to modify these fatty acids metabolically.

A major difference appears to exist between freshwater and stenohaline marine fish (those unable to withstand a wide variation in water salinity). In general, freshwater fish require either dietary linoleic acid, 18:2(n-6), or linolenic acid, 18:3(n-3), or both, whereas stenohaline marine fish require dietary eicosapentaenoic acid (EPA), 20:5(n- 3), and/or docosahexaenoic acid (DHA), 22:6(n-3).

Among the freshwater species, the ayu, channel catfish, coho salmon, and rainbow trout require 18:3(n-3) or EPA and/or DHA. Chum salmon, common carp, and Japanese eel are examples of fish that require an equal mixture of 18:2(n-6) and

18:3(n-3); whereas, Nile tilapia and Zulu's tilapia are examples of fish that only require 18:2(n-6) for maximum growth and feed efficiency. Other fish species such as striped bass, however, require n-3 PUFA and cannot chain elongate 18:3(n-3).

The principal gross signs of EFA deficiency reported for various fishes are dermal signs (fin rot), a shock syndrome, myocarditis, reduced growth rate, reduced feed efficiency, and increased mortality. Essential fatty acid deficiency has also been shown to reduce the reproductive performance of some fish including common carp, rainbow trout and red sea bream.

In fish species that can further desaturate and chain elongate 18:2(n-6) or 18:3(n-3), an absence of either of these fatty acids in the diet leads to the desaturation and chain elongation of oleic acid, 18:1 (n-9), to 20:3(n-9), which is characteristic of an EFA deficiency in many terrestrial animals. Thus when EFAs are deficient, increased concentrations of 20:3(n-9) are incorporated into tissue polar lipids in place of 20:4(n- 6), 20:5(n-3), or 22:6(n-3).

n-3 PUFAs such as EPA and DHA, are required for normal growth and development of for example ayu and red sea bream larvae. High mortalities and abnormalities, such as underdeveloped swim bladder and scoliosis, have been observed in e.g. red sea bream larvae reared on rotifers and Artemia spp., either devoid of n-3 PUFAs or containing only low concentrations of n-3 PUFAs. Subsequently, EPA and/or DHA have been shown to be essential for various marine fish larvae, such as ayu, red sea bream, striped jack, and gilthead sea bream, as well as for the larvae of one freshwater fish, striped bass.

The essential fatty acids function as components of phospholipids in all biomembranes and as precursors for eicosanoids that fulfill a variety of metabolic functions. The role of dietary n-3 PUFA during homeoviscous regulation, whereby fish alter their biomembrane phospholipid composition in response to changes in environmental temperature, has been described. During acclimation to cold-water temperatures the total amount of phospholipid in the fish biomembrane does not change, however changes occur in the relative proportion of individual phospholipids, in the fatty acid composition of the phospholipids, and in the distribution of fatty acids within the phospholipid molecules. For example, in rainbow trout transferred from 20° to 50C, the proportion of phosphatidylethanolamine increases with a corresponding decrease in phosphatidylcholine in both liver and gills. Similar changes have been observed during cold adaptation in membranes of goldfish intestine and carp muscle. Conversely, during adaptation to higher temperatures, the proportion of phosphatidylethanolamine decreases in trout gill membranes and phosphatidylcholine increases.

During cold adaptation, the relative amount of n-3 PUFA increases in trout liver membrane phospholipids, whereas the amount of saturated fatty acids decreases and the amount of monounsaturated fatty acids remains relatively constant. A large increase in 22:6(n-3) occurs in phosphatidylcholine, whereas 20:5(n-3) instead of

22:6(n-3) increases in phosphatidylethanolamine in response to lower temperature in e.g. trout membranes. The present invention also relates to a fish feed composition comprising one or more essential fatty acids. Any of the essential fatty acids can be combined in a fish feed composition. The present invention further relates to a fish feed composition comprising one of the following combinations of essential fatty acids:

1 ) 1 percent linolenic acid or 1 percent EPA or

2) 1 -2 percent linolenic acid or 0.5-0.75 percent EPA and DHA or

3) 1 percent linoleic acid and 1 percent linolenic acid or

4) 1 -2.5 percent linolenic acid or

5) 1 percent linoleic acid and 1 percent linolenic acid or 6) 0.5 percent linoleic acid and 0.5 percent linolenic acid or

7) 1 percent linolenic acid; 0.8 percent linolenic acid; 20 percent of lipid as linolenic acid or 10 percent of lipid as EPA and DHA or

8) 0.5 percent linoleic acid or

9) 1 percent linoleic acid or 1 percent arachidonic acid 10) 0.5 percent of EPA and DHA

1 1 ) 0.5 percent EPA and DHA or 0.5 percent EPA 12) 1 percent EPA and DHA

13) 1 .7 percent EPA and DHA or 1 .7 percent DHA

14) 0.8 percent EPA and DHA 15) 2 percent EPA and DHA

NOTE: Linolenic acid, 18:3(n-3); EPA (eicosapentaenoic acid), 20:5(n-3); DHA (docosahexaenoic acid), 22:6(n-3); linoleic acid, 18:2(n-6); and arachidonic acid, 20:4(n-6).

The present invention relates in one embodiment to a fish feed composition wherein the percentage of EPA (eicosapentaenoic acid), 20:5(n-3) is in the range from 0.1 to 25%, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to

0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1.0%, for example from 1.0 to 1.1 %, such as from 1.1 to 1.2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1.6%, for example from 1.6 to 1.7%, such as from 1.7 to 1 .8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of Linolenic acid, 18:3(n-3) is in the range from 0.1 to 25%, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1.1 %, such as from 1 .1 to 1 .2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1 .6%, for example from 1.6 to 1.7%, such as from 1 .7 to 1 .8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of DHA (docosahexaenoic acid), 22:6(n-3) is in the range from 0.1 to 25%, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1.0%, for example from 1.0 to 1.1 %, such as from 1.1 to 1 .2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1.6%, for example from 1.6 to 1.7%, such as from 1.7 to 1.8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to

3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%.

The present invention relates in one embodiment to a fish feed composition wherein the percentage of linoleic acid, 18:2(n-6) is in the range from 0.1 to 25%, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1.0%, for example from 1.0 to 1.1%, such as from 1.1 to 1.2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1.6%, for example from 1.6 to 1.7%, such as from 1.7 to 1.8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1 %, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%. The present invention relates in one embodiment to a fish feed composition wherein the percentage of arachidonic acid, 20:4(n-6) is in the range from 0.1 to 25%, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1.1 %, such as from 1 .1 to 1 .2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1 .6%, for example from 1.6 to 1.7%, such as from 1 .7 to 1 .8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%.

Carbohydrates in fish feed

The nutritional value of carbohydrates varies among fish. In general warm-water fish can use much greater amounts of dietary carbohydrate than cold-water and marine fish. No dietary requirement for carbohydrates has been demonstrated in fish; however, if carbohydrates are not provided in the diet, other compounds, such as protein and lipids, are catabolized for energy and for the synthesis of various biologically important compounds usually derived from carbohydrates. Thus, it is important to provide the appropriate concentration of carbohydrate in the diet of the fish species being cultured.

Enzymes for carbohydrate digestion are apparently present in fish. The enzymes for the major carbohydrate metabolic pathways, such as glycolysis, tricarboxylic acid cycle, pentose phosphate shunt, gluconeogenesis, and glycogen synthesis, have been demonstrated. Only a limited number of studies have reported on the kinetic properties of the various enzymes, and the results are consistent with evolutionary development. Even though the various enzymes and pathways for glucose metabolism have been detected, the role of dietary carbohydrates and the contribution of glucose to the total energy requirement of fish remain unclear.

The relative use of dietary carbohydrates by fish varies and appears to be associated with the complexity of the carbohydrate. Glucose, maltose, and sucrose resulted in the best growth rates, followed in descending order by dextrin and fructose, galactose and potato starch, and glucosamine when various carbohydrate sources were fed to e.g. young chinook salmon at a concentration of 10 percent of the diet. Rainbow trout have e.g. been reported to use 30 percent glucose in a 45 percent protein diet, whereas a concentration of 30 percent glucose in a 30 percent protein diet had a negative effect on growth and feed efficiency. A similar trend has been reported for sucrose use by rainbow trout when 35 and 55 percent protein diets were compared. Fifty-seven and 64 percent of the gross energy of glucose and sucrose, respectively, were used by rainbow trout when these carbohydrates were included at a concentration of 30 percent in a 48 percent protein diet.

Feeding high concentrations of digestible carbohydrates has been reported to result in an increase in liver size and glycogen content in e.g. salmonids, red sea bream, plaice, and yellowtail.

The relative utilization of dietary glucose, dextrin, and gelatinized starch has been compared in carp and red sea bream. Growth and feed efficiency of carp were highest when fed the gelatinized starch diet, followed by the dextrin and glucose diets in decreasing order, whereas red sea bream did not show any significant difference in growth rates for the various carbohydrate sources. Channel catfish used dextrin or starch for growth but not mono- and disaccharides. Chum salmon fry used glucose, maltose, sucrose, dextrin, and gelatinized starch but not fructose, galactose, or lactose for growth. White sturgeon, however, used glucose and maltose better than dextrin or starch.

The ability of fish to use dietary carbohydrates differs among species. Studies have indicated that common carp, channel catfish, red sea bream, and tilapia use higher levels than yellowtail and salmonids. In general, a concentration of less than 25 percent dextrin or gelatinized starch appears to be used as an energy source by e.g. rainbow trout, plaice, and yellowtail, whereas e.g. channel catfish and common carp can use a higher percentage.

In one preferred embodiment the present invention relates to a fish feed composition comprising one or more of the carbohydrates mentioned above.

In one preferred embodiment the fish feed composition comprise one or more carbohydrates in the range from 0.5 to 30%, such as from 0.5 to 5%, for example from 5% to 10%, such as from 10 to 15%, for example from 15% to 20%, such as from 20 to 25%, for example from 25% to 30%, such as from 0.5 to 2%, for example from 2% to 4%, such as from 4 to 6%, for example from 6% to 8%, such as from 8 to 10%, for example from 10% to 12%, such as from 12 to 14%, for example from 14% to 16%, such as from 16 to 18%, for example from 18% to 20%, such as from 20 to 22%, for example from 22% to 24%, such as from 24 to 26%, for example from 26% to 28%, such as from 28 to 30%.

Minerals

Minerals are inorganic elements necessary in the diet for normal body functions. They can be divided into two groups; bulk minerals and trace minerals; based on the quantity required in the diet and the amount present in the species. Common bulk minerals are sodium, chloride, potassium, calcium, chlorine, magnesium, sulfur and phosphorous. These minerals regulate osmotic balance and aid in bone formation and integrity.

Trace minerals are required in small amounts as components in enzyme and hormone systems. Common trace minerals are copper, chromium, iodine, zinc, cobalt, fluorine, iron, manganese, molybdenum and selenium. Fish can absorb many minerals directly from the water through their gills and skin, allowing them to compensate to some extent for mineral deficiencies in their diet. However, if the levels of mineral supplement in feed are too high the pigment melanin is produced and deposited around the blood vessels, making them appear black, as has been found for cod. This reduces the market price of the fish. Furthermore, several minerals, the trace elements especially, are poisonous to animals if excessive amounts are eaten.

Minerals can be naturally occurring in a feed or added hereto in elemental or mineral form, such as calcium carbonate and calcium phosphate such as tricalcium phosphate Ca3(PO4)2, calcium monohydrogenphosphate CaHPO4, calcium dihydrogen phosphate Ca(H2PO4)2 (also known as monocalciumphosphate), calcium pyrophosphate Ca2P2O7, hydroxyapatite Cai0(PO4)6(OH)2) and dicalcium dihydrogenphosphate Ca2H2(PO4)2, magnesium sulphate, potassium chloride or sodium chloride. Minerals may also be given as a supplement separately from the feed. Sources of minerals may include what naturally occurs in the feed due to the protein source used or the source may be commercial mineral mixes which may be balanced and pre-measured or kelp meal or other algae meals which are rich in micronutrients and thus comprise more than 70 minerals and furthermore are a good source of potassium.

It is an object of the present invention to provide a feed composition which comprises at least one mineral source such as a commercial mineral mix optionally further supplemented by one or more minerals such as calcium phosphate and/or magnesium sulphate. In one embodiment the minerals of the feed composition according to the present invention constitute between 0.5 to 40% of the feed (by % inclusion) such as between 1 and 35%, such as between 1.5 and 30% such as between 2 and 25%, such as between 2.5 and 20%, such as between 3 and 15%, such as between 3.5 and 10%, such as between 4 and 9%, or between 4.5 and 8%, such as between 5 and 7%, such as around 6% or between 1 and 13% such as between 1 .5 and 1 1%, such as between 2 and 9%, such as between 2.5 and 7%, such as between 3 and 5%, such as between 3.5 and 4.5%, such as around 4%, or around 3% or around 3.5% of the feed composition.

Fish, unlike most terrestrial animals, can absorb some minerals (inorganic elements) not only from their diets but also from their external aquatic environment. Calcium (Ca), magnesium (Mg), sodium (Na), potassium (K), iron (Fe), zinc (Zn), copper (Cu), and selenium (Se) are generally derived from the water to satisfy part of the nutritional requirements of fish. Phosphates and sulfates, however, are more effectively obtained from feed sources. Inorganic elements are required for the normal life processes of fish. Their main functions include the formation of skeletal structure, electron transfer, regulation of acid-base equilibrium, and osmoregulation. Minerals are also important components of hormones and enzymes, and they activate enzymes. Complex biochemical mechanisms control and regulate the uptake, storage, and excretion of various inorganic elements, allowing fish to live in a dynamic equilibrium with their aquatic medium. The electrolytes Na+, K+, Mg2+, Ca2+, Cl", and HCO3 ' play a major role in the osmotic and ionic regulation of extra- and intracellular fluids in fish. The exchange of ions from the surrounding water across the gills and skin of fish complicates the measurement of mineral requirements. Although most essential elements known for terrestrial animals are also considered important for fish, quantitative requirements have been reported for only nine minerals (calcium, phosphorus, magnesium, iron, copper, manganese, zinc, selenium, and iodine) for selected fish species. The role of macrominerals (calcium, phosphorus, magnesium, sodium, potassium, and chlorine) and trace elements (iron, copper, zinc, manganese, selenium, iodine, fluorine, and chromium) in fish nutrition are discussed in this section and sources of the minerals are given in Table 5.

TABLE 5 Mineral Composition of Ingredients Commonly Used in Fish Feeds (as-fed basis)

Calcium and phosphorus (Ca and P)

Calcium and phosphorus are directly involved in the development and maintenance of the skeletal system and participate in several physiological processes. Fish scales are also an important site of calcium metabolism and deposition. In addition to its structural functions, calcium plays an important role in muscle contraction, blood clot formation, nerve impulse transmission, the maintenance of cell integrity and acid-base equilibrium, and activation of several important enzymes.

Fish absorb calcium directly from their environment. The uptake of calcium occurs through gills, fins and oral epithelia, however gills are considered the most important site for calcium regulation. The calcium requirement of fish is met in large part by absorption through gills and skin in fresh water and by drinking sea water. The calcium requirement is affected by the water chemistry and species differences. The concentration of dietary calcium rarely seems critical for salmonids, and a dietary requirement has not been demonstrated. A low concentration of calcium (0.34 percent or less) is required in the diet of som fish including carp and eel for optimum growth. Catfish and tilapia reared in calcium-free water require 0.45 percent and 0.7 percent calcium in the diet, respectively, for optimum growth. Atlantic salmon derive calcium from sea water, thus making dietary supplementation unnecessary. The uptake of calcium from sea water is not sufficient to meet the calcium requirement of red sea bream, which requires 0.34 percent calcium in the diet.

In one preferred embodiment the fish feed composition comprise calcium in the range from 0.1 to 5% calcium, such as from 0.1 to 4%, for example from 0.1 to 3%, such as from 0.1 to 2%, for example from 0.1 to 1 %, such as from 1 to 5%, for example from 2 to 5%, such as from 3 to 5%, for example from 4 to 5%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1.0%, for example from 1.0 to 1.1 %, such as from 1.1 to 1 .2%, for example from 1.2 to 1 .3%, such as from 1 .3 to 1 .4%, for example from 1.4 to 1.5%, such as from 1.5 to 1.6%, for example from 1.6 to 1.7%, such as from 1.7 to 1 .8%, for example from 1.8 to 1 .9%, such as from 1 .9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1 %, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.3%, such as from 3.5 to 3.6%, for example from 3.6 to 3.3%, such as from 3.7 to 3.8%, for example from 3.8 to 3.3%, such as from 3.9 to 4.0%, for example from 4.0 to 3.3%, such as from 4.1 to 4.2%, for example from 4.2 to 4.3%, such as from 4.3 to 4.4%, for example from 4.4 to 4.5%, such as from 4.5 to 4.6%, for example from 4.6 to 4.7%, such as from 4.7 to 4.8%, for example from 4.8 to 4.9%, such as from 4.9 to 5.0%.

Phosphorus is an important constituent of nucleic acids and cell membranes, and is directly involved in all energy-producing cellular reactions. The role of phosphorus in carbohydrate, lipid, and amino acid metabolism, as well as in various metabolic processes involving buffers in body fluids, is also well established. Feed is the main source of phosphate for fish because the concentration of phosphate is low in natural waters. The dietary supply of phosphate is more critical than that of calcium because fish must effectively absorb, store, mobilize, and conserve phosphate in both freshwater and sea water environments.

In most fish, the main phosphorus deficiency signs include poor growth, feed efficiency, and bone mineralization. Other signs of deficiency in carp include increase in the activity of certain gluconeogenic enzymes in liver, increase in carcass fat with decrease in carcass water content, reduced blood phosphate levels, deformed head, and deformed vertebrae. A reduction in hematocrit level of catfish may also occur. A low- phosphorus intake by red sea bream also causes curved, enlarged vertebrae; increased serum alkaline phosphatase activity; higher lipid deposition in muscle, liver, and vertebrae; and reduction in liver glycogen content.

Dietary phosphorus requirements ranging from 0.5 to 0.8 percent have been reported for e.g. rainbow trout, Atlantic salmon, chum salmon, carp, and red sea bream. The phosphorus requirement of Atlantic salmon in either fresh water or sea water is 0.6 percent of the diet. The phosphorus requirement of catfish is 0.8 percent of available phosphorus in a natural ingredient diet. The phosphorus requirement using chemically defined diets is approximately 0.42 percent available phosphorus. The phosphorus requirement of Japanese eel is relatively low (0.29 percent) compared with that of other finfish. The concentration of dietary calcium has no effect on phosphorus requirement of catfish, carp, and rainbow trout. However, optimum Ca:P ratio is important in the diet of red sea bream, 1 :2 , and eel, 1 :1.

In one preferred embodiment the fish feed composition comprise phosphorus in the range from 0.1 to 5% calcium, such as from 0.1 to 4%, for example from 0.1 to 3%, such as from 0.1 to 2%, for example from 0.1 to 1%, such as from 1 to 5%, for example from 2 to 5%, such as from 3 to 5%, for example from 4 to 5%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1.0%, for example from 1.0 to 1 .1%, such as from 1.1 to 1.2%, for example from 1.2 to 1.3%, such as from 1.3 to 1 .4%, for example from 1.4 to 1.5%, such as from 1.5 to 1.6%, for example from 1.6 to 1 .7%, such as from 1.7 to 1.8%, for example from 1.8 to 1.9%, such as from 1.9 to

2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1 %, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.3%, such as from 3.5 to 3.6%, for example from 3.6 to 3.3%, such as from 3.7 to 3.8%, for example from 3.8 to 3.3%, such as from 3.9 to 4.0%, for example from 4.0 to 3.3%, such as from 4.1 to 4.2%, for example from 4.2 to 4.3%, such as from 4.3 to

4.4%, for example from 4.4 to 4.5%, such as from 4.5 to 4.6%, for example from 4.6 to 4.7%, such as from 4.7 to 4.8%, for example from 4.8 to 4.9%, such as from 4.9 to 5.0%.

Wide differences in the availability of phosphorus from different sources have been reported. In general, the more soluble the salt, the higher the availability of phosphorus for fish. Thus, the phosphorus of monocalcium or dicalcium phosphates is more readily available than that from tricalcium phosphate. The availability of phosphorus in fishmeal for tilapia is low compared to that for rainbow trout and chum salmon. Also, the availability of phosphorus in fishmeal is significantly lower for carp than for rainbow trout. The differences in the availability of phosphorus to salmonids and to carp and tilapia is probably due to the limited secretion of gastric juices by these warm-water species. About 60 percent of the phosphorus in anchovy and menhaden fishmeals was available to channel catfish.

Feedstuffs that originate from seeds contain phosphorus primarily as the calcium- magnesium salt of phytic acid known as phytin. Phytin phosphorus is unavailable to animals with simple stomachs because they lack the enzyme phytase in the gastrointestinal tract. Phytic acid also forms insoluble salts with free calcium in the digestive tract. Hence, the availability of phosphorus in most plant products is low; for example, that of soybean meal is between 29 and 54 percent.

Magnesium (Mq)

Magnesium is an essential cofactor in many enzymatic reactions in intermediary metabolism. These enzymes include phosphokinases, thiokinases, phosphatases, pyrophosphatases, and amino acyl synthetases. Magnesium plays an important role in the respiratory adaptation of freshwater fish. It is also required in skeletal tissue metabolism, osmoregulation, and neuromuscular transmission. The quantitative dietary magnesium requirements of rainbow trout, carp, channel catfish, eel, and guppy have been estimated to range from 0.04 to 0.06 percent of the diet. A dietary magnesium content of 0.06 to 0.08 percent was required for tilapia.

In one preferred embodiment the fish feed composition comprise magnesium in the range from 0.01 to 0.5 % of the diet, such as from 0.01 to 0.45%, for example from 0.01 to 0.4%, such as from 0.01 to 0.35%, for example from 0.01 to 0.3%, such as from 0.01 to 0.25%, for example from 0.01 to 0.2%, such as from 0.01 to 0.15%, for example from 0.01 to 0.1 %, such as from 0.01 to 0.05%, for example from 0.05 to 0.5%, such as from 0.1 to 0.5%, for example from 0.15 to 0.5%, such as from 0.2 to 0.5%, for example from 0.25 to 0.5%, such as from 0.3 to 0.5%, for example from 0.35 to 0.5%, such as from 0.4 to 0.5%, for example from 0.45 to 0.5%, such as from 0.01 to 0.05%, for example from 0.05 to 0.1 %, such as from 0.1 to 0.15%, for example from 0.15 to 0.2%, such as from 0.2 to 0.25%, for example from 0.25 to 0.3%, such as from 0.3 to 0.35%, for example from 0.35 to 0.4%, such as from 0.4 to 0.45%, for example from 0.45 to 0.5%, such as from 0.01 to 0.02%, for example from 0.02 to 0.03%, such as from 0.03 to 0.04%, for example from 0.04 to 0.05%, such as from 0.05 to 0.06%, for example from 0.06 to 0.07%, such as from 0.07 to 0.08%, for example from 0.08 to 0.09%, such as from 0.09 to 0.10%, for example from 0.10 to 0.1 1%, such as from 0.1 1 to 0.12%, for example from 0.12 to 0.13%, such as from 0.13 to 0.14%, for example from 0.14 to 0.15%, such as from 0.15 to 0.16%, for example from 0.16 to 0.17%, such as from 0.17 to 0.18%, for example from 0.18 to 0.19%, such as from 0.19 to 0.20%.

The magnesium requirement of fish can be met either from the diet or water. In fresh water, a waterborne concentration of 46 mg per liter is sufficient to meet the magnesium requirement of rainbow trout fed a magnesium-free diet. In the marine environment, magnesium supplementation of diet may not be necessary. The magnesium requirement of rainbow trout was not influenced by an increase in dietary calcium or phosphorus. Inorganic magnesium salts are efficiently used by rainbow trout with an apparent magnesium retention of 76 percent from these compounds, but magnesium retention from the bone fraction of fishmeal is only 54 percent.

Magnesium deficiency causes anorexia, reduced growth, lethargy, and reduced tissue magnesium content in fish. In rainbow trout, magnesium deficiency also caused calcinosis of the kidney, vertebrae deformity, and degeneration of muscle fibers and epithelial cells of the pyloric cecum and gill filaments. Catfish and rainbow trout fed magnesium-deficient diets show flaccid appearance of their muscle. Carp maintained on a low-magnesium diet also develop convulsions and cataracts. An interaction between dietary protein and magnesium concentrations has been demonstrated in tilapia, where excess magnesium (0.32 percent) in a low-protein (24 percent) diet produced toxicity signs and where magnesium deficiency in a high-protein (44 percent) diet caused whole-body hypercalcinosis.

Sodium, Potassium and Chlorine (Na, K and Cl)

Sodium, potassium, and chlorine are the most abundant electrolytes in the body. Sodium and chlorine are the principal cation and anion, respectively, in the extracellular fluid of the body; whereas, potassium is the major monovalent intracellular cation. Chloride ion is the major anion of gastric juice and blood. The deficiency signs of these elements are difficult to produce because fish readily absorb these elements from the surrounding aquatic medium.

The abundance of these elements in common feedstuffs used in fish diets means they need not be supplemented in most natural ingredient diets. However, potassium supplementation was found necessary in chemically defined diets for e.g. chinook salmon. Juvenile chinook salmon reared in fresh water required 0.8 percent potassium in their diet for maximum growth, and the whole-body potassium saturation was reached at a potassium concentration between 0.6 and 1.2 percent of the diet. Red sea bream reared in sea water, where potassium concentration is much higher, did not require a dietary potassium supplement. The signs of potassium deficiency in chinook salmon included anorexia, convulsions, tetany, and death.

Supplements of 1 to 4 percent of sodium chloride in natural ingredient diets had no beneficial effect on growth of rainbow trout, coho salmon, Atlantic salmon, channel catfish, or red sea bream. However, higher supplements of salt adversely affected growth and feed efficiency of coho salmon and rainbow trout. Atlantic salmon and coho salmon fed salt-enriched diets adapted well to seawater, with few mortalities. The Na+- and K+-stimulated ATPase activity of gill microsomes is elevated by dietary salt supplementation, thus making saltwater adaptation easier physiologically.

In one preferred embodiment the present invention relates to a fish feed composition wherein the percentage of potassium is in the range from 0.1 to 5%, such as from 0.1 to 4%, for example from 0.1 to 3%, such as from 0.1 to 2%, for example from 0.1 to 1%, such as from 1 to 5%, for example from 2 to 5%, such as from 3 to 5%, for example from 4 to 5%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1.1 %, such as from 1 .1 to 1 .2%, for example from 1.2 to 1.3%, such as from 1.3 to 1.4%, for example from 1.4 to 1.5%, such as from 1.5 to 1 .6%, for example from 1.6 to 1.7%, such as from 1 .7 to 1 .8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1%, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.3%, such as from 3.5 to 3.6%, for example from 3.6 to 3.3%, such as from 3.7 to 3.8%, for example from 3.8 to 3.3%, such as from 3.9 to 4.0%, for example from 4.0 to 3.3%, such as from 4.1 to 4.2%, for example from 4.2 to 4.3%, such as from 4.3 to 4.4%, for example from 4.4 to 4.5%, such as from 4.5 to 4.6%, for example from 4.6 to 4.7%, such as from 4.7 to 4.8%, for example from 4.8 to 4.9%, such as from 4.9 to 5.0%.

In another preferred embodiment the fish feed composition according to the present invention comprises from 0.1 to 25% sodium, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1.1%, such as from 1.1 to 1.2%, for example from 1.2 to 1.3%, such as from 1.3 to 1 .4%, for example from 1.4 to 1.5%, such as from 1 .5 to 1 .6%, for example from 1.6 to 1.7%, such as from 1.7 to 1.8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1 %, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%, such as from 1 to 3%, for example from 3% to 5%, such as from 5 to 7%, for example from 7% to 9%, such as from 9 to 1 1%, for example from 1 1% to 13%, such as from 13 to 15%, for example from 15% to 17%, such as from 17 to 19%, for example from 19% to 21%, such as from 17 to 19%, for example from 19% to 21%, such as from 19 to 21%, for example from 21% to 23%, such as from 23 to 25%.

In another preferred embodiment the fish feed composition according to the present invention comprises from 0.1 to 25% chloride, such as from 0.1 to 20%, for example from 0.1 to 15%, such as from 0.1 to 10%, for example from 0.1 to 5%, such as from 1 to 25%, for example from 5 to 25%, such as from 10 to 25%, for example from 15 to 25%, such as from 20 to 25%, for example from 0.1 to 5%, such as from 5 to 10%, for example from 10 to 15%, such as from 15 to 20%, for example from 20 to 25%, such as from 0.1 to 0.2%, for example from 0.2 to 0.3%, such as from 0.3 to 0.4%, for example from 0.4 to 0.5%, such as from 0.5 to 0.6%, for example from 0.6 to 0.7%, such as from 0.7 to 0.8%, for example from 0.8 to 0.9%, such as from 0.9 to 1 .0%, for example from 1.0 to 1.1%, such as from 1.1 to 1.2%, for example from 1.2 to 1.3%, such as from 1.3 to 1 .4%, for example from 1.4 to 1 .5%, such as from 1 .5 to 1 .6%, for example from 1.6 to 1.7%, such as from 1.7 to 1.8%, for example from 1.8 to 1.9%, such as from 1.9 to 2.0%, for example from 2.0 to 2.1 %, such as from 2.1 to 2.2%, for example from 2.2 to 2.3%, such as from 2.3 to 2.4%, for example from 2.4 to 2.5%, such as from 2.5 to 2.6%, for example from 2.6 to 2.7%, such as from 2.7 to 2.8%, for example from 2.8 to 2.9%, such as from 2.9 to 3.0%, for example from 3.0 to 3.1%, such as from 3.1 to 3.2%, for example from 3.2 to 3.3%, such as from 3.3 to 3.4%, for example from 3.4 to 3.5%, such as from 3.5 to 3.6%, for example from 3.6 to 3.7%, such as from 3.7 to 3.8%, for example from 3.8 to 3.9%, such as from 3.9 to 4.0%, such as from 1 to 3%, for example from 3% to 5%, such as from 5 to 7%, for example from 7% to 9%, such as from 9 to 1 1%, for example from 1 1% to 13%, such as from 13 to 15%, for example from 15% to 17%, such as from 17 to 19%, for example from 19% to 21%, such as from 17 to 19%, for example from 19% to 21%, such as from 19 to 21%, for example from 21% to 23%, such as from 23 to 25%.

Iron (Fe)

Iron is an essential element in the cellular respiratory process through its oxidation- reduction activity and electron transfer. It is found in the body mainly in the complex form bound to proteins, such as heme compounds (hemoglobin and myoglobin), heme enzymes (cytochromes, catalase, peroxidase, and so on), and nonheme compounds (transferrin, ferritin, and iron-containing flavoproteins [ferredoxins, dehydrogenases]). Feed is considered the major source of iron for fish because natural waters usually contain low amounts of soluble iron. Fish can absorb soluble iron from the water through the gills because the addition of ferrous sulfate to water enhanced growth and hemoglobin level in sword tail and platyfish. Iron was absorbed from the peritoneal cavity in rainbow trout and stored in the liver, spleen, and anterior kidney.

The iron requirements have been reported for catfish, Atlantic salmon, and eel, and they are 30, 60, and 170 mg/kg of diet, respectively. Iron deficiency causes characteristic microcytic anemia in brook trout, red sea bream, yellowtail, eel, and carp. In catfish, iron deficiency suppressed hematocrit, hemoglobin, and plasma iron concentrations and transferrin saturation. Ferrous chloride and ferrous sulfate are equally effective in preventing anemia in red sea bream; however, a somewhat higher concentration of ferric citrate is required. Dietary iron toxicity signs develop in rainbow trout fed more than 1 ,380 mg Fe/kg. The major effects of iron toxicity include reduced growth, increased mortality, diarrhea, and histopathological damage to liver cells.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 5 - 500 mg/kg of iron, such as from 5 to 10 mg/kg, for example 10 to 15 mg/kg, such as from 15 to 20 mg/kg, for example 20 to 25 mg/kg, such as from 25 to 30 mg/kg, for example 30 to 35 mg/kg, such as from 35 to 40 mg/kg, for example 40 to 45 mg/kg, such as from 45 to 50 mg/kg, for example 50 to 55 mg/kg, such as from 55 to 60 mg/kg, for example 60 to 65 mg/kg, such as from 65 to 70 mg/kg, for example 70 to 75 mg/kg, such as from 75 to 80 mg/kg, for example 80 to 85 mg/kg, such as from 85 to 90 mg/kg, for example 90 to 95 mg/kg, such as from 95 to 100 mg/kg, for example 100 to 1 10 mg/kg, such as from 1 10 to 120 mg/kg, for example 120 to 130 mg/kg, such as from 130 to 140 mg/kg, for example 140 to 150 mg/kg, such as from 150 to 160 mg/kg, for example 160 to 170 mg/kg, such as from 170 to 180 mg/kg, for example 180 to 190 mg/kg, such as from 190 to 200 mg/kg, for example 200 to 220 mg/kg, such as from 190 to 200 mg/kg, for example 200 to 220 mg/kg, such as from 220 to 240 mg/kg, for example 240 to 260 mg/kg, such as from 260 to 280 mg/kg, for example 280 to 300 mg/kg, such as from 300 to 320 mg/kg, for example 320 to 340 mg/kg, such as from 340 to 360 mg/kg, for example 360 to 380 mg/kg, such as from 380 to 400 mg/kg, for example 400 to 420 mg/kg, such as from 420 to 440 mg/kg, for example 440 to 460 mg/kg, such as from 460 to 480 mg/kg, for example 480 to 500 mg/kg.

Copper (Cu)

Copper is a constituent of many enzymes and is essential for their activities. It is associated with cytochrome c oxidase of the electron transport chain in the cell. Other cuproenzymes found in fish tissues include superoxide dismutase, tyrosinase, lysyl oxidase, ceruloplasmin, and dopamine β-hydroxylase. The distribution of copper and copper-dependent enzymes is similar in plaice and mammals, copper metabolism of most fish is poorly defined. High concentrations of copper are found in the heart, liver, brain, and eyes. Copper is present as the copper-protein complex, ceruloplasmin, in plasma.

The dietary copper requirements of selected fish species have been reported: rainbow trout and common carp require 3 mg/kg; channel catfish require 5 mg/kg; and Atlantic salmon require 5 mg/kg. Carp fed diets containing high-ash fishmeal without copper supplement showed reduced growth and cataract formation.

Fish appear to be more tolerant of copper in the diet than of dissolved copper in the water. Concentrations of 0.8 to 1.0 mg copper per liter as copper sulfate in water are toxic to many species of fish. Coho salmon tolerate copper at 1 ,000 mg/kg in the diet with only retarded growth and impaired pigmentation.

Copper toxicity has been experimentally produced in rainbow trout fed 730 mg Cu/kg of diet for 24 weeks. The toxicity signs include reduced growth and feed efficiency and elevated liver copper levels. However, a diet with up to 665 mg Cu/kg did not produce toxicity signs.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg copper, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18-20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30-35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45- 50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70- 80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

Zinc (Zn)

The essential function of zinc for living organisms is based on its role as an integral part of a number (more than 70) of metalloenzymes, including dehydrogenases, aldolases, peptidases, and phosphatases. Fish accumulate zinc from both water and dietary sources; however, dietary zinc is more efficiently absorbed than waterborne zinc. The gills in rainbow trout play a major role in excretion of zinc.

The zinc requirement of young rainbow trout and carp is 15 to 30 mg/kg of diet, whereas channel catfish and blue tilapia require 20 mg/kg of diet. Dietary calcium and phosphorus concentrations, presence of phytic acid, protein source, and form of zinc and calcium affect zinc absorption and use in fish. Phytate forms a complex with transitional elements, such as zinc, iron, and manganese, in the gastrointestinal tract and prevents their absorption. Calcium promotes the complexing of zinc to phytates. The bioavailability of zinc in fishmeal is inversely related to the tricalcium phosphate content. This is presumably caused by absorption of zinc into insoluble calcium phosphate complexes in the intestine that are passed through the gut unabsorbed and excreted. Higher supplements of zinc should be included in natural ingredient fish diets to compensate for reduced zinc bioavailability caused by dietary phytate and tricalcium phosphate.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg zinc, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18-20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30-35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45- 50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70- 80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

Rainbow trout and common carp tolerate 1 ,700 to 1 ,900 mg Zn/kg of diet without adverse effect on growth or survival. Copper status of channel catfish was not impaired by diets containing 200 mg Zn/kg.

In rainbow trout, zinc deficiency caused growth suppression, mortality, lens cataracts, erosion of fins and skin, and short-body dwarfism. High-ash (white) fishmeal may affect zinc absorption and use, resulting in lens cataracts. When zinc supplements (40 mg/kg) were added to rainbow trout diets containing white fishmeal, dwarfism and cataract problems were alleviated

Caudal fin zinc concentration is a good indicator of zinc status in rainbow trout. In channel catfish, diets low in zinc reduced growth rate, appetite, and bone zinc, calcium, and serum zinc concentrations.

Manganese (Mn)

Manganese functions either as a cofactor that activates metal-enzyme complexes or as an integral part of certain metalloenzymes in carbohydrate, lipid, and protein metabolism. Many kinases, transferases, hydrolases, and decarboxylases can be activated by either manganese or other divalent cations, such as magnesium, and their activity is not specific for manganese. However, enzymes such as glycosyl transferase are highly specific for manganese activation. Two important manganese metalloenzymes are pyruvate carboxylase and superoxide dismutase.

Although the uptake of manganese from water has been demonstrated, it is more efficiently absorbed from feed. The manganese requirements have been demonstrated for channel catfish, 2.4 mg/kg, and common carp and rainbow trout, 13 mg/kg. In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg manganese, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18- 20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30- 35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45-50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70-80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

Manganese deficiency caused reduced growth and skeletal abnormalities in rainbow trout, carp, and tilapia. In rainbow trout, low manganese intake both decreased the activities of copper-zinc superoxide dismutase and manganese-superoxide dismutase in cardiac muscle and liver and suppressed manganese and calcium concentrations of the vertebrae. Liver manganese-superoxide dismutase activity was not influenced in catfish fed a diet containing 2.4 mg Mn/kg of diet.

Selenium (Se)

Selenium is an integral part of the enzyme glutathione peroxidase. This enzyme can reduce hydrogen peroxide and fatty acyl hydroperoxides in water and fatty acyl alcohols, respectively, thereby protecting cells and membranes against peroxide damage.

Selenium deficiency causes growth depression in rainbow trout and catfish, but selenium deprivation alone does not produce pathological signs in these fish. Both selenium and vitamin E are required to prevent muscular dystrophy in Atlantic salmon and exudative diathesis in rainbow trout. Glutathione peroxidase activity in plasma and liver is a useful index of selenium status in fish. The selenium requirement of fish varies with the form of selenium ingested, polyunsaturated fatty acid and vitamin E content of the diet, and concentration of waterborne selenium. The selenium requirement determined on the basis of optimum growth and maximum plasma glutathione peroxidase activity was estimated to be 0.15 to 0.38 mg Se/kg diet for rainbow trout and 0.25 mg Se/kg for channel catfish. The biological availability of selenium differs in various selenium compounds and feed supplements. It has been reported that selenium present in fishmeal has low digestibility, whereas selenomethionine is highly digestible. A low concentration of selenium is found extensively in aquatic ecosystems. The uptake of selenium across gills is very efficient at low-waterborne concentrations.

Selenium toxicity occurred in rainbow trout and catfish when dietary selenium exceeded 13 and 15 mg/kg dry feed, respectively. Reduced growth, poor feed efficiency, and high mortality were the major effects. Trout reared on high-selenium diets (10 mg/kg) also showed renal calcinosis.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 0.01 to 20 mg/kg selenium, such as 0.01 to 0.05 mg/kg, for example 0.05 to 0.1 mg/kg, such as 0.1 to 0.15 mg/kg, for example 0.15 to 0.2 mg/kg, such as 0.2 to 0.25 mg/kg, for example 0.25 to 0.3 mg/kg, such as 0.3 to 0.35 mg/kg, for example 0.35 to 0.4 mg/kg, such as 0.4 to 0.45 mg/kg, for example 0.45 to 0.5 mg/kg, such as 0.5 to 0.55 mg/kg, for example 0.55 to 0.6 mg/kg, such as 0.6 to 0.65 mg/kg, for example 0.65 to 0.7 mg/kg, such as 0.7 to 0.75 mg/kg, for example 0.75 to 0.8 mg/kg, such as 0.8 to 0.85 mg/kg, for example 0.85 to 0.9 mg/kg, such as 0.9 to 0.95 mg/kg, for example 0.95 to 1.0 mg/kg, such as 1 to 2 mg/kg, for example 2 to 3 mg/kg, such as 3 to 4 mg/kg, for example 4 to 5 mg/kg, such as 5 to 6 mg/kg, for example 6 to 7 mg/kg, such as 7 to 8 mg/kg, for example 8 to 9 mg/kg, such as 9 to 10 mg/kg, for example 10 to 1 1 mg/kg, such as 1 1 to 12 mg/kg, for example 12 to 13 mg/kg, such as 13 to 14 mg/kg, for example 14 to 15 mg/kg, such as 15 to 16 mg/kg, for example 16 to 17 mg/kg, such as 17 to 18 mg/kg, for example 18 to 19 mg/kg, such as 19 to 20 mg/kg.

Iodine (I)

Iodine is essential for the biosynthesis of the thyroid hormones, thyroxine and triiodothyronine. Fish obtain iodine from water via branchial pumps and from feed sources. The total uptake of iodine depends on the iodine content of the feed and water. Under laboratory conditions, rainbow trout derive 80 percent of their iodide from water, 19 percent from diet, and less than 1 percent by recycling iodide from thyroid hormone degradation.

Iodine deficiency causes thyroid hyperplasia in brook trout. Thyroid hormone deficiency has been induced by glucosinolates in the diet.

The minimum iodine requirement of most fish species has not been established. Higher iodine requirements for advanced chinook salmon parr compared with fingerlings due to increased thyroid activity during smoltification has been reported. Relatively high concentrations of iodine and fluorine (4.5 mg/kg of diet of each) were essential to protect Atlantic salmon from bacterial kidney disease infections.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg iodine, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18-20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30-35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45- 50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70- 80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg fluorine, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18-20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30-35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45- 50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70- 80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

Other trace elements

In a preferred embodiment the present invention relates to a fish feed composition compising one or more other trace elements such as fluoride and chromium.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg fluoride, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18-20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30-35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45- 50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70- 80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 - 1000 mg/kg chromium, such as from 1 -2 mg/kg, for example from 2-3 mg/kg, such as from 3-4 mg/kg, for example from 4-5 mg/kg, such as from 5-6 mg/kg, for example from 6-7 mg/kg, such as from 7-8 mg/kg, for example from 8-9 mg/kg, such as from 9-10 mg/kg, for example from 10-12 mg/kg, such as from 12-14 mg/kg, for example from 14-16 mg/kg, such as from 16-18 mg/kg, for example from 18- 20 mg/kg, such as from 20-25 mg/kg, for example from 25-30 mg/kg, such as from 30- 35 mg/kg, for example from 35-40 mg/kg, such as from 40-45 mg/kg, for example from 45-50 mg/kg, such as from 50-60 mg/kg, for example from 60-70 mg/kg, such as from 70-80 mg/kg, for example from 80-90 mg/kg, such as from 90-100 mg/kg, for example from 100-150 mg/kg, such as from 150-200 mg/kg, for example from 200-250 mg/kg, such as from 250-300 mg/kg, for example from 300-350 mg/kg, such as from 350-400 mg/kg, for example from 400-500 mg/kg, such as from 500-600 mg/kg, for example from 600-700 mg/kg, such as from 700-800 mg/kg, for example from 800-900 mg/kg, such as from 900-1000 mg/kg.

Information on the dietary requirements of other trace elements is limited. Increased dietary fluoride enhanced fluoride accumulation in the vertebrae of rainbow trout. Evidence also indicated that elevated concentrations of fluoride may reduce the prevalence of bacterial kidney disease.

The importance of chromium and other trace elements essential for other animals and humans is also recognized in fish nutrition, although the effects of their deficiencies have not been reported.

Vitamins Vitamins are nutrients required in very small amounts for essential metabolic reactions in the body. Vitamins are organic compounds necessary in the diet for normal growth and health of living organisms. They often are not synthesized by these organisms themselves, and must be supplied in the diet. Vitamins may divided into two groups: those that are water-soluble and those that are fat-soluble. Water-soluble vitamins include: the B vitamins, choline, inositol, folic acid, pantothenic acid, biotin and ascorbic acid (vitamin C). Of these, vitamin C may be the most important as it is a powerful antioxidant and helps the immune system in aquatic species, especially fish. The fat- soluble vitamins include A vitamins, retinols (responsible for vision); the D vitamins, cholecaciferols (bone integrity); E vitamins, the tocopherols (antioxidants); and K vitamins such as menadione (blood clotting, skin integrity). Of these, vitamin E is especially important due to its function as an antioxidant. Deficiency of each vitamin has certain specific symptoms, but reduced growth is the most common symptom of any vitamin deficiency. Scoliosis (bent backbone symptom) and dark coloration may result from deficiencies of ascorbic acid and folic acid vitamins, respectively.

It is an object of the present invention to provide a feed composition comprising a source of vitamins. Vitamins for feed are commercially available as balanced and pre- measured vitamin mixes, and the feed may comprise such a ix as well as additional vitamin supplements such as vitamin C, betain (a choline precursor), inositol and other vitamin B complex members such as thiamine, riboflavin, niacin, pantothenic acid, biotin, cyanocobalamin, folic acid and pyridoxine /pyridoxamine.

An embodiment of the present invention comprises vitamins at an inclusion percentage of between 0.5 and 10% of the feed composition, such as between 1 and 9%, such as between 1 .5 and 8% such as between 2 and 7%, such as between 2.5 and 6%, such as between 3 and 7%, such as between 3.5 and 6%, such as between 4 and 5%, such as around 4.5% of the feed composition, or between 1 and 4%, such as between 1.5 and 3.5%, such as between 2 and 3% such as around 2.5% of the feed composition.

Vitamins are organic compounds, distinct from amino acids, carbohydrates, and lipids, that are required in trace amounts from an exogenous source (usually the diet) for normal growth, reproduction, and health. Vitamins are classified as water-soluble and fat soluble. Eight of the water-soluble vitamins are required in relatively small amounts, have primarily coenzyme functions, and are known as the vitamin B complex. Three of the water-soluble vitamins, choline, inositol, and vitamin C, are required in larger quantities and have functions other than coenzymes. Vitamins A, D, E, and K are the fat soluble vitamins that function independent of enzymes or, in some cases such as vitamin K, may have coenzyme roles. In mammals the absence of vitamins leads to characteristic deficiency diseases, but in fish such diseases are less specifically identified.

Some vitamins may be synthesized from other essential nutrients to spare a portion of the dietary requirement. For example, channel catfish appear to synthesize choline if adequate methyl donors such as methionine are present in the diet; however, if the concentration of dietary methionine is limiting, a choline requirement can be demonstrated. An exogenous source of some water-soluble vitamins for certain warm- water fish has been shown to be derived from microorganisms in the gastrointestinal tract. In cold-water carnivorous fish microorganisms are not a significant source of vitamins.

Both qualitative and quantitative vitamin requirements of fish have been determined by feeding chemically defined diets deficient in a specific vitamin. The quantitative requirements for most of the vitamins have been established for chinook salmon, rainbow trout, common carp, channel catfish, and yellowtail, while only some of the requirements are known for red sea bream and tilapia. Qualitative requirements have been identified in several other species. The requirements are affected by size, age, and growth rates as well as by various environmental factors and nutrient interrelationships. Thus, different researchers have reported fairly wide ranges in requirement values for growth in the same species. Recent studies with spring chinook salmon indicate that the dietary requirements for certain vitamins may be lower than previously reported for this species. In addition, the requirement values listed in Table 2, as determined by maximum liver storage or based on certain enzyme data, are often much higher than the requirement values based on weight gain and absence of deficiency signs; therefore, professional judgment must be used in selecting which requirement value best fits the user's needs.

TABLE 6 Vitamin Requirements for Growing Fish Determined with Chemically Defined Diets in a Controlled Environment

NOTE: Abbreviations: AASLP, ascorbic acid stimulated lipid peroxidation; ADS, absence of deficiency signs; ED, enzyme data; FE, feed efficiency; LLC, liver lipid content; MLS, maximum liver storage; MKS, maximum kidney storage; NHV, normal hematocrit values; OSS, optimum swimming stamina; VC, vertebral collagen content; and WG, weight gain.

In one preferred embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 5%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 20%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 30%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 40%. In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 50%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 60%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 70%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 80%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 90%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 100%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 +/- 5%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 150%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 200%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 300%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 400%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 500%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 600%. In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 700%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 800%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 900%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 1000%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 2000%.

In another embodiment the fish feed composition comprises one or more of the vitamins listed in Table 6 in the amounts listed Table 6 + 5000%.

Fat-soluble vitamins

The fat-soluble vitamins, A, D, E, and K, are absorbed in the intestine along with dietary fats; therefore, conditions favorable for fat absorption also enhance the absorption of fat-soluble vitamins. Fat-soluble vitamins are stored by animals if dietary intake exceeds metabolic needs. Thus, animals can accumulate enough fat-soluble vitamins in their tissues to produce a toxic condition (hypervitaminosis).

Vitamin A

Vitamin A is required in vertebrates for the regeneration of the light-sensitive compound rhodopsin in the retina of the eye. Vitamin A has also been shown to be essential for proper growth, reproduction, resistance to infection, and the maintenance of differentiated epithelia and mucus secretions.

Vitamin A occurs in three forms: as an alcohol (retinol), an aldehyde (retinal), and an acid (retinoic acid). Vitamin A1 (retinol) is found in mammals and marine fishes, whereas both vitamin A1 and vitamin A2 (3-dehydroretinol) are found in freshwater fishes. In freshwater fish, the oxidative conversion of retinol to 3-dehydroretinol occurs as well as the reversible oxidation and reduction reactions of retinol to retinal and of 3- dehydroretinol to 3-dehydroretinal. For example, tilapia has been shown to convert dietary retinol into 3-dehydroretinol and retinal into 3-dehydroretinal. Channel catfish were found to convert β-carotene to vitamin A1 and A2 in about a 1 :1 ratio.

Cold-water fish can use β-carotene as a vitamin A precursor. Channel catfish could use β-carotene as a vitamin A source only if the dietary concentration exceeded 2,000 international units per kilogram (IU/kg). It has recently been shown that β-carotene and canthaxanthin can be biotransformed in the liver of tilapia into vitamin A1 and that dihydroxycarotenoids such as astaxanthin, zeaxanthin, lutein, and tunaxanthin were directly bioconverted into vitamin A2. In mammals, carotenoids have been found to fulfill various biological functions independent of vitamin A.

Vitamin A deficiency in rainbow trout causes anemia, twisted gill opercula, and hemorrhages in the eyes and base of fins. Brook trout exhibited poor growth, high mortality, and eye lesions, such as edematous eyes, displaced lens, and degeneration of the retina, when fed a vitamin A-deficient, purified diet from first feeding. Channel catfish fed 0.4 mg of β-carotene/kg of diet for 3 years developed exophthalmia, edema, and hemorrhagic kidney. Anorexia, pale body color, hemorrhagic skin and fins, exophthalmia, and twisted gill opercula occurred in common carp fed a vitamin A- deficient diet after 8 to 1 1 weeks. Rapidly growing yellowtail fingerlings fed a vitamin A- deficient diet developed deficiency signs in 20 days including arrested growth of gill opercula, dark pigmentation, anemia, and hemorrhage in the eyes and liver, accompanied by high mortality.

High dietary intake (2.2 million IU/kg diet) of retinyl palmitate caused slow growth, anemia, and severe necrosis of the caudal fin of brook trout at 8.30C. Feeding up to 2.5 million IU retinyl palmitate to trout at 12.4°C also reduced body fat and liver size. A high intake of dietary protein or methionine by young trout reduced the toxicity of excess dietary vitamin A observed in fish fed a low-protein diet.

Vitamin A is in one embodiment added to fish feeds as the acetate, palmitate, or propionate ester in the form of free-flowing beadlets in a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of vitamin A including vitamin A precursors such as those mentioned above. Vitamin D

The two major natural sources of vitamin D are ergocalciferol (vitamin D2, which occurs predominantly in plants) and cholecalciferol (vitamin D3, which occurs in animals). Both forms of vitamin D are hydroxylated in the liver to the 25-hydroxy forms. The 25- hydroxy-D3 is further hydroxylated in the kidney to 1 ,25-dihydroxyvitamin D3, which is the biologically active form of vitamin D responsible for facilitating mobilization, transport, absorption, and use of calcium and phosphorus in concert with the actions of parathyroid hormone and calcitonin.

Cholecalciferol has been shown to be at least three times more effective than ergocalciferol in meeting the vitamin D requirement of rainbow trout. Andrews et al. found that vitamin D3 was used more effectively by catfish than vitamin D2 at dietary concentrations of 2,000 ILJ/kg of diet and that high concentrations of vitamin D3 (20,000 to 50,000 ILJ/kg of diet) reduced weight gain.

Other studies indicate that vitamin D2 was utilized as well as vitamin D3 up to 1 ,500 ILJ/kg of diet, but higher concentrations of vitamin D2 depressed weight gain and feed efficiency in channel catfish reared in calcium-free water.

Rainbow trout fed a vitamin D-deficient diet exhibited poor growth, elevated liver lipid content, impaired calcium homeostasis manifested by tetany of white skeletal muscles, and ultrastructural changes in the white muscle fibers of the epaxial musculature. However, in a similar study also with rainbow trout, no hypocalcemia or changes in bone ash were observed. A lordosis-like droopy tail syndrome observed in vitamin D- deficient trout was suggested to be related to an epaxial muscle weakness. Channel catfish fed a vitamin D-deficient diet for 16 weeks showed poor growth, lowered body calcium and phosphorus levels, and lowered total body ash.

Fingerling brook trout fed 3.75 x 106 IU vitamin D3/kg diet for 40 weeks had hypercalcemia and increased hematocrit levels but no difference in rates of growth and survival. A diet of 1 x 106 IU vitamin D3/kg has been reported to show no toxic effects in channel catfish reared in calcium-free water for 14 weeks.

Vitamin D3 is in one preferred embodiment added to the fish feed either in a beadlet with vitamin A or as a spray or drum-dried powder in a multivitamin premix. The present invention relates in one embodiment to a fish feed composition comprising any form of vitamin D including vitamin D precursors such as those mentioned above.

Vitamin E

Vitamin E is a generic descriptor for all the molecules that possess the biological activity of α-tocopherol. Natural forms of vitamin E are all d-stereoisomers and consist of a substituted aromatic ring and a long isoprenoid side chain. There are eight naturally occurring compounds with vitamin E activity: d-α-; d-β-; d-γ-; d-δ-tocopherols, which differ in the number and position of the methyl groups in the aromatic ring; and their corresponding tocotrienols. The compound with the highest biopotency is d-α- tocopherol. The other tocopherol isomers have some, but very low, biological activity. No interconversion between a-tocopherol and the other tocopherol forms has been detected in liver or muscle tissue of rainbow trout. The free tocopherol form of vitamin E is unstable to oxidizing conditions; whereas the acetate and succinate esters are quite stable. These ester forms possess no antioxidant activity, but they are readily hydrolyzed in the digestive tract to the biologically active free tocopherol. One IU of vitamin E is defined as the biological activity of 1 mg of DL-α-tocopheryl.

Vitamin E functions in vitro as a very good antioxidant in a manner similar to several synthetic antioxidants. In vivo, vitamin E and selenium (via glutathione peroxidase) function as parts of a multicomponent antioxidant defense system. This system protects the cell against the adverse effects of reactive oxygen and other free radical initiators of the oxidation of polyunsaturated membrane phospholipids, critical proteins, or both.

Vitamin E deficiency signs have been described e.g. for Chinook salmon, Atlantic salmon, channel catfish, common carp, rainbow trout and yellowtail. The deficiency signs of vitamin E in various fishes are similar and include muscular dystrophy involving atrophy and necrosis of white muscle fibers; edema of heart, muscle, and other tissues due to increased capillary permeability allowing exudates to escape and accumulate, which are often green in color as a result of hemoglobin breakdown; anemia and impaired erythropoiesis; depigmentation; and ceroid pigment in the liver. The incidence and severity of these deficiency signs have been shown to be enhanced when diets deficient in both vitamin E and selenium were fed to Atlantic salmon, rainbow trout, and channel catfish. These latter observations demonstrated a significant interaction between selenium and vitamin E in the nutrition of fish.

Erythrocyte fragility has been used as an indicator of vitamin E status in some animals. Peroxide hemolysis of red blood cells has been used to determine vitamin E deficiency in rainbow trout.

When high concentrations of dietary polyunsaturated fatty acids are involved in the diets of common carp and rainbow trout, the requirement for vitamin E is increased. Vitamin E-deficient rainbow trout have been reported to have significantly reduced immune and nonspecific responses to infection. However, no beneficial effect of dietary vitamin E supplementation alone or in combination with selenium as a prophylaxis for Hitra disease in Atlantic salmon was observed.

High dietary concentrations of vitamin E (5,000 mg of DL-α-tocopherol/kg of diet) have been shown to cause reduced concentrations of erythrocytes in trout blood.

Vitamin E is added to fish feeds as a dry powder form of DL-α-tocopheryl acetate.

The present invention relates in one embodiment to a fish feed composition comprising any form of vitamin E including vitamin E precursors such as those mentioned above.

Vitamin K

Vitamin K is required for stimulation of prothrombin activity in plasma and synthesis of blood clotting factors VII, IX, and X. The metabolic role of vitamin K involves the vitamin K-dependent carboxylase, which carries out the posttranslational conversion of specific glutamyl residues in the vitamin K-dependent plasma proteins to γ-carboxy-glutamyl residues. These residues are essential for the normal, Ca2+-dependent, interaction of the vitamin K-dependent clotting factors with phospholipid surfaces.

The term vitamin K is used as a generic descriptor for both 2-methyl-1 ,4- naphthoquinone and all 3-substituted derivatives of this compound, which exhibit an antihemorrhagic activity in animals fed a vitamin K-deficient diet. The three major forms of vitamin K include: vitamin Ki or phylloquinone, which can be isolated from plants; vitamin K2 or the menaquinones, which are synthesized by bacteria; and vitamin K3 or menadione which is a synthetic product. Many animals do not require vitamin K in the diet because of bacterial synthesis in the intestinal tract, but intestinal vitamin K-synthesizing microflora have not been described in fish. Supplementation of sulfaguanidine to a vitamin K-deficient diet and low water temperature caused prolonged blood coagulation time and low hematocrit values without affecting growth performance of trout.

Vitamin K is in one preferred embodiment added to the fish feed as a menadione salt — menadione sodium bisulfite (50 percent K3), menadione sodium bisulfite complex (33 percent K3), or menadione dimethylpyrimidinol bisulfite (45.5 percent K3).

The present invention relates in one embodiment to a fish feed composition comprising any form of vitamin K including vitamin K precursors such as those mentioned above.

Water-soluble vitamins

The water-soluble vitamins, with the exception of two water-soluble growth factors (choline and myoinositol) and ascorbic acid, have unique coenzyme functions in cellular metabolism. Yet, it is not always possible to correlate a sign of deficiency with a diminished function of an enzyme system for which that vitamin is essential. For some warm-water fishes, intestinal synthesis by microorganisms supplies the requirement for certain vitamins. Thus, deficiency signs result only in those cases when antibiotics are fed along with a deficient diet. A constant supply of essential water-soluble vitamins is required to prevent deficiency signs in fish, since these vitamins are not stored in body tissues.

Thiamin

The coenzyme form of thiamin is thiamin pyrophosphate. Thiamin pyrophosphate functions in the oxidative decarboxylation of α-keto acids, such as pyruvate and α- ketoglutarate, and in the transketolase reaction in the pentose shunt.

Dietary thiamin deficiency has been shown to result in neurological disorders such as hyperirritability in salmonids, channel catfish, Japanese eel, and Japanese parrotfish. Deficiency signs with varying degrees of mortality have been reported in common carp, red sea bream, turbot, and yellowtail. Erythrocyte transketolase activity has been used as a specific indicator of thiamin status in the turbot. Kidney or liver transketolase activity in rainbow trout and thiamin content in the blood of yellowtail also have been shown to decrease much earlier than the appearance of external deficiency signs.

Thiamin is in one preferred embodiment added to fish feeds as thiamin mononitrate, which is 91.9 percent thiamin. Thiamin mononitrate is stable in vitamin premixes that do not contain trace minerals and choline chloride.

The present invention relates in one embodiment to a fish feed composition comprising any form of thiamin including thiamine precursors such as those mentioned above.

Riboflavin

Riboflavin functions in the intermediary transfer of electrons in metabolic oxidation- reduction reactions as a component of two coenzymes, flavin monouncleotide (FMN) and flavin adenine dinucleotide (FAD). These coenzymes serve as prosthetic groups of oxidation-reduction enzymes involved in the metabolism of keto-acids, fatty acids, and amino acids in the mitochondrial electron transport system.

Species-specific deficiency signs are found in fish. The only common signs are anorexia and poor growth. The first sign of riboflavin deficiency observed in salmonids appeared in the eyes and included photophobia, cataracts, corneal vascularization, and hemorrhages. Lack of coordinated swimming and dark skin coloration have also been reported for riboflavin-deficient chinook salmon and rainbow trout. Severe fin erosion and light skin coloration accompanied by high mortality has also been observed. The eye lesions and dark skin coloration followed by high mortality have also been observed in riboflavin-deficient yellowtail fingerlings. Riboflavin-deficient common carp and Japanese eel exhibited hemorrhages in various parts of the body, nervousness, and photophobia but no evidence of cataract development. Monolateral or bilateral cataracts have been reported in riboflavin-deficient channel catfish. Lethargy and high mortality have been reported in Japanese parrotfish fed riboflavin-deficient diets.

It has been observed that feeding high concentrations of riboflavin (up to 600 mg/kg diet) had no adverse effects on growth of rainbow trout. These results were expected since riboflavin has not been shown to cause hypervitaminosis in other animals.

However, two previous studies had reported depressed growth in rainbow trout fed moderate concentrations of riboflavin. It was concluded that the growth depression observed in the earlier studies must have resulted from some factor other than riboflavin.

Riboflavin is in one preferred embodiment added to the fish feed as a dry powder in a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of riboflavin including riboflavin precursors such as those mentioned above.

Vitamin B6 (Pyridoxine)

The term vitamin B6 is the generic descriptor for the 2-methylpyridine derivatives that have the biological activity of pyridoxine. Pyridoxine is the main form found in plant products, whereas pyridoxal and pyridoxamine are the principal forms found in animal tissue. All three forms are readily converted in animal tissue to the coenzyme forms, pyridoxal phosphate and pyridoxamine phosphate. Pyridoxal phosphate is required for many enzymatic reactions involving amino acids such as transamination, decarboxylation, and dehydration. Pyridoxal phosphate also functions in the biosynthesis of porphyrins and in the catabolism of glycogen.

Pyridoxal phosphate is required for the synthesis of the neurotransmitters — 5- hydroxytryptamine and serotonin— from tryptophan. Consequently, signs of pyridoxine deficiency include nervous disorders — erratic swimming, hyperirritability, and convulsions— that have been observed e.g. in salmonids, gilthead sea bream, channel catfish, common carp, yellowtail, and Japanese eel.

Other deficiency signs such as anorexia and poor growth usually appear in the fish within 3 to 6 weeks after being fed a pyridoxine-deficient diet. Pyridoxine deficiency has been reported to cause various histopathological changes in rainbow trout liver and kidney and in the intestinal tissue of both rainbow trout and gilthead sea bream.

The activity of certain aminotransferase enzymes that require pyridoxal phosphate as a coenzyme has been used as an index of pyridoxine status in fish. Serum or tissue alanine and/or aspartate aminotransferase activities have been used to evaluate pyridoxine status in common carp, rainbow trout, chinook salmon, turbot, and gilthead sea bream. Vitamin B6 is added to fish feeds as pyridoxine hydrochloride in a dry form as part of a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of Vitamin B6 including Vitamin B6 precursors such as those mentioned above.

Pantothenic acid

Pantothenic acid is a component of coenzyme A (CoA), acyl CoA synthetase, and acyl carrier protein. The coenzyme form of the vitamin is therefore responsible for acyl group transfer reactions. Coenzyme A is required in reactions in which the carbon skeletons of glucose, fatty acids, and amino acids enter into the energy-yielding tricarboxylic acid cycle. Acyl carrier protein is required for fatty acid synthesis.

A deficiency of this vitamin impairs the metabolism of mitochondria-rich cells that undergo rapid mitosis and high-energy expenditure. Thus, deficiency signs have been found to appear within 10 to 14 days in rapidly growing fish such as fingerling yellowtail. Gill lamellar hyperplasia or clubbed gills is a characteristic sign of pantothenic acid deficiency in most fish. In addition to clubbed gills, anemia and high mortality have been observed in pantothenic acid-deficient salmonids, channel catfish and yellowtail. Pantothenic acid-deficient Japanese parrotfish exhibited anorexia, convulsions, and cessation of growth followed by high mortality. Similar deficiency signs were observed in red sea bream. Slow growth, anorexia, lethargy, and anemia were observed in common carp. Poor growth, hemorrhage, skin lesions, and abnormal swimming were found in Japanese eel fed pantothenic acid-deficient diets.

Pantothenic acid is in one preferred embodiment added to the fish feed as either calcium d-pantothenate (92 percent activity) or calcium DL-pantothenate (46 percent activity) as a dry powder in a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of Pantothenic acid including Pantothenic acid precursors such as those mentioned above Niacin

Niacin is used as the generic descriptor of pyridine 3-carboxylic acids and their derivatives that exhibit the biological activity of nicotinamide (the amide of nicotinic acid). Of the compounds with niacin activity, nicotinic acid and nicotinamide have the greatest biological activity. Niacin is widely distributed in both plant and animal tissue. Much of the niacin in plant material, however, is present in bound forms that have limited availability to fish.

Niacin is a component of the two coenzymes nicotinamide adenine dinucleotide (NAD) and nicotinamide adenine dinucleotide phosphate (NADP). These coenzymes are essential for several oxidation-reduction reactions involving the transfer of hydrogen and electrons in carbohydrate, lipid, and amino acid metabolism. They are also involved in various energy yielding and biosynthetic pathways including the mitochondrial electron transport system. Tryptophan can be metabolically converted to niacin in many animals, but not in certain salmonid fish. The fact that niacin deficiency can readily be induced in various fish indicates that most if not all fish lack the capacity for niacin synthesis.

Trout and salmon fed niacin-deficient diets exhibited anorexia, poor growth, poor feed conversion, photosensitivity or sunburn, intestinal lesions, abdominal edema, muscular weakness, spasms, and increased mortality. Channel catfish and common carp showed skin and fin lesions, high mortality, skin hemorrhages, anemia, and deformed jaws when fed niacin-deficient diets for 2 to 6 weeks. Skin hemorrhages, dermatitis, anemia, abnormal swimming, and ataxia were observed in Japanese eels fed a niacin- deficient diet for 14 weeks.

High dietary intake of niacin (10,000 mg/kg) increased liver fat, decreased body fat, and tended to reduce growth rate in e.g. fingerling brook trout.

Niacin is in one preferred embodiment added to fish feeds as either nicotinic acid or niacinamide; both have similar biological activity. Nicotinic acid or niacinamide is added to the multivitamin premix in a dry form.

The present invention relates in one embodiment to a fish feed composition comprising any form of Niacin including Niacin precursors such as those mentioned above Biotin

Biotin acts in certain metabolic reactions as an intermediate carrier of carbon dioxide during carboxylation and decarboxylation reactions. Specific enzymes that require biotin include acetyl-CoA carboxylase, pyruvate carboxylase, and propionyl-CoA carboxylase. Metabolic pathways requiring biotin include the biosynthesis of long-chain fatty acids and the synthesis of purines.

In many animals, a biotin deficiency can only be induced by feeding avidin, a glycoprotein found in raw chicken egg white that binds biotin and prevents absorption of the vitamin from the intestine.

Common carp required 8 to 12 weeks and channel catfish took 1 1 weeks to show growth depression when fed biotindeficient diets. A similar effect in rainbow trout took only 4 to 8 weeks in water temperatures of 150C. Anorexia, reduced weight gain, and higher feed conversion were more noticeable in smaller than in larger rainbow trout fed biotin-deficient diets. Biotin-deficient channel catfish exhibited skin depigmentation.

Hepatic pyruvate carboxylase activity in rainbow trout fed a lipid-free and biotin- deficient diet decreased to 3.3 percent of that in fish fed a diet sufficient in lipid and biotin, although the enzyme activity was restored to about 50 percent of normal following the addition of lipid to the diet .

Biotin is in one preferred embodiment added to fish feeds when necessary as D-biotin in a dry form in the multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of biotin including biotin precursors such as those mentioned above.

Folate

The term folate is used as the generic descriptror for folic acid and related compounds exhibiting qualitatively the biological activity of folic acid. Folic acid is composed of a pteridine ring linked through a methylene bridge to p-aminobenzoic acid to form pteroic acid, which is in turn linked as an amide to glutamic acid. Folic acid undergoes enzymatic reduction in the tissues to its active coenzyme form, tetrahydrofolic acid. It functions as an intermediate carrier of one-carbon groups in a number of complex enzymatic reactions. In these reactions, methyl, methylene, and other one-carbon groups are transferred from one molecule to another. These reactions are found in the metabolism of certain amino acids and the biosynthesis of purines and pyrimidines along with the nucleotides found in DNA and RNA.

Trout and salmon fed folate-deficient diets exhibited anorexia; reduced growth; poor feed conversion; and macrocytic normochromic, megaloblastic anemia characterized by pale gills, anisocytosis, and poikilocytosis. The erythrocytes were large with abnormally segmented and constricted nuclei, and a large number of megaloblastic proerythrocytes were present in the erythropoietic tissue of the anterior kidney. Production of erythrocytes decreased with time in fish fed the folate-deficient diet.

Folate is in one preferred embodiment added to the fish feed as folic acid as a dry powder in a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of folate including folate precursors such as those mentioned above.

Vitamin B12

The term vitamin B12 should be used as the generic descriptor for all corrinoids exhibiting qualitatively the biological activity of cyanocobalamin. This vitamin was previously known as vitamin B12 or cyanocobalamin. Vitamin B12 is a large molecule (molecular weight 1355) that contains a cobalt atom. Neither higher plants nor animals can synthesize vitamin B12, but both depend on certain microorganisms for the trace amounts required. Vitamin B12 is required for normal maturation and development of erythrocytes, for the metabolism of fatty acids, in the methylation of homocysteine to methionine, and for the normal recycling of tetrahydrofolic acid. Thus, a deficiency of vitamin B12 can result in signs similar to folate deficiency.

Salmon and trout fed low amounts of vitamin B12 showed a high variability in numbers of fragmented erythrocytes and in hemoglobin values, with a tendency for a microcytic, hypochromic anemia. Channel catfish fed a vitamin B12-deficient diet for 36 weeks exhibited reduced growth but no other clinical deficiency signs.

Intestinal microfloral synthesis appeared to satisfy the B12 requirement of Nile tilapia, but channel catfish required dietary supplementation of B12 to prevent anemia. Intestinal microfloral synthesis of vitamin Bi2 has been demonstrated in e.g. common carp, channel catfish, Nile tilapia, rainbow trout, and goldfish.

Vitamin B12 is in one preferred embodiment added to the fish feed composition when necessary in a dry form as part of a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of Vitamin Bi2 including Vitamin Bi2 precursors such as those mentioned above.

Choline

Unlike the other water-soluble vitamins, choline has no known coenzyme function. Choline has three major metabolic functions: as a component of phosphatidylcholine, which has structural functions in biological membranes and in tissue lipid utilization; as a precursor of the neurotransmitter acetylcholine; and as a precursor of betaine, which serves as a source of labile methyl groups for methylation reactions such as the formation of methionine from homocysteine and creatine from guanidoacetic acid.

Rainbow trout fed a choline-deficient diet developed light yellow-colored livers, protruded eyes, anemia, and extended abdomens. Lake trout fed a choline-deficient diet for 12 weeks had depressed growth rate and increased liver fat content. Depressed growth, loss of appetite, and white-gray colored intestines were observed in Japanese eels fed a choline-deficient diet.

Channel catfish fed casein-gelatin diets containing excess methionine did not develop signs of choline deficiency; however, catfish fed diets adequate but not excessive in methionine did develop deficiency signs. 50 percent of the choline requirement of rainbow trout can be met from betaine. These observations indicate that certain fish can meet a part of their choline needs through the synthesis of choline by the methylation of ethanolamine, which uses methyl groups from S-adenosyl methionine.

Choline is in one preferred embodiment added to fish feeds as a 70 percent choline chloride solution or a 25 to 60 percent dry powder.

The present invention relates in one embodiment to a fish feed composition comprising any form of choline including choline precursors such as those mentioned above. Myoinositol

Inositol may exist in one of seven optically inactive forms and as one pair of optically active isomers. Only one of these forms, myoinositol, possesses biological activity. Inositol is a biologically active cyclohexitol and occurs as a structural component in biological membranes as phosphatidylinositol. Recently, phosphatidylinositol was shown to be involved in signal transduction of several metabolic processes. Although similar in many respects to the adenylate cyclase transduction system, the phosphoinositide system is distinctive in that the hormonal stimulus activates a reaction that generates two second messengers. Membrane bound phosphatidylinositol 4,5- bisphosphate is cleaved to release sn-1 ,2-diacylglycerol and inositol 1 ,4,5- triphosphate, following the interaction of a hormone or agonist with the receptor on the cell membrane. Inositol 1 ,4,5-triphosphate stimulates the release of calcium from its intracellular stores in the endoplasmic reticulum, and sn-1 ,2-diacylglycerol activates protein kinase C to phosphorylate specific target proteins. Examples of cellular processes controlled by the phosphoinositide second messenger system include amylase secretion, insulin release, smooth muscle contraction, liver glycogenosis, platelet aggregation, histamine secretion, and DNA synthesis in fibroblasts and lymphoblasts.

Signs of inositol deficiency have been reported to include poor appetite, anemia, poor growth, fin erosion, dark skin coloration, slow gastric emptying, and decreased cholinesterase and certain aminotransferase activities in trout , red sea bream, Japanese eel, Japanese parrotfish, and yellowtail. Rainbow trout fed a diet devoid of inositol had large accumulations of neutral lipids in the liver, increased levels of cholesterol and triglycerides, but decreased amounts of total phospholipid, phosphatidylcholine, phosphotidylethanolamine, and phosphotidylinositol.

Myoinositol is in one preferred embodiment added to fish feeds when necessary as a dry powder in a multivitamin premix.

The present invention relates in one embodiment to a fish feed composition comprising any form of Myoinositol including Myoinositol precursors such as those mentioned above. Vitamin C

Most animals can synthesize vitamin C, or L-ascorbic acid, from D-glucose, but many fish cannot. Ascorbic acid is a strong reducing agent and is readily oxidized to dehydroascorbic acid. Dehydroascorbic acid can be enzymatically reduced back to ascorbic acid in animal tissue with glutathione or reduced NADP. Ascorbic acid is a cofactor in the hydroxylation of proline and lysine to hydroxyproline and hydroxylysine in procollagen, which is the precursor of collagen and thus is necessary for the formation of connective tissues, scar tissue in wound repair, and bone matrix. Ascorbic acid also facilitates the absorption of iron, thus preventing the anemia often observed in ascorbic acid-deficient fish. In addition, ascorbic acid functions with vitamin E to minimize peroxidation of lipids in fish tissues.

Vitamin C-deficient salmon and trout exhibited structural deformities (scoliosis, lordosis, and abnormal support cartilage of the eye, gill, and fins) and internal hemorrhaging usually preceded by nonspecific signs such as anorexia and lethargy, ascites and hemorrhagic exophthalmia, and high level of plasma triglycerides and cholesterol.

Phagocytic activity of cells of the immune system in fish produce reactive oxygen radicals that are potent microbicidal factors, but also autotoxic to fish macrophages. Vitamin C appears to protect phagocytic cells and surrounding tissues from oxidative damage. An increased immune response due to high concentrations of vitamin C supplementation has been demonstrated in e.g. channel catfish and rainbow trout.

Various derivatives of ascorbic acid, which are more stable than the parent compound, have been shown to provide antiscorbutic activity in fish. These include L-ascorbate-2- sulfate in rainbow trout, channel catfish, and tilapia; L-ascorbyl-2-monophosphate in channel catfish; and L-ascorbyl-2-polyphosphate in rainbow trout and channel catfish. Ascorbate-2-sulfate does not appear to be used as well as other more stable forms of ascorbic acid by certain fish.

Ascorbic acid is very labile and thus readily destroyed in the manufacturing process, especially in extruded feeds. Therefore it is not usually added to multivitamin premixes for fish feeds. Various coated forms of ascorbic acid, such as ethylcellulose or fat- coated products, have been used to increase retention of the vitamin in fish feeds.

Nevertheless, approximately 50 percent of the supplemental ascorbic acid is destroyed during the manufacture of extruded catfish feeds, and excess ascorbic acid is added to commercial formulations to ensure that an adequate concentration of the vitamin is retained during processing. Phosphorylated ascorbic acid, which is stable during extrusion processing, is available for use in fish feeds. The form of the vitamin selected depends on how the fish feed is to be manufactured and how long it is to be stored before being fed to the fish.

The present invention relates in one embodiment to a fish feed composition comprising any form of vitamin c including vitamin c precursors such as those mentioned above.

Binders A binder is a material used to bind together two or more other materials in mixtures. Its two principal properties are adhesion and cohesion. Generally binders may be of protein (see the above section on protein), carbohydrate (see in the below) or gum base. Furthermore, it is of importance that the feed comprises a stickwater content to ensure proper binding of the ingredients. Stickwater is the water portion isolated after screening and centrifuging the solids and oil away from fish pieces in the production of e.g. fish meal. Stickwater may be used as is or be condensed into a thick, syrup like solution comprising a variable percentage of solids.

Carbohydrates (starches and sugars) are the most economical and inexpensive sources of energy for fish diets. Although not essential, carbohydrates are included in aquaculture diets to reduce feed costs and especially for their binding activity during feed manufacturing. Dietary starches are useful in the extrusion manufacture of floating feeds. In aquatic species, carbohydrates are stored as glycogen that can be mobilized to satisfy energy demands. Up to about 20% of dietary carbohydrates can be used by these species. Cooking starch/carbohydrates during the extrusion process makes it more biologically available to the aquatic organisms.

As mentioned above, virtually any protein source may function as a protein based binder; in the present context marine protein binders are preferred, examples hereof are fish gelatine and stickwater.

Non-limiting examples of binders include wax, linseed oil, gum arabic, gum tragacanth, methyl cellulose, gums, or protein such as egg white or casein, flours of corn, wheat or other "breakfast" cereals, polysaccharide binders, plant gum agar-agar, tapioca flour (starch) cassava flour, lactose, sucrose, microcrystalline cellulose, pectin, poly vinyl pyrrolidone and various other starches, gelatinized starch, wheat, gum binders, plant gum, gum arabic, locust bean, agar carageenin and other alginates and gelatine from any animal source, preferably porcine and/or bovine, and beef heart.

Preferably, the feed composition of the present invention comprises at least one, preferably two, such as three or more types of binders including stickwater. Preferred binders include: gelatinized starch, wheat, fish and/or bovine gelatin. In an embodiment, the binders constitute between 1 and 60% of the feed composition, such as between 3 and 55% of the feed composition, such as between 5 and 50%, such as between 7 and 45%, such as between 9 and 40%, such as between 10 and 35%, such as between 1 1 and 30%, or between 13 and 25%, such as between 15 and 20%, or such as between 20 and 30%, such as between 22 and 28%, such as between 24 and 26%, such as around 25% of the feed composition. In yet an embodiment two types of binders are comprised in the feed composition these binders being carbohydrate based binders and protein based binders. The protein based binder fraction of the feed composition furthermore comprises stickwater. Thus the protein based binder fraction of the feed composition including stickwater constitutes between 1 and 40%, such as between 3 and 35%, such as between 5 and 30% such as between 7 and 25%, such as between 9 and 23%, such as between 1 1 and 22%, such as between 13 and 21%, such as between 15 and 19%, such as around 17%, such as 16 or 18% of the feed composition. Likewise, the preferred carbohydrate based binders such as gelatinized starch, corn flour and wheat constitute between 0.5 and 30%, such as between 1 and 25%, such as between 2 and 20% such as between 3 and 18%, such as between 4 and 16%, such as between 5 and 14%, such as between 6 and 12%, such as between 8 and 10%, such as around 9%, 8% or 10% of the feed composition.

Binders are incorporated into fish feeds to improve stability in water, increase pellet firmness, and reduce the amount of fines produced during processing and handling. Among the most widely used binders are sodium and calcium bentonites, lignosulfonates, hemicellulose, carboxymethylcellulose, alginate, and guar gum. More recently, some inert polymeric binders have been introduced, but limited information is available on their composition or toxicity to commonly cultured fish. Cereal grains provide starch that, when gelatinized, gives a durable, water-stable pellet. Certain feed ingredients such as whey, wheat gluten, pregelatinized starches, and molasses will permit the production of good-quality pellets. Most binders are considered to be inert and have limited or no nutritional value. However, incorporation of alginate and guar gum in rainbow trout diets reduced feed intake, increased moisture content of feces, and lowered the digestibility of protein and lipids.

Feeding stimulants

The primary modes of feed detection by fish are through olfaction or sight, but the taste of the item is the key factor in determining whether the item is swallowed or rejected. There appears to be a well-defined and species-specific tuning of the taste receptors of fish for the particular cues present in their feed items. Many researchers and feed manufacturers have attempted to add substances to fish feeds to enhance palatability and feed acceptance. This focus has taken particular importance in the production of larval and starter feeds, where feed acceptability is a major concern.

Four major characteristics of feeding stimulants for fish that were derived from animal tissues: (1 ) they have a low molecular weight (<1 ,000), (2) they contain nitrogen, (3) they are nonvolatile and water-soluble, and (4) they are amphoteric (have both acid and base properties simultaneously). Several substances or groups of substances for which these generalizations apply, such as amino acids, betaine, and inosine, have improved feeding behavior in carnivorous and omnivorous species. Some dipeptides elicit a greater feeding response than either of the constituent amino acids presented alone for abalone. Organic acids along with certain amino acids were found to be stimulatory. Feeding was stimulated by the organic acid, dimethyl-β-propiothetin, in e.g. goldfish, common carp, and tilapia.

When data on the effectiveness of the various feeding stimulants containing amino nitrogen are considered, a pattern seems to emerge relating to the feeding behavior of the fish and the type of compounds that are stimulatory. In general, carnivores show the greatest positive response to alkaline and neutral substances, such as glycine, proline, taurine, valine, and betaine, while herbivores respond more to acidic substances, such as aspartic acid and glutamic acid. The pattern is reasonable considering the chemical characteristics of the feed items the fish would seek in the natural environment.

The presence of certain compounds can also act as feeding deterrents. This phenomenon has been shown to occur with certain combinations of amino acids. Trimethylamine or its oxidation products, which are produced in decaying fish flesh, were shown to cause a decrease in feed consumption in e.g. turbot, plaice, and chinook salmon when these compounds were added to the diet. Salmonids and yellowtail show aversion to highly oxidized oils and fishmeals.

In one preferred embodiment the present invention relates to a fish feed composition comprising one or more of the feeding stimulants mentioned above.

Attractants

Other common additives incorporated into feeds for aquatic species are chemoattractants and flavorings, such as fish hydrosylates and condensed fish solubles (typically added at 5% of the diet). The amino acids glycine and alanine, and the chemicals betaine and betafin (choline) are also known to stimulate strong feeding behavior in fish. Blends of amino acids and natural flavoring ingredients such as Alanine, Arginine, Betaine, Cysteine, Glycine, Histidine, Isoleucine, Lysine, Methionine, Phenylalanine, Choline, Chloride, Proline, Serine, Threonine, Trytophan, Tyrosine and Valine, Taurine, Taurocholate, Hydroxyproline and BHT (added as a preservative) are flavour enhancers as well as nutritional supplements. Basically, attractants enhance feed palatability and its intake and thus assist the growth and survival of the aquatic species to which they are feed. The feed composition may comprise any of the above components and preferably more than one such as two, three or more attractants, these preferably being betaine, choline, hydrolysates of fish, alanine, and/or tryptophan. In an embodiment, the attractants constitute between 0 and 20%, such as between 0.5 and 18%, such as between 1 and 16%, such as between 1 .5 and 14%, such as between 2 and 12%, or between 2.5 and 10%, such as between 3 and 8%, such as between 3.5 and 8% such as between 4 and 6% such as around 5%, such as 4% or 6% of the feed composition or between 0.5 and 10%, such as between 2.5 and 7.5% of the feed composition.

Pigments

A variety of natural and synthetic pigments or carotenoids are available to enhance coloration in the flesh of and the skin of freshwater and marine species and fish. The pigments most frequently used supply the colors red and yellow. The synthetically produced pigment, astaxanthin which is also an antioxidant (obtained from companies such as Cyanotech and F. Hoffmann-La Roche Ltd.), is the most commonly used additive (100-400 mg/kg). Cyanobacteria (blue-green algae such as Spirulina), dried shrimp meal, shrimp and palm oils, and extracts from marigold, red peppers and Phaffia yeast are excellent natural sources of pigments. Preferably the pigment is phaffia yeast (or extract hereof) and/or astaxanthin. The pigments of the feed composition comprise between 0 and 7% of the feed composition such as between 0.5 and 6%, such as between 1 and 5%, such as between 1.5 and 4% such as between 2 and 3%, such as around 2.5%, or such around 0.5%, 1 %, 1.5 or 2% of the feed composition.

Many plants and animals contain a variety of natural pigments that impart yellow, orange, and red colors to the flesh, skin, and eggs of fish. One of the most important groups of natural pigments in the plant and animal kingdom is the carotenoids. Fish and birds use oxygenated carotenoids (xanthophylls) for pigmentation of skin, flesh, and plumage. Fish cannot synthesize these pigments; therefore, they must be present in the diet. In salmonids, two oxycarotenoids, astaxanthin (3,3'-dihydroxy-4,4'-diketo-β- carotene) and canthaxanthin (4-4'-diketo-β-carotene) are responsible for the red to orange coloring of the flesh, skin, and fins. Astaxanthin is the main carotenoid pigment of wild salmonids, and is derived mainly from zooplankton. Feedstuffs of plant origin contain pigments that do not produce the desired color of salmon flesh. The major plant carotenoids are lutein (3,3'-dihydroxy-a-carotene) and zeaxanthin (3R,R'-β,β-carotene- 3,3'-diol), as found in alfalfa, yellow corn, and algae. Lutein produces a yellow color whereas zeaxanthin imparts a yellow-orange color.

The retention of carotenoids in tissues depends on absorption, transport, metabolism, and excretion of these compounds. The digestibility of astaxanthin found in yeast and shrimp waste meal is low. However, ensiling of shrimp by-products improves the digestibility of astaxanthin by degrading the chitincalcium-protein-carotenoid complex in shrimp shells. Free astaxanthin is absorbed more efficiently than the astaxanthin ester. It appears that the rate of hydrolysis of the astaxanthin ester to free astaxanthin in the digestive tract of salmonids is limited. Approximately 90 percent of astaxanthin in fish flesh is located in free form, while the ester form predominates in skin. Salmonids are not able to oxygenate carotenoids, but deposit ingested oxygenated carotenoids without modification. Wide differences in the accumulation of carotenoids may be due to the differences in absorption of these compounds. Apparently, absorption is enhanced by the incorporation of hydroxyl groups into the carotene skeleton because astaxanthin is deposited at significantly higher concentrations than canthaxanthin in both Atlantic salmon and rainbow trout. In salmonids, the absorption of astaxanthin and canthaxanthin is 10 to 20 times more efficient than lutein and zeaxanthin.

Skin pigmentation is important in cultured yellowtail and red sea bream. These fish convert dietary astaxanthin largely into tunaxanthin and deposit it in their skin. Goldfish and fancy red carp are similar to the chicken in their absorption preference: zeaxanthin- astaxanthin-lutein. The yellow pigment, zeaxanthin, is readily metabolized to astaxanthin in goldfish and fancy red carp, which imparts red coloration. Goldfish metabolize little β-carotene and no lutein to astaxanthin.

The function of carotenoids other than as precursors of vitamin A in fish is not well defined and mostly speculative. Although the mobilization of carotenoids from the flesh to skin and ovaries of salmonids during maturation is well documented, their role in reproduction is not clear. A biological function of astaxanthin, canthaxanthin, and zeaxanthin as vitamin A (retinol and 3,4-dihydroretinol) precursors for vitamin A- depleted rainbow trout has been reported.

Preservatives

Preservatives, such as antimicrobials and antioxidants, are often added to extend the shelf-life of feed compositions and reduce the rancidity of the fats. Vitamin E is an effective, but expensive, antioxidant that can be used for small scale preparations. Commonly available commercial antioxidants are butylated hydroxyanisole (BHA), or butylated hydroxytoluene (BHT), and ethoxyquin. BHA and BHT are added at 0.005% of dry weight of the diet or no more than 0.02% of the fat content in the diet, while ethoxyquin is added at 150 mg/kg of the diet. Sodium and potassium salts of propionic, benzoic or sorbic acids, are commonly available antimicrobials added at less than 0.1% in the manufacture of aquatic feed compositions. An embodiment of the present invention comprises between 0 and 2% of preservatives such as between 0.05 to 1.5% such as between 0.1 to 1%, such as between 0.15 to 0.5%, such as between 0.2 to 0.25% or such as between 0.05 and 0.2% such as around 0.1% of the feed composition.

Other ingredients/special ingredients

In an embodiment of the present invention, immunestimulants are added to the feed composition to ensure the health of the aquatic species. The health of the organisms is ensured by preventing or reducing the risk of infections, diseases, and stress. Several agents may be employed to this end. For example, recent research in aquaculture has shown that the addition of complex sugars / polysaccharides to feed has an effective impact in stimulating some immune response both at the cellular and humoral levels. Certain polysaccharides have been shown to decrease gut colonization by pathogens and it has been demonstrated that manno-oligosaccharides, glucans, beta-glucans, cell walls and extracts and extracellular material from a variety of fungi occupy bacterial binding sites, thus preventing attachment of pathogens to the intestinal wall. The fungal sources of the glucans and other polysaccharides may be Reishi, Ganoderma lucidum, Lentinus edodes, Schizophyllum commune or Shiitake Mushroom. It appears that many of these polysaccharides only can be degraded by enzymes secreted by certain beneficial microorganisms, and thus promotes the proliferation of the latter at the exclusion of other potentially pathogenic types such as Gram-negative bacteria (vibrios), Salmonella spp., Clostridium spp. and E. coli which are unable to break down these particular sugars. These ingredient are generally termed prebiotics and may be used alone or together with probiotics (such as in a synbiotic mixture) to improve the microflora of the species being fed. Alternatively probiotics alone may be included in the feed in a form that enables them to colonize the gut after intake thereby securing a beneficial microflora in the gut. In this manner immunestimulats may improve feed conversion. Other ingredients that maybe added in order to stimulate the immune system of the fed animals are dietary essential fatty acids (EFAs) such as arachidonic acid (AA) and docosahexaenoic acid (DHA), which provide stress resistance; especially they enhance resistance to salinity stress, immunoresistance, better hatching rate and growth rate.

It also falls within the scope of the present invention to include further immunestimulants such as protease inhibitors and growth hormones in the feed composition. Protease inhibitors in the feed serve several functions: they can treat or prevent viral infections by arresting viral replication by inhibiting the activity of protease, an enzyme used by the viruses to cleave nascent proteins for final assembly of new virons and protease inhibitors may increase the utilization of the protein in the feed by blocking the protein digesting enzymes of the gut (the proteases). Growth hormones obviously enhance the growth rate of the organisms given the feed, but in fact also stimulate the immunity of the organisms. The growth hormones may be from an aquatic species, or may be mammalian in origin such as bovine growth hormone. The growth hormones may be isolated from the tissue from which they originate or be produced recombinantly. Both growth hormones and protease inhibitors are commercially available. It is thus an object of the present invention to include protease inhibitors and or growth hormones in the feed composition.

In another embodiment of the present invention the feed composition comprises pharmaceuticals. When an aquatic species, in fact any species, reduce or stop feeding, it is a sing of imbalance, and often disease. Relatively few therapeutic drugs are approved for aquatic species by the FDA, but some pharmaceuticals are avaible. Although using medicated feeds is one of the easiest ways to treat fish, they must be used early and quickly to prevent or reduce the weight loss or death of the fish as they discontinue feeding. Examples of pharmaceuticals include, and are not limited to Fucoidan, PG and complex carbohydrates such as mannan oligosaccharides as described in the above. Fucoidan is a sulfated polysaccharide that is extracted from the common brown algae, Laminaria digitata. Fucoidan has been shown to bind to enveloped viruses interfering with their ability to attach to host cells. This effect has been observed with the White Spot Virus. PG is a digested cell material from a nonpathogenic bacterium, Brevibacterium lactofermentum. This bacterium has been used for amino acid production for many years. It is an approved feed additive in the USA. Complex carbohydrates such as mannan oligosaccharides are used to modulate gut microbiology in an effort to reduce the impact of pathogenic challenges in the young animal. Although their method of action is not entirely resolved, the oligosaccharides, which cannot be metabolized by digestive enzymes, serve as substrates for the growth of specific beneficial bacteria in the gut and help prevent the establishment of pathogens on the intestinal mucosa.

In an additional embodiment the feed comprises complex additives such as yeast extract, krill and/or algae meal and/or hydrolysates of these. These additives in themselves may comprise several of the groups of nutrients as mentioned in the above, but in themselves also add to the effect of the feed such as by constituting survival enhancing agents. These survival enhancing agents may be further characterized as growth, health and/or longevity enhancing agents and may function by modulating the microbial population of the gut (microflora).

In yet an embodiment of the present invention, fibre, ash and fillers may be components of the feed composition. Fibre and ash (minerals) are a group of mixed materials found in most feedstuffs. Fibre may be used as a filler, and ash as a source of calcium and phosphorus; both should be no higher than 8-12% of the formulation. A high fibre and ash content reduces the digestibility of other ingredients in the diet resulting in poor growth of the fish. Fresh leafy or cooked green vegetables may also be components of the feed. Although vegetables are composed mainly of water, they contain some ash, carbohydrates and certain vitamins. Kale, dandelion greens, parsley and turnip greens are examples of relatively nutritious vegetables. Casein may also be part of the feed composition of the present invention. Casein consists of a fairly high number of proline peptides and may be utilized as a slow-digesting source of amino acids.

In an embodiment of the present invention the feed composition comprises special nutrients such as immunestimulants, pharmaceuticals and complex additives. Preferably the feed composition comprises immunestimlants, yeast extract, algae and / or krill meal. The combined inclusion percentage of these components is between 0 and 45% of the feed, such as between 0.5 to 40%, such as between 1 and 35%, such as between 1.5 and 30% such as between 2 and 25%, such as between 2.5 and 20%, such as between 3 and 15%, such as between 3.5 and 10%, such as between 4 and 9%, or between 4.5 and 8%, such as between 5 and 7%, such as around 6%, 5% or 7% of the feed composition or between 1 and 13% such as between 1 .5 and 1 1 %, such as between 2 and 9%, such as between 2.5 and 7%, such as between 3 and 5%, such as between 3.5 and 4.5%, such as around 4%, or around 3% or around 3.5% of the feed composition. Specifically the immunestimulants constitute between 0 and 8% of the feed composition such as between 0.5 and 7%, such as between 1 and 6%, such as between 1 .5 and 5% such as between 2 and 4%, such as between 2.5 and

3%, or such as between 0 and 3%, such as between 0.5 and 2.5%, such as between 1 and 2%, such as around 1 .5%, or 1% or 2% of the feed composition.

Ash In one preferred embodiment the present invention relates to a fish feed composition comprising from 1 -20% ash, such as from 1 -2%, for example from 2-3%, such as from 3-4%, for example from 4-5%, such as from 5-6%, for example from 6-7%, such as from 7-8%, for example from 8-9%, such as from 9-10%, for example from 10-1 1%, such as from 1 1 -12%, for example from 12-13%, such as from 13-14%, for example from 14-15%, such as from 15-16%, for example from 16-17%, such as from 17-18%, for example from 18-19%, such as from 19-20%.

In one embodiment the ash consist of one or more minerals. In another preferred embodiment the ash comprises phosphate.

Krill meal

KrNI, which means "whale food" in Norwegian, are eucarid crustaceans divided into 2 families. The Bentheuphausiidae family consists solely of Bentheuphausia amblyops, a deep water krill species that differs from members of the family Euphausiidae in that Bentheuphausia amblyops is not bioluminescent. The Euphausiidae family includes the other 89 known krill species, including one of the most common, Euphausia superba, which is the most frequent species associated with krill. Krill meal is in one embodiment composed of 100 percent Euphausia superba that has been freeze dried and ground into a powder.

In one embodiment the present invention realtes to a fish feed composition comprising krill meal.

Nutritional properties of krill meal

Krill meal is highly nutritious, protein rich and very high in the pigment carotenoid astaxanthin. Krill meal is widely used for feeding e.g. larval catfish and increases survival rates and health in e.g. trout, salmon, and other finfish. Krill meal contains 60 percent protein and is high in omega-3 fatty acids. It is in a powdered form with 80 percent of the particle size smaller than 500 microns.

Krill meal is a specialty feed ingredient, which has been produced by the industry for more than 15 years from whole round krill. Although there are more than 80 different krill species around the globe, resource abundance and high value dried krill meals have been mainly produced from South Antarctic Krill (Euphausia superba).

South Antarctic Krill has unique nutritional and quality attributes. Krill meal uniqueness comprises its good protein content, its strong palatability effect, natural beta-carotene content [in the form of astaxanthine], its excellent lipids & minerals profile and its chitin and chitosan constituent. Nevertheless, it is krill meals' negligible amount of dioxins, PCB's and heavy metals, the main feature that makes it an irreplaceable feed ingredient.

Krill meal is an excellent nutritional source of protein in an average of 60% [58-65% dry basis] of the highest biological value. Krill meal's typical average amino acid profile is as follows; Alanine 5.8% [percent of protein] - Arginine 6.7% - Aspartic Acid 9.5% - Cisteine 1 .2% - Glutamic Acid 12.6% - Glycine 4.8% - Histidine 2.5% - lsoleucine 5.0% - Leucine 7.8% - Lysine 8.2% - Methionine 4.0% - Phenylalanine 5.2% - Proline 4.0% - Serine 4.5% - Threonine 4.7% - Tyrosine 4.5% - Valine 5.3% - Taurine 2.9%.

Regarding krill meal's palatability attribute, it has low molecular weight soluble compounds such as nucleotides, amino acids in the form of proline and glycine, glucosamine, and high levels of trimethyl amine oxide, TMAO (190 MgN/100 g sample). All these compounds act together as an effective attractant and flavoring agent. Krill meal has been successfully used in low palatability aqua-diets such as feeds containing vegetable proteins and/or antibiotics. Additionally, krill meal high TMAO content has an extra osmoregulatory contribution, useful to reduce salmon's physiological stress when they are transferred from fresh to seawater.

South Antarctic krill meal's natural pigment content [in the form of Astaxanthin] is a very well known attribute. It has an average content of 180ppm [132-250ppm] dry basis, depending mainly on processing plus resource and fishing grounds conditions. This feature is used to increase flesh pigmentation on salmon, trout, yellow tail, shrimp and other farmed species. Krill meals used this way, the resulting end product contains the same type and coloring agent as naturally fed wild caught salmon. This characteristic has proved a strong selling argument for feed manufacturers focused on natural or organic conscious buyers.

Indeed, studies suggest that astaxanthin play a fundamental role in the protection against active oxygen species in fish and other organisms.

Beta-carotene astaxanthin found in krill meal has an important role in the regulation of fish' immune system, besides its role as a pigmentation agent, enhancing disease resistance and boosting survival rates. It is also known as an essential fish growth regulator. Krill meal steroidal component located in krill's cephalotorax region has proved a powerful and efficient promoting agent in the use of the protein found in feed diets. It therefore acts as a good growth promoting agent, increasing weight gain and feed conversion rates.

Krill meal chitin content found on raw krill's caparison has an average content of 2-4% of chitin. This way, krill meal is being studied as an immune system stimulant for some fish species.

Regarding minerals' and their use on several biological functions, South Antarctic krill meal is a good source of bio-available minerals; Copper 101 ppm (dried meal), Selenium 12ppm, Zinc 72ppm, Calcium 1.7% (dried meal), Phosphorous 1.3%. Copper's high content plays an important role in fin and skin integrity, while high concentration of selenium plays a relevant part on cellular antioxidant systems.

Krill meal has an additional relevant feature, which is its fat content uniqueness, in an average of 15% (8 - 18%), depending mainly on the fishing season and processing particulars. Within the traditional krill meal-processing layout, around 70% of raw krill original fat content remains bonded to krill meal's protein. This fat contains a high Omega-3 fatty acid concentration, where EPA & DHA are found in the vicinity of 23% or even higher (as part of the lipids). This fat has also a high content of phospholipids (40-50% of lipids). Accordingly, fish fed with diets containing krill meals increase their natural Omega 3 and natural astaxanthin content allowing this fish to enter the highly lucrative natural food market niche.

In a study on the effect of dietary lipid level on muscle composition in Atlantic salmon, it was found that muscle fatty acid composition reflected dietary fatty acid profiles, containing similar percentages of total saturated, monoenic and n-3 fatty acids in fish from all dietary treatment groups.

Krill meal is in one embodiment added in aquaculture feed diets in a range of 1 to 8%. Feeds containing krill meal are either used only at pre-harvest period or throughout the whole rearing & growth phase, depending on diet's main purpose (flesh pigmentation or attractant for example). Markets for these feeds include shrimp, trout and salmon feed manufacturers. The best krill meals are a result of raw material processed on board factory trawlers within the first 5 hours after the krill has been caught. This allows the highest freshness expressed as a very low TVN value in the range of 5 - 20 (mgN/100g).

Probably krill meal's future will not be purely link to nutritional aspects, but also on food safety issues. Krill meal raw material comes from South Antarctic waters with a very low content of risky contaminants such as Dioxins, PCB's and heavy metals.

Krill Meal shows a remarkably low content of undesirable substances such as heavy metals and dioxins, closely related to the unpolluted waters where it is captured and processed. South Antarctic krill fishing grounds has its own natural barriers such as sea current activity, circumpolar atmospheric winds and a limited human intervention. Industrial contamination is at a minimum level - if any. Heavy metals found in this area come primarily from volcanic activity, the main estimated pollutant source for Antarctic marine species.

Arsenic (As) comes from volcanic sources and it is a natural element found in water, soil and air. In marine species it mainly comes on its organic [80-99%] non-toxic form. Arsenic inorganic form is found in an amount of less than 0.01 ppm As/Kg wet weight while fish have 1 -10ppm of As/kg wet weight. In whole krill, Arsenic level reaches 3 ppm As/Kg.

Cadmium (Cd) and Lead (Pb) come from volcanic activity and human contamination through wastewater, fertilizers and air pollution. Lead comes from industrial contaminants (batteries, solder, and alloys). Both metals have a low accumulation rate in fish's flesh. The Cadmium and Lead levels in krill meal fall within EU's Directive 2002/32/EC.

Mercury (Hg) is widely distributed in nature, found in water, soil, and air and in several organisms. In marine species, organic mercury (methyl mercury) is considered a toxic compound, thoroughly concentrated throughout the food chain. Inorganic less-toxic mercury is accumulated at lower concentrations. Methyl mercury found in fish feeds is accumulated in fish's flesh and it is slowly eliminated. Tuna, halibut, sharks, and other predatory species accumulate higher mercury concentrations (0.5 - 1 ppm wet weight). The opposite is valid for species found at the beginning of the food chain, such as

Antarctic krill that fed from plankton. It accumulates mercury at less than 0.1 ppm (wet weight). KrNI meal mercury levels falls within EU regulations and is a suitable and safe feed ingredient.

Krill meal also comprise Fluorine (F). While whole krill has average moisture content in one embodiment is 79%, Fluorine equivalent dry basis content reaches 1 ,495ppm. In frozen de-shelled krill tail meat for example, with an average moisture content of 76% and 21 ppm F, its equivalent F content reaches 88ppm (dry basis). On 12% moisture and 60% protein content krill meal, lipids reaches 14% while F content jumps to 2,036ppm.

Microalqae Definition of microalqae: Microalgae are unicellular, photosynthetic aquatic plants.

Microalgae (single celled algae or phytoplankton) represent the largest, but most poorly understood, kingdom of microorganisms on the earth. Microalgae represent the natural nutritional base and primary source of all the phytonutrients in the aquatic food chain. Microalgae are microscopic algae, typically found in freshwater and marine systems. They are unicellular species which exist individually, or in chains or groups. Depending on the species, their sizes can range from a few micrometers to a few hundreds of micrometers.

Microalqae in fish feed

In one embodiment the present invention relates to a fish feed composition comprising microalgae. Microalgae are an essential first food for certain larval marine fishes, and can also be used to enrich other fish feeds.

Microalgae are utilized in aquaculture as live feeds for all growth stages of bivalve molluscs (eg. oysters, scallops, clams and mussels), for the larval/early juvenile stages of abalone, crustaceans and some fish species, and for zooplankton used in aquaculture food chains. Over the last four decades, several hundred microalgae species have been tested as food, but probably less than twenty have gained widespread use in aquaculture.

Microalgae must possess a number of key attributes to be useful aquaculture species. They must be of an appropriate size for ingestion, e.g. from 1 to 15 μm for filter feeders; 10 to 100 μm for grazers and readily digested. They must have rapid growth rates, be amenable to mass culture, and also be stable in culture to any fluctuations in temperature, light and nutrients as may occur in hatchery systems. Finally, they must have a good nutrient composition, including an absence of toxins that might be transferred up the food chain.

Strains that are successful for bivalve culture include lsochrysis galbana, lsochrysis sp. (T. ISO), Pavlova lutheri, Tetraselmis suecica, Pseudoisochrysis paradoxa, Chaetoceros calcitrans and Skeletonema costatum.

Nutritional properties of microalqae Microalgal species can vary significantly in their nutritional value, and this may also change under different culture conditions. Microalgae that have been found to have good nutritional properties - either as monospecies or within a mixed diet - include C. calcitrans, C. muelleri, P. lutheri, lsochrysis sp. (T. ISO), T. suecica, S. costatum and Thalassiosira pseudonana.

Several factors can contribute to the nutritional value of a microalga, including its size and shape, digestibility (related to cell wall structure and composition), biochemical composition (eg. nutrients, enzymes, toxins if present) and the requirements of the animal feeding on the alga. Since the early reports that demonstrated biochemical differences in gross composition between microalgae and fatty acids, many studies have attempted to correlate the nutritional value of microalgae with their biochemical profile.

Microalgae grown to late-logarithmic growth phase typically contain 30 to 40% protein, 10 to 20% lipid and 5 to 15% carbohydrate. When cultured through to stationary phase, the proximate composition of microalgae can change significantly; for example when nitrate is limiting, carbohydrate levels can double at the expense of protein. There does not appear to be a strong correlation between the proximate composition of microalgae and nutritional value, though algal diets with high levels of carbohydrate are reported to produce the best growth for juvenile oysters and larval scallops provided polyunsaturated fatty acids (PUFAs) are also present in adequate proportions. In contrast, high dietary protein provided best growth for e.g. juvenile mussels and Pacific oysters. PUFAs derived from microalgae, i.e. docosahexaenoic acid (DHA), eicosapentaenoic acid (EPA) and arachidonic acid (AA) are known to be essential for e.g. various larvae. The fatty acid content is systematically different in different taxonomic groups, although there are also examples of significant differences between microalgae from the same class.

Most microalgal species have moderate to high percentages of EPA (7 to 34%). Prymnesiophytes (eg. Pavlova spp. and lsochrysis sp. (T. ISO)) and cryptomonads are relatively rich in DHA (0.2 to 1 1%), whereas eustigmatophytes {Nannochloropsis spp.) and diatoms have the highest percentages of AA (0 to 4%). Chlorophytes (Dunaliella spp. And Chlorella spp.) are deficient in both C20 and C22 PUFAs, although some species have small amounts of EPA (up to 3.2%). Because of this PUFA deficiency, chlorophytes generally have low nutritional value and are not suitable as a single species diet. Prasinophyte species contain significant proportions of C20 (Tetraselmis spp.) or C22 (Micromonas spp.) - but rarely both.

While the importance of PUFAs is recognized, the quantitative requirements of larval or juvenile animals feeding directly on microalgae is not well established. A correlation between the percentage composition of the short chain fatty acids 14:0 + 16:0 in microalgae, and larval growth rates has been demonstrated. Diets with higher percentages of the saturated fats were more beneficial for the rapidly growing larvae, because energy is released more efficiently from saturated fats than unsaturated fats.

In late-logarithmic phase, prymnesiophytes, on average, contain the highest percentages of saturated fats (33% of total fatty acids), followed by diatoms and eustigmatophytes (27%), prasinophytes and chlorophytes (23%) and cryptomonads (18%). The content of saturated fats in microalgae can also be improved by culturing under high light conditions.

The content of vitamins can vary between microalgae. Ascorbic acid shows the greatest variation, i.e. 16-fold (1 to 16 mg/g dry weight). Concentrations of other vitamins typically show a two- to four-fold difference between species, i.e. β-carotene 0.5 to 1.1 mg/g, niacin 0.1 1 to 0.47 mg/g, α-tocopherol 0.07 to 0.29 mg/g, thiamin 29 to 109 μg/g, riboflavin 25 to 50 μg/g, pantothenic acid 14 to 38 μg/g, folates 17 to 24 μg/g, pyridoxine 3.6 to 17 μg/g, cobalamin 1.8 to 7.4 μg/g, biotin 1.1 to 1.9 μg/g, retinol < 2.2 μg/g, and vitamin D < 0.45 μg/g. To put the vitamin content of the microalgae into context, data should be compared with the nutritional requirements of the consuming animal. Unfortunately, nutritional requirements of larval or juvenile animals that feed directly on microalgae are, at best, poorly understood. However, the requirements of the adult are far better known (eg. For marine fish and prawns) and, in the absence of information to the contrary, will have to serve as a guide for the larval animal. These data suggest that a carefully selected, mixed-algal diet should provide adequate concentrations of the vitamins for aquaculture food chains.

The amino acid composition of the protein of microalgae is very similar between species and relatively unaffected by the growth phase and light conditions. Further, the composition of essential amino acids in microalgae is very similar to that of protein from oyster larvae. This indicates that it is unlikely the protein quality is a factor contributing to the differences in nutritional value of microalgal species.

Sterols, minerals and pigments also may contribute to nutritional differences of microalgae.

As the primary producers in the aquatic food chain, microalgae are the source of many phytonutrients, including docosahexaenoic acid (DHA) and arachidonic acid (ARA). Microalgae also provide fish with vitamins and polyunsaturated fatty acids. In one preferred embodiment the use of heterotrophically grown microalgae and its extracted oil is used as a source of nutrients and essential fatty acids for live food and in formulated broodstock feeds in aquaculture. These heterotrophically grown microalgae and extracted oil sources are particularly rich in docosahexaenoic acid (DHA) and arachidonic acid (AA), and may be utilized for enhancing larval growth and survival, as well as contributing to egg and sperm quality when included in broodstock diets.

In one preferred embodiment marine microalgae high in polyunsaturated fatty acids (PUPA) content are added to fish feeds.

Lipids from marine microalgae contain high amounts of eicosapentaenoic acid (EPA, C20:5) and docosahexaenoic acid (DHA, C22:6), two nutritionally important ω3 highly unsaturated fatty acids (HUFA-ω3), and are nowadays considered as a potential alternative source to fish oils. Microalgae display variable relative amounts of EPA and DHA depending on the taxonomic class they belong to. Moreover, a given strain may produce highly variable amounts of these fatty acids in response to modifications of culture conditions. Because microalgae are photoautotrophic microorganisms, specific bioreactors, namely photobioreactors, were developed to ensure large biomass production. Numerous research works are still to be carried out in order to confirm economic feasibility of industrial production of EPA and DHA from microalgae.

In another preferred embodiment fish feed with a high level of arachidonic acid is produced from microalgae, and fed to aquatic animals grown in aquaculture. The arachidonic acid-rich microalgae are fed directly to the aquatic animals, or processed to produce an oil that can be used as a nutritive supplement. The arachidonic acid-rich microalgae can be combined with long chain omega-3 fatty acids to provide a source of nutrition for fish.

In another embodiment microalgae is a source of astaxanthin. In one preferred embodiment Haematococcus microalgae is used as a natural source of astaxanthin.

Depending on the species, microalgae contain a variety of different lipids, hydrocarbons and other complex oils. Most species of microalgae contain relatively high percentages of lipids, with average contents 20-40% dry wt, whereas some species, most notably Botryococcus braunii produce up to 75% of their dry wt as hydrocarbons.

Microalgae contain high concentrations of fatty acids. Some microalgae contain high concentrations of specific long chain essential fatty-acids.

Microalαea species

Microalgae, which represent an extensive group of photosynthetic and heterotrophic organisms. Microalgae represent a vast genetic resource, comprising in excess of 80,000 different species. A list of preferred the algal-strains are included in figure 3.

Microalgae include both prokaryotic and eukaryotic algae that are classed in many different species. Prokaryotic algae are typically referred to as cyanobacteria or bluegreen algae. Eukaryotic microalgae come from many different genera, some of which overlap with the macroalgae, but can be generally differentiated by their size and lack of defined organs. Microalgae can have specialized cell types. Examples of different groups containing microalgae include, but are not limited to, the chlorophyta, rhodophyta, phaeophyta, dinophyta, euglenophyta, cyanophyta, prochlorophyta, and cryptophyta. Other examples of microalgae are Euglena (JP-A-60-196157), Nannochloropsis and Phaeodactylum.

The fish feed composition according to the present invention comprises in one preferred embodiment one or more of the microalgae mentioned above.

Fish hvdrolvsate

Fish hydrolysate, in its simplest form, is basically ground up fish carcasses. After the fish fillets are removed for human consumption, the remaining fish body, (which means the guts, bones, cartilage, scales, meat, etc.), is put into water and ground up. Some fish hydrolysate is ground more finely than others so more bone material is able to remain suspended. Alternatively, enzymes may be used to solubilize bones, scale and meat. If the larger chunks of bone and scales are screened out, calcium or protein, or mineral content may suffer.

Different fish contain very different amounts and types of oils, proteins, bone, and cartilage. Recognize that fish from contaminated waters will be high in that contaminant. Fish hydrolysate contains all the vitamins, proteins, amino acids, enzymes, growth hormones, and micro nutrients naturally found in whole fish.

In one embodiment the present invention relates to a fish feed compostion comprising fish hydrolysate. In one preferred embodiment the fish feed composition comprises fish hydrolysate, wherein the fish hydrolysate is characterized by one or more of the features in the table above.

Water

Diets contain water as an added ingredient, a natural constituent of the feedstuffs, or an element adsorbed from the atmosphere. Moisture derived from the atmosphere is generally low, 6 to 10 percent by weight, and little significance is attributed to these low "air-dry" concentrations in diets or ingredients. Low-moisture concentrations permit relative ease of storage and handling. In contrast, feeds with 12 percent or more moisture are generally more susceptible to spoilage by microorganisms.

Moist (10 to 40 percent) diets have been used at first feeding for e.g. Pacific salmon and Atlantic salmon because these fish prefer moist feeds under hatchery conditions, particularly at cold-water temperatures. Thus, in recent years, commercial semimoist (15 to 20 percent) diets have been introduced that do not require refrigeration. To reduce moisture loss during processing and storage and to improve feed texture, polyhydric alcohols (propylene glycol, glycerol, and sorbitol, for example) are incorporated into these diets. The addition of compounds that inhibit molds is also required.

In one preferred embodiment the present invention relates to a fish feed composition with 1 - 50% moisture such as from 1 -2%, for example 2-3%, such as from 3-4%, for example 4-5%, such as from 5-6%, for example 6-7%, such as from 7-8%, for example 8-9%, such as from 9-10%, for example 10-12%, such as from 12-14%, for example 14-16%, such as from 16-18%, for example 18-20%, such as from 20-22%, for example 22-24%, such as from 24-26%, for example 26-28%, such as from 28-30%, for example 30-32%, such as from 32-34%, for example 34-36%, such as from 36- 38%, for example 38-40%, such as from 40-42%, for example 42-44%, such as from 44-46%, for example 46-48%, such as from 48-50%.

In one preferred embodiment the present invention relates to a fish feed composition with 1 - 15% water, such as from 1 -2%, for example from 2-3%, such as from 3-4%, for example from 4-5%, such as from 5-6%, for example from 6-7%, such as from 7-8%, for example from 8-9%, such as from 9-10%, for example from 10-1 1 %, such as from 1 1 -12%, for example from 12-13%, such as from 13-14%, for example from 14-15%.

Fiber

Fiber refers to indigestible plant matter such as cellulose, hemicellulose, lignin, pentosans, and other complex carbohydrates found in feedstuffs. These components are indigestible unless bacterial action occurs within the digestive tract. Fish do not secrete cellulase, therefore cellulose digestion does not play an important role in their nutrition.

Fiber provides physical bulk to the feed. Cellulose and hemicellulose have been used as diluents and binders in experimental fish diets. Dietary fiber improved gastric evacuation time of rainbow trout fed purified diets. Small amounts of supplemental cellulose increased growth and the efficiency of protein utilization in laboratory diets. Most fish can tolerate up to 8 percent fiber in their diets, but higher concentrations (8 to 30 percent) depress growth. The poor performance of salmonids fed certain types of fiber may result from a combination of factors including poor digestion and faster gastric emptying rates, which in turn affect feed intake and utilization of nutrients. In natural ingredient diets that contain 3 to 5 percent fiber (derived mainly from plant ingredients), adding fiber is unlikely to have any measurable benefit. In most cases the concern is to formulate diets without excessive fiber content, which may reduce the environmental pollution from aquaculture waste, an important strategy is to use highly digestible feed ingredients and limit the fiber content of the diet.

In one preferred embodiment the present invention relates to fish feed composition comprising from 1 -15% fiber, such as from 1 -2%, for example 2-3%, such as from 3- 4%, for example 4-5%, such as from 5-6%, for example 6-7%, such as from 7-8%, for example 8-9%, such as from 9-10%, for example 10-1 1 %, such as from 1 1 -12%, for example 12-13%, such as from 13-14%, for example 14-15%.

Hormones

Various natural and synthetic hormones have been evaluated in fish growth experiments, including growth hormone, thyroid hormones, gonadotropin (GnH), prolactin, insulin, and various steroids. Experimental feeding of synthetic androgens has enhanced growth and improved feed conversion in some species such as salmonids.

Prolonged steroid treatment for growth acceleration may cause detrimental side-effects including early gonadal development, skeletal deformity, increased susceptibility to infections, and pathological changes in the liver, kidney, and digestive tract.

Hormones have been successfully used to induce or synchronize ovulation and the stimulation of spermiation. To increase gamete availability and fry production throughout the year, hormones have some application for the initiation and stimulation of oogenesis and spermatogenesis. The most commonly used preparations are pituitary extracts and human chorionic gonadotropin. Failure of fish to release GnHs may be responsible for the lack of final oocyte maturation, ovulation, and spawning. GnH-releasing hormones (GnRH) have been effective in inducing ovulation and spawning in salmonids, cyprinids, Indian catfish, winter flounder, plaice, grey mullet, milkfish, sea bass, red sea bream, sablefish, and herring.

Sex steroids have also been used to reverse the sex of some species of salmonids, carps, and tilapias. The objectives are to produce monosex and sterile fish of the faster growing sex, achieve better somatic growth, and prevent sexual maturation and the accompanying deterioration of flesh quality. Feminization can be achieved by feeding estrogenic steroids (ethynylestradiol, esterone, and diethylstilbestrol) to tilapia fry and 17-β-estradiol to salmonid fry. Production of all-male populations of tilapia by feeding androgenic steroids to the fry is practiced in many countries. Generally, ethynyltestosterone or methyltestosterone (30 to 60 mg/kg of diet) is incorporated in the first feed of tilapia fry and fed for 14 to 21 days. This sex reversal method produces 90 to 100 percent male tilapia.

The present invention relates in one embodiment to a fish feed composition comprising one or more hormones such as the hormones mentioned above.

Antibiotics

A wide range of antibiotics are used for therapeutic purposes in livestock production; however, only two compounds, sulfadimethoxine/ormetoprim and oxytetracycline, have been approved by the FDA for use in fish. Generally these compounds are stable during compression pellet processing and storage. Extrusion processing, however, will inactivate some of the oxytetracycline but very little of the sulfadimethoxine/ormetoprim. The quantity of antibiotic fed must be controlled, and proper feeding rate and withdrawal time must be practiced to reduce the entry of such compounds into the tissues of food fish or into the surrounding water. Antibiotics may only be added to feeds in the United States by a licensed manufacturer.

Subtherapeutic concentrations of antibiotics in the diets of poultry, swine, and other farm animals influence bacterial microflora of the gut and stimulate growth and feed efficiency. However, oxytetracycline and chlortetracycline in the diets of salmonid fish showed no appreciable benefit. In red sea bream, however, administration of a subtherapeutic concentration (0.01 percent) of furazolidone, a nitrofuran derivative used against salmonellosis and protozoan diseases, improved growth and feed efficiency. Chemotherapeutic compounds may also be toxic when administered for an extended period or at high doses. Rainbow trout fed therapeutic concentrations of erythromycin (1 10 mg/kg daily) for 10 weeks showed vascular degeneration of proximal renal tubules. Prolonged sulfonamide therapy in salmonids caused growth retardation, renal tubular casts, focal hepatic necrosis, and visceral arterial sclerosis.

The present invention relates in one embodiment to a fish feed composition comprising one or more antibiotics such as the antibiotics mentioned above.

Antioxidants Antioxidants are commonly used in fish feeds that contain a high concentration of polyenic fatty acids to prevent the oxidation of lipids. Oxidative rancidity, or lipid peroxidation, affects the nutritional value of lipids, oxidation sensitive vitamins, and other feed components. The breakdown products of lipid peroxidation can react with the epsilon amino group of lysine and reduce its nutritional value. Natural tocopherols (vitamin E) have antioxidant activity; however, synthetic vitamin E is usually supplied in the diet in ester form, which has little antioxidant activity until it is hydrolyzed in the gut to the alcohol form. Thus, synthetic vitamin E has little antioxidant activity in the diet. More vitamin E is required alone than when used in combination with antioxidants. Murai and Andrews (1974) showed that the commercial antioxidant ethoxyquin (1 ,2- dihydro-6-ethoxy-2,2,4-trimethyl-quinoline) could physiological replace vitamin E in channel catfish. Lipoid degeneration of liver and other pathologies have been associated with the feeding of rancid fat and/or the absence of vitamin E from the diet.

Synthetic antioxidants used in fish feeds are ethoxyquin, BHT (3,5-di-tert-butyl-4- hydroxytoluene), BHA (2(3)-tertbutyl-4-hydroxyanisole), and propyl gallate. Several excellent reviews of antioxidant types and mechanisms have been published (Uri, 1961 ; Stuckey, 1968; Porter, 1980). The maximum concentration of BHA and BHT permitted by the FDA is 0.02 percent of the fat content; for ethoxyquin, it is 150 mg/kg diet (21 C.F.R. § 573.380, 582.3169, 582.3173 [1987]).

The present invention relates in one embodiment to a fish feed composition comprising one or more antioxidants such as the antioxidants mentioned above.

Uptake

It is an object of the present invention to provide a feed composition which has a high degree of uptake / digestibility in the species to which it is fed. It is of importance when feeding small aquatic species such as immature individual and especially sensitive organisms such as larvae that the feed provided is taken up into the organism rapidly to avoid excess energy expenditure. An increase in uptake may for example be brought about by reducing the speed of digestion or by adding ingredients to the feed that increase the absorption time available in the gut.

Particle Size

The size of the feed particles is an important aspect of the invention as it must be ensured that the species fed receive all the nutrients and other ingredients within the feed without spending to much time and energy on feeding such as would happen if the particle size is too small nor choke on the feed as may happen if the feed is too large. It is essential, that the size of the feed correlates with the species fed the size and developmental stage of the animals themselves. Obviously, larger aquatic species will be capable of oral intake of particles ranging in size from fine crumbles for e.g. small fish to large (1/2 inch or larger) pellets. The pellet size should be approximately 20-30% of the size of the species mouth gape. Feeding too small a pellet results in inefficient feeding because more energy is used in finding and eating more pellets. Conversely, pellets that are too large will depress feeding and, in the extreme, cause choking. Generally it is advisable to select the largest sized feed the animals will actively eat.

When feeding smaller species, younger members of a species and/or marine larvae the particle size becomes especially relevant, as these animals require small particle sizes, which still must comprise adequate amounts of all or most of the essential nutrients. Leakage of the nutrients furthermore becomes an increasing problem as the particle size decreases.

Another aspect relates to the feeding behaviour of the species being fed. When feeding decapods, it is important that the feed as gripping size, as these animals grip the food prior to consuming it. Furthermore, some species will prefer or only take floating feed, whereas other species may prefer or only take sinking feed, or feed that has already settled (see in the below for more on floatation).

It is an object of the present invention to provide feed particle of a size suitable for smaller aquatic species, immature members of various aquatic species, especially marine larvae such as shrimp larvae. It is thus an aspect of the present invention to provide feed of small particle size with minimum leakage of nutrients to the surrounding water, thereby solving two of the main problems in production of formulated feed for marine larvae. This is achieved by the production process employed as is stated in the below.

In one embodiment the particles have an average diameter of from about 2 micron (μm) to preferably less than 100 micron. Examples include: Particles having an average diameter of for example about 4 micron, such as about 6 micron, for example about 8 micron, such as about 10 micron, for example about 12 micron, such as about 14 micron, for example about 16 micron, such as about 18 micron, for example about 20 micron, such as about 22 micron, for example about 24 micron, such as about 26 micron, for example about 28 micron, such as about 30 micron, for example about 32 micron, such as about 34 micron, for example about 36 micron, such as about 38 micron, for example about 40 micron, such as about 42 micron, for example about 44 micron, such as about 46 micron, for example about 48 micron, such as about 50 micron, for example about 52 micron, such as about 54 micron, for example about 56 micron, such as about 58 micron, for example about 60 micron, such as about 62 micron, for example about 64 micron, such as about 66 micron, for example about 68 micron, such as about 70 micron, for example about 72 micron, such as about 74 micron, for example about 76 micron, such as about 78 micron, for example about 80 micron, such as about 82 micron, for example about 84 micron, such as about 86 micron, for example about 88 micron, such as about 90 micron, for example about 92 micron, such as about 94 micron, for example about 96 micron, such as about 98 micron; as well as particles having a diameter in the range of for example from about 2 micron to preferably less than about 95 micron, such as from about 2 micron to preferably less than 90 micron, for example from about 2 micron to preferably less than about 85 micron, such as from about 2 micron to preferably less than 80 micron, for example from about 2 micron to preferably less than about 85 micron, such as from about 2 micron to preferably less than 80 micron, for example from about 2 micron to preferably less than about 75 micron, such as from about 2 micron to preferably less than 70 micron, for example from about 2 micron to preferably less than about 65 micron, such as from about 2 micron to preferably less than 60 micron, for example from about 2 micron to preferably less than about 55 micron, such as from about 2 micron to preferably less than 50 micron, for example from about 2 micron to preferably less than about 45 micron, such as from about 2 micron to preferably less than 40 micron, for example from about 2 micron to preferably less than about 35 micron, such as from about 2 micron to preferably less than 30 micron, for example from about 2 micron to preferably less than about 25 micron, such as from about 2 micron to preferably less than 20 micron, for example from about 2 micron to preferably less than about 15 micron, such as from about 2 micron to preferably less than 10 micron, for example from about 5 micron to preferably less than about 95 micron, such as from about 5 micron to preferably less than 90 micron, for example from about 5 micron to preferably less than about 85 micron, such as from about 5 micron to preferably less than 80 micron, for example from about 5 micron to preferably less than about 85 micron, such as from about 5 micron to preferably less than 80 micron, for example from about 5 micron to preferably less than about 75 micron, such as from about 5 micron to preferably less than 70 micron, for example from about 5 micron to preferably less than about 65 micron, such as from about 5 micron to preferably less than 60 micron, for example from about 5 micron to preferably less than about 55 micron, such as from about 5 micron to preferably less than 50 micron, for example from about 5 micron to preferably less than about 45 micron, such as from about 5 micron to preferably less than 40 micron, for example from about 5 micron to preferably less than about 35 micron, such as from about 5 micron to preferably less than 30 micron, for example from about 5 micron to preferably less than about 25 micron, such as from about 5 micron to preferably less than 20 micron, for example from about 5 micron to preferably less than about 15 micron, for example from about 10 micron to preferably less than about 95 micron, such as from about 10 micron to preferably less than 90 micron, for example from about 10 micron to preferably less than about 85 micron, such as from about 10 micron to preferably less than 80 micron, for example from about 10 micron to preferably less than about 85 micron, such as from about 10 micron to preferably less than 80 micron, for example from about 10 micron to preferably less than about 75 micron, such as from about 10 micron to preferably less than 70 micron, for example from about 10 micron to preferably less than about 65 micron, such as from about 10 micron to preferably less than 60 micron, for example from about 10 micron to preferably less than about 55 micron, such as from about 10 micron to preferably less than 50 micron, for example from about 10 micron to preferably less than about 45 micron, such as from about 10 micron to preferably less than 40 micron, for example from about 10 micron to preferably less than about 35 micron, such as from about 10 micron to preferably less than 30 micron, for example from about 10 micron to preferably less than about 25 micron, such as from about 10 micron to preferably less than 20 micron, for example from about 20 micron to preferably less than about 95 micron, such as from about 20 micron to preferably less than 90 micron, for example from about 20 micron to preferably less than about 85 micron, such as from about 20 micron to preferably less than 80 micron, for example from about 20 micron to preferably less than about 85 micron, such as from about 20 micron to preferably less than 80 micron, for example from about 20 micron to preferably less than about 75 micron, such as from about 20 micron to preferably less than 70 micron, for example from about 20 micron to preferably less than about 65 micron, such as from about 20 micron to preferably less than 60 micron, for example from about 20 micron to preferably less than about 55 micron, such as from about 20 micron to preferably less than 50 micron, for example from about 20 micron to preferably less than about 45 micron, such as from about 20 micron to preferably less than 40 micron, for example from about 20 micron to preferably less than about 35 micron, such as from about 20 micron to preferably less than 30 micron, for example from about 30 micron to preferably less than about 95 micron, such as from about 30 micron to preferably less than 90 micron, for example from about 30 micron to preferably less than about 85 micron, such as from about 30 micron to preferably less than 80 micron, for example from about 30 micron to preferably less than about 85 micron, such as from about 30 micron to preferably less than 80 micron, for example from about 30 micron to preferably less than about 75 micron, such as from about 30 micron to preferably less than 70 micron, for example from about 30 micron to preferably less than about 65 micron, such as from about 30 micron to preferably less than 60 micron, for example from about 30 micron to preferably less than about 55 micron, such as from about 30 micron to preferably less than 50 micron, for example from about 30 micron to preferably less than about 45 micron, such as from about 30 micron to preferably less than 40 micron, for example from about 40 micron to preferably less than about 95 micron, such as from about 40 micron to preferably less than 90 micron, for example from about 40 micron to preferably less than about 85 micron, such as from about 40 micron to preferably less than 80 micron, for example from about 40 micron to preferably less than about 85 micron, such as from about 40 micron to preferably less than 80 micron, for example from about 40 micron to preferably less than about 75 micron, such as from about 40 micron to preferably less than 70 micron, for example from about 40 micron to preferably less than about 65 micron, such as from about 40 micron to preferably less than 60 micron, for example from about 40 micron to preferably less than about 55 micron, such as from about 40 micron to preferably less than 50 micron, for example from about 50 micron to preferably less than about 95 micron, such as from about 50 micron to preferably less than 90 micron, for example from about 50 micron to preferably less than about 85 micron, such as from about 50 micron to preferably less than 80 micron, for example from about 50 micron to preferably less than about 85 micron, such as from about 50 micron to preferably less than 80 micron, for example from about 50 micron to preferably less than about 75 micron, such as from about 50 micron to preferably less than 70 micron, for example from about 50 micron to preferably less than about 65 micron, such as from about 50 micron to preferably less than 60 micron, for example from about 60 micron to preferably less than about 95 micron, such as from about 60 micron to preferably less than 90 micron, for example from about 60 micron to preferably less than about 85 micron, such as from about 60 micron to preferably less than 80 micron, for example from about 60 micron to preferably less than about 85 micron, such as from about 60 micron to preferably less than 80 micron, for example from about 60 micron to preferably less than about 75 micron, such as from about 60 micron to preferably less than 70 micron.

It is furthermore an object of the present invention to provide a feed composition with particle sizes that are specially adapted to suit the species or type of animal to which is given as well as the specific developmental stage of the animal. Thus is it an object of the present invention to provide a feed composition for shrimp larvae with a particle size (diameter) of between 2 and 100 micron, such as 4 micron, for example about 8 micron, such as about 10 micron, for example about 12 micron, for example about 16 micron, such as about 18 micron, for example about 20 micron, such as about 22 micron, for example about 24 micron, such as about 26 micron, for example about 28 micron, such as about 30 micron, for example about 32 micron, such as about 34 micron, for example about 36 micron, such as about 38 micron, for example about 40 micron, such as about 42 micron, for example about 44 micron, such as about 46 micron, for example about 48 micron, such as about 50 micron, for example about 52 micron, such as about 54 micron, for example about 56 micron, such as about 58 micron, for example about 60 micron, such as about 62 micron, for example about 64 micron, such as about 66 micron, for example about 68 micron, such as about 70 micron, for example about 72 micron, such as about 74 micron, for example about 76 micron, such as about 78 micron, for example about 80 micron, such as about 82 micron, for example about 84 micron, such as about 86 micron, for example about 88 micron, such as about 90 micron, for example about 92 micron, such as about 94 micron, for example about 96 micron, such as about 98 micron. Preferably the particle size of the feed composition for shrimp larvae is between 30 and 70 micron, such as between 35 and 65 micron, such as between 40 and 60 micron, such as between 45 and 55 micron.

It is furthermore an object of the present invention to provide a feed composition for crustaceans of a size between 2 and 80 micron, such as between 4 and 75 micron, such as between 6 and 70 micron, such as between 8 and 65 micron, such as between 10 and 60 micron, such as between 12 and 58 micron, such as between 14 and 56 micron, such as between 16 and 54 micron, such as between 18 and 52 micron, such as between 20 and 50 micron, such as between 22 and 48 micron, such as between 24 and 46 micron, such as between 26 and 44 micron, such as between 28 and 42 micron, such as between 30 and 40 micron, such as between 32 and 38 micron, such as between 34 and 36 micron.

It is also an object of the present invention to provide a feed composition specially adapted due to its composition of ingredients and particle size for feeding filter feeders such as mussels, scallops and oysters. The preferred average particle size for the feed composition for filter feeders of any developmental stage is between 0 and 30 micron, such as between 2 and 28 micron, such as between 3 and 26 micron, such as between 4 and 24 micron, such as between 5 and 22 micron, such as between 5 and 20 micron, such as between 6 and 18 micron, such as between 8 and 16 micron, such as between 10 and 14 micron. The feed for filter feeders may furthermore have a preferred particle size of from 0 to 10 micron, such as 1 to 9 micron, such as between 2 and 8 micron, such as between 3 and 7 micron, such as between 3 and 6 micron, such as between 4 and 6 micron, such as around an average size of 5 micron.

For fish and fish larvae the average particle size may be slightly larger such as between 0 and 400 micron such as between 2 and 390 micron, such as between 4 and 380 micron, such as between 5 and 370 micron, such as between 6 and 360 micron, such as between 8 and 350 micron, such as between 10 and 340 micron, such as between 12 and 330 micron, such as between 14 and 320 micron, such as between 16 and 310 micron, such as between 20 and 300 micron, such as between 22 and 290 micron, such as between 24 and 280 micron, such as between 26 and 260 micron, such as between 28 and 250 micron, such as between 30 and 240 micron, such as between 40 and 230 micron, such as between 42 and 220 micron, such as between 44 and 210 micron, such as between 46 and 200 micron, such as between 48 and 190 micron, such as between 50 and 180 micron, such as between 52 and 170 micron, such as between 54 and 160 micron, such as between 56 and 150 micron, such as between 58 and 140 micron, such as between 60 and 130 micron, such as between 62 and 120 micron, such as between 64 and 1 10 micron, such as between 66 and 100 micron. Generally, the larger the fish and/or fish larvae, the larger the particle size. Thus for larger fish /fish larvae the particle size is preferably between 100 and 300 micron such as between 150 and 250 micron such as around 200 micron in size.

Consistency It is an object of the present invention that the feed particles have a consistency and shape which makes them attractive to the species being fed. The feed particles must also be suitable for both small and large scale operations / aquafarms, wherein e.g. automatic feeding systems may be employed. It is thus an object of the present invention to provide a feed wherein the particles are small, rounded and/or soft and/or hygroscopic. It is of importance when feeding sensitive organisms such as marine larvae, that the particles are not sharp, as sharp particles may destroy the mouths and digestive systems of the larvae. Thus the present invention preferably comprises a feed composition in the form of small, rounded and/or soft particles. The desired consistency of the feed is achieved by the production process employed in the manufacture of the present feed composition (see herein below). The advantage of soft particles is the increased ease with which the animals may grasp the feed. The particles are furthermore preferably hygroscopic to ensure that the particle do not rest on the surface of the water when the feed is administered to the animals and that the particles easily may be mixed into water prior to administration to the animals without clogging pipes or other feeding devices. The particles of the present invention comprise granules, fine grains, porous granules or pellets, powder (to be mixed into the water), flakes and any type of extrusion product of a small size.

Leakage Providing a feed composition with a low degree of leakage is an object of the present invention. It is of special importance that the feed does not leak nutrients into the surrounding water as this reduces the nutritional value of the feed and may lead to eutrophication (algal, bacterial and/or mould bloom) of the water in which the animals reside. However, attractant must be able to leak out of the particles into the water as this serves to attract the animals to the particles and increases the feeding rate. A low degree of leakage of the nutrients of the feed is in the present invention secured by the production process employed in manufacturing the feed. Alternatively control of the degree of leakage of nutrients maybe obtained by the use of a water insoluble polymers, which may be comprised in the feed itself or may be coated onto the particles in a down stream processing step. A preferred embodiment of the present invention therefore leaks attractants and not nutrients. It is also of significance that the particles for a sufficient amount of time retain their shape and do not disintegrate. The purpose hereof is two fold: If the particles disintegrate, the particles are in fact no longer available for the animals as they are so reduced in size to be unattractive and further, if the particles disintegrate the cleaning of the tanks, ponds or other structures wherein the animals are farmed is made increasingly difficult.

Floatation

Generally feed compositions for aquatic species are manufactured as either extruded (floating or buoyant) or pressure-pelleted (sinking) feeds. Both floating and sinking feed can produce satisfactory growth, but some fish species prefer floating, others sinking feed. Extruded feeds tend to be more expensive due to the higher manufacturing costs. However, it is advantageous to feed with a floating (extruded) feed, as the feeding intensity of the animals may thus be observed easily and feeding rates adjusted accordingly. Determining whether feeding rates are too low or too high is important in maximizing fish growth and feed use efficiency. Both sinking and floating feed compositions are objects of the present invention. Preferably, the feed composition is slow sinking, or "flies" in the water, i.e. it does not readily precipitate. Ultimately the feed must however precipitate primarily to facilitate cleaning the tank (such as by siphoning) or other device in which the organisms are being farmed. This increases the availability of the feed for the largest numbers of organisms. The behaviour of the feed particles in the water column may be obtained through the manufacturing process or by use of gas producers within the feed. Gas producers may be carbonates such as sodium, potassium, magnesium or calcium carbonate. Preferably, the behaviour of the feed particles is obtained by the manufacturing process.

Effect

It is an aspect of the present invention through the ingredients and production process of the feed composition to enhance survival, growth and robustness of the fed organisms.

In one embodiment of the invention it is preferred that the food or feed product is capable of improving survival, preferably after oral intake. Thus when the feed product according to the invention is fed to one group of animals, the lethal rate should be lower than in a similar control group fed on a similar diet. The lethal rate is determined as the percentage of dead animals after a predetermined time. Preferably, the lethal rate is at least 1.2, such as 1.5, for example 2, such as 3, for example 5, such as 10 times lower in animals fed with a feed product according to the present invention. In particular, the above-mentioned reduction in lethal rate is observed in aquatic animals, preferably in smaller aquatic species such as immature individuals of any species and more preferably in marine larvae such as shrimp or other marine larvae after 1 week, such as after 2 weeks, for example after 3 weeks, such as after approximately 30-45 days, wherein said aquatic animal has been fed with a feed product according to the invention during the entire period.

In one embodiment of the invention it is preferred that the food or feed product is capable of improving growth, preferably after oral intake. In particular it is preferred that the food or feed product is capable of improving growth in young animals. Preferably, when the feed product according to the present invention is fed to one group of animals, the average weight gain is higher than in a similar control group fed on a similar diet. The average weight gain may be determined as the difference in weight gain between the groups divided by the average weight in the control group. The weight may be the weight of the living animals or the market weight. More preferably, the average weight gain is at least 13%, more preferably at least 15%, such as at least 20%, for example at least 25%.

Increased robustness is an aspect of the present invention which relates to multiple factors such as the increased growth and survival rates of the feed of the present invention compared to other feeds and/or food stuffs. Further factors are the presence of immunestimulating agent, pharmaceutical and a well balanced set of nutrients and attractants comprised in a particle that performs in a manner attractive to the species to which the feed composition is given.

Animal Any animal that may benefit from the intake of the feed composition is an object of the present invention. Thus any fish, bird, mammal, insect or reptile is an object of the present invention. Especially any type of aquatic species that may benefit from the intake of the feed composition of the present invention, thus any aquatic species is an object of the present invention. Preferably, the feed composition is suitable for sensitive and/or undeveloped, i.e. immature organisms which due to their condition have special nutritional demands. Such sensitive organisms preferably include aquatic larvae, especially marine larvae and more preferably shellfish larvae and most preferably shrimp/prawn larvae.

In one embodiment of the invention the feed product is an aquatic animal feed product, such as a fish feed product or a shellfish product. Non-limiting examples of the most popular fish species being raised and including both marine and freshwater fish, and thus species that fall within the scope of the present invention are: Arctic Char, Atlantic Salmon, Atlantic Cod, Bass, such as Sea bass, Australian sea bass, black sea bass, giant sea bass, Chilean sea bass and European sea bass, striped bass (Morone saxatilis), white bass (M. chrysops), black basses such as the largemouth bass (Micropterus salmoides), smallmouth bass (M. dolomieu), spotted bass (M. punctulatus), Guadalupe bass (M. treculii) and rock bass (Ambloplites rupestris), Barramundi, Blue Gill, Brook Trout, Brown Trout, Carps, Catfish, Chinook Salmon, Crappie, Drum, Halibut, Flounders, Rainbow Trout, Hybrid Striped Bass, Tilapias, Tunas, Walleye, Perch and Grouper. Perch and grouper are of special interest in connection with the present feed composition and examples of these include, but are not limited to: Grouper: Black grouper (Mycteroperca bonaci), Comet grouper (Epinephelus morrhua), Gag grouper (Mycteroperca microlepis), Giant grouper (Epinephelus lanceolatus), Goliath grouper (Epinephelus itajara), Nassau grouper (Epinephelus striatus), Saddletail grouper (Epinephelus daemelii), White grouper (Epinephelus aeneus), Queensland Groper (Epinephelus lanceolatus) and Yellowfin grouper (Myceroperca venenosa); Perch: Balkhash perch (Perca schrenkii), European perch (Perca fluviatilis), Yellow perch (Perca flavescens), fish of the family Percichthyidae are known as the Temperate perch and several other species of fish, including Estuary perch (Macquaria colonorum), Golden perch (Macquaria ambigua), Macquarie perch (Macquaria australasica), Nile perch (Lates niloticus), Pirate perch (Aphredoderus sayanus), White perch (Morone americana), Rock Perch (Ambloplites rupestris), Sacramento perch (Archoplites interruptus), shiner perch (Cymatogaster aggregata), Silver Perch (Bidyanus bidyanus), American silver perch (Bairdiella chrysoura), Cod, Turbot, Halibut, Sea bass, Sea bream, Perch, Grouper, Sturgeon, White fish and the Climbing perch family (Climbing gourami, Anabantidae).

In one preferred embodiment the fish can be selected from, but is not limited to, the group consisting of Albacore Tuna (Thunnus alalunga), Arrowtooth Flounder (Atheresthes stomias), Atlantic Cod (Gadus morhua), Atlantic Cutlassfish (Trichiurus lepturus), Atlantic Salmon (Salmo salaή, Atlantic Wolffish (Anarhichas lupus), Black Drum (Pogonias cromis), Black Pomfret {Parastromateus nigeή, Blackback Flounder (Sole, Pleuronectes americanus), Blacktip Shark (Carcharhinus limbatus), Catfish {lctalurus furcatus), Crab, Blue {Callinectes sapidus), Marlin (Makaira nigricans), Rockfish (Sebastes auriculatus), Puffer (Sphoeroides annulatus), Scorpionfish {Scorpaena guttata), Sheephead {Semicossyphus pulcher), Rockfish (Sebastes pinnigeή, Snapper (Lutjanus purpureus), Catfish (lctalurus punctatus), Rockfish (Sebastes goodei, Sebastes nebulosus), Chinook (Oncorhynchus tshawytscha), Chub Mackerel (Scomber japonicus), Coho Salmon (Silver, Medium Red) (Oncorhynchus kisutch), Thresher Shark (Alopias vulpinus), Grouper (Epinephelus fulva), Cusk (Brosme brosme), Mahi-mahi (Coryphaena hippurus), Sole (Microstomus pacificus), Sole (Pleuronectes vetulus), Escolar (Lepidocybium flavobrunneum), Dory (Zeus fabeή, Ocean Perch (Sebastes norvegicus), Snapper (Lutjanus griseus), Sole (Flounder) (Glyptocephalus cynoglossus), Barracuda (Sphyraena barracuda), Haddock (Melanogrammus aeglefinus), Tuna (Euthynnus affinis), Snapper (Lutjanus synagris), Lingcod (Ophiodon elongatus), Milkfish (Chanos chanos), Tilapia (Tilapia mossambica), Nile Tilapia (Tilapia nilotica), Puffer (Sphoeroides maculatus), Tilefish (Caulolatilus princeps), Oilfish (Ruvettus pretiosus), Orange Roughy (Hoplostethus atlanticus), Barracuda (Sphyraena argentea), (Bonito (Sarda chiliensis), Cod (Alaska Cod, Gadus macrocephalus), Jack (Caranx caninus), Jack (Selene peruviana), Ocean Perch (Sebastes alutus), Mackerel (Scomber scorn brus), Spanish (Scomberomorus sierra), Snapper (Lutjanus peru), Patagonian Toothfish (Dissostichus eleginoides), Sole (Flounder, Eopsetta Jordan /), Pink Salmon (Humpback) (Oncorhynchus gorbuscha), Pollock (Pollachius virens), Rockfish (Sebastes maliger), Trout, Rainbow (Steelhead) (Oncorhynchus mykiss), Drum (Redfish) (Sciaenops ocellatus), Porgy (Chrysophrys auratus), Snapper (Lutjanus campechanus), Rockfish (Sebastes proriger), Sole (Flounder, Errex zachirus), Rockfish (Sebastes aleutianus), Schoolmaster (Lutjanus apodus), Sheepshead (Archosargus probatocephalus), Shark, Mako (Isurus oxyrinchus), Snapper (Lutjanus vivanus), Butterfish (Pampus argenteus), Rockfish (Sebastes brevispinis), Skipjack Tuna (Katsuwonus pelamis), Spinefoot (Siganus javus), Croaker or Corvina (Roncador stearnsi), Flounder (Platichthys stellatus), Marlin (Tetrapturus audax), Bass (Morone chrysops x saxatilis), Swordfish (Xiphias gladius), Carp (Barbodes schwanefeldi), Pollock (Alaska Pollock, Theragra chalcogramma), Hake (Urophycis tenuis), Rockfish (Sebastes entomelas), Flounder (Scophthalmus aquosus), Croaker (Yellowfish, Pseudosciaena manchurica), Rockfish (Sebastes ruberrimus), Tuna (Thunnus albacares), Yellowstripe Scad (Selaroides leptolepis), Yellowtail {Seriola lalandei), Flounder (Limanda ferruginea), Rockfish (Sebastes flavidus) and Snapper (Ocyurus chrysurus ) Arctic char (Salvelinus alpinus), Turbot, Greenland halibut {Reinhartdius hippoglossoides) and Halibut {Hippoglossus hippoglossus).

In one preferred embodiment the fish can be selected from, but is not limited to, the group consisting of Ablennes hians, Acanthopagrus berda, Acanthophthalmus semicinctus, Acanthuridae, Acanthurus lineatus, Acanthurus sp., Acanthurus tήostegus, Acentrogobius janthinopterus, Alectis sp., Ambassidae, Ambassis buruensis, Ambassis com merson i auctorum, Ambassis miops, Ambassis miops, Amblygaster sirm, Amphacanthus oramin, Siganus canaliculatus, Anabantidae, Anabas testudineus, Anguilla bicolor pacifica, Anguilla celebensis, Anguilla marmorata, Anguilla mauritiana, Anguilla marmorata, Anguilla sp., Anguillidae, Anodontostoma chacunda, Anomalopidae, Anomalops katoptron, Anyperodon leucogrammicus, Apogon ellioti, Apogon sp. auctorum, Hypseleotris bipartite, Apogonichthys ellioti, Apogon ellioti, Apogonidae, Apolectus niger, Parastromateus niger, Ariidae, Aristichthys nobilis, Arius manillensis, Arius sp., Arius thallassinus, Netuma thalassina, Arothron manilensis, Arothron mappa, Atherina balabacensis, Atherinidae, Atule mate, Bagridae, Batistes flavimarginatus, Pseudobalistes flavimarginatus, Balistidae, "banak", Belonidae, Belontiidae, Berycidae, Beryx splendens, Bodianus mesothorax, "boloan", Botia macracanthus, Butts amboinensis, Caesio cuning, Caesio erythrogaster, Caesio cuning, Caesio lunaris, Caesionidae, Capoeta tetrazona, Puntius tetrazona, Carangidae, Carangoides armatus, Caranx affinis, Atule mate, Caranx armatus, Carangoides armatus, Caranx sexfasciatus, Caranx sp., Caranx speciosus,

Gnathanodon speciosus, Carassius auratus, Carassius carassius, Carassius sp., "catfish", Centropomidae, Cephalopholis sonnerati, Chaetodon collare, Chaetodontidae, Chanidae, Channa striata, Channidae, Chanos chanos, Characidae, Cheilinus diagrammus, Oxycheilinus diagrammus, Cheilio inermis, Choerodon anchorago, Chonophorus melanocephalus, Cichlidae, Cirrhina mrigala, Cirrhinus mrigala, Cirrhinus mrigala, Clarias batrachus, Clarias macrocephalus, Clariidae, Clupeidae, Cobitidae, Colisa lalia, Trichogaster lalia "colored tilapia", Creisson validus, Acentrogobius janthinopterus, Ctenopharyngodon idella, Cymbacephalus nematophthalmus, Cyprinidae, Cyprinus carpio, Cyprinus carpio carpio, Cyprinus carpio carpio, Cyprinus sp., Decapterus macrosoma, Decapterus sp., Dipterygonotus balteatus, Dischistodus fasciatus, "eel", Eleotridae, Eleotris fusca, Eleotris melanosoma, Eleutheronema tetradactylum, Engraulidae, Epalzeorhynchos bicolour, Epalzeorhynchos frenatum, Ephippidae, Epinephelus bleekeri, Epinephelus malabaricus, Epinephelus sp., Epinephelus undulosus, Erythrichthys leucogrammicus, Dipterygonotus balteatus, Euthynnus affinis, Euthunnus yaito, Euthynnus affinis, Gazza minuta, Gerreidae, Gerres filamentosus, Gerres kapas, Glossogobius biocellatus, Glossogobius giuris, Gnathanodon speciosus, Gobiidae, "grouper", Gymnocranius griseus, Haemulidae, Harengula dispilonotus, Herklotsichthys dispilonotus, Hemiramphidae, Hemiramphus dussumieri, Hyporhamphus dussumieri, Hemiramphus georgii, Rhynchorhamphus georgii, Hepsetia balabacensis, Atherina balabacensis,

Herklotsichthys dispilonotus, Holocentridae, Holocentrus samara, Neoniphon samara, Holocentrus violaceus, Sargocentron violaceum, Hypophthalmichthys molitrix, Hyporhamphus dussumieri, Hypseleotris bipartite, "igat", lniistius sp., Xyrichtys sp., Labeo bicolour, Epalzeorhynchos bicolour, Labeo frenatus, Epalzeorhynchos frenatum, Labridae, Lactariidae, Lactarius lactarius, Lates calcarifer, Leiocassis siamensis, Leiognathidae, Leiognathus equulus, Leiognathus sp., Lepidaplois mesothorax, Bodianus mesothorax, Lethrinidae, Lethrinus erythropterus, Lethrinus hypselopterus, Lethrinus erythropterus, Lethrinus nebulosus, Liza subviridis, Lutjanidae, Lutjanus bohar, Lutjanus dodecacanthus, Lutjanus malabaricus, Lutjanus fulviflamma, Lutjanus gibbus, Lutjanus malabaricus, Lutjanus rangus, Lutjanus bohar, Lutjanus sp., Lutjanus vitta, Megalaspis cordyla, Megalopidae, Megalops cyprinoides, Mene maculate, Menidae, Moenkhausia collettii, Mollienesia latipinna, Poecilia latipinna, Monocentridae, Monocentris sp., Monopterus albus, Mugil cephalus, Mugil dussumieri, Liza subviridis, Mugil sp., Mugilidae, "mullet", Mullidae, Muraenesocidae, Muraenesox cinereus, Mylopharyngodon piceus, Naso hexacanthus, Naso unicornis, Naso vlamingii, Nematabramis verecundus, Nemipteridae, Nemipterus sp., Neoniphon samara, Netuma thalassina, Ophicephalus striatus, Channa striata, Ophieleotris aporos, Ophiocara aporos, Ophieleotris aporos, Oreochromis mossambicus, Oreochromis mossambicus x O. niloticus, Oreochromis niloticus niloticus, Otolithes rubber, Oxycheilinus diagrammus, Oxyurichthys microlepis, Pangasiidae, Pangasius sutchi, Pantodon buchholzi, Pantodontidae, Parachaetodon ocellatus, Paracheirodon simulans, Paralichthyidae, Parastromateus niger, Parupeneus barberinus, Parupeneus indicus, Parupeneus macronema, Pelates quadrilineatus, Pennahia anea, Petrochromis orthognathus, Pinjalo pinjalo, Platax orbicularis, Platybelone sp., Platycephalidae, Platycephalus indicus, Plotosidae, Plotosus anguillaris, Plotosus lineatus, Plotosus lineatus, Poecilia latipinna, Poecilia reticulate, Poeciliidae, Polymixia japonica, Polymixiidae, Polynemidae, Pomacentridae, Pomacentrus fasciatus, Dischistodus fasciatus, Pomadasys argenteus, Pomadasys hasta, Pomadasys argenteus, Priacanthidae, Priacanthus tayenus, Pristipoma hasta, Pomadasys argenteus, Psettodes erumei, Psettodidae, Pseudobalistes flavimarginatus,

Pseudorhombus javanicus, Pseudosciaena anea, Pennahia anea, Puntius binotatus, Puntius manalak, Puntius palata, Spratellicypris palata, Puntius tetrazona, Rasbora kalochroma, Rastrelliger brachysoma, Rastrelliger chrysozonus, Rastrelliger kanagurta, Rastrelliger faughni, Rastrelliger kanagurta, Rhynchorhamphus georgii, Sardinella albella, Sardinella Iongiceps, Sardinella perforate, Sardinella albella, Sardinella sirm, Amblygaster sirm, Sargocentron violaceum, Saurida tumbil, Scaridae, Scarus festivus, Scarus lunula, Scarus festivus, Scatophagidae, Scatophagus argus, Sciaenidae, Scolopsis sp., Scomberoides lysan, Scomberoides sp., Scomberomorus commerson, Scombridae, Selar crumenophthalmus, Selaroides leptolepsis, Serbia nigrofasciata, Seriolina nigrofasciata, Seriolina nigrofasciata, Serranidae, Sicyopterus sp., Siganidae, Siganus argenteus, Siganus canaliculars, Siganus fuscescens, Siganus guttatus, Siganus javus, Siganus oramin, Siganus canaliculars, Siganus sp., Siganus spinus, Siganus striolatus, Siganus spinus, Siganus virgatus, Sillaginidae, Sillago maculate, Sillago sihama, "snapper", Soleidae, Sparidae, Sparus berda, Acanthopagrus berda, Sphaerichthys osphromenoides, Sphyraenajello, Sphyraena langsar, Sphyraena sp., Sphyraenidae, Spratellicypris palata, Stolephorus commerson, Stolephorus sp., Strongylura incise, Strongylura leiura, Strongylura strongylura, Strongylura urvillii, Synaptura sorsogonensis, Synbranchidae, Synodontidae, "talilong" , Tanichthys albonubes, Terapon argenteus auctorum, Terapon plumbeus, Terapon jarbua, Terapon plumbeus, Terapon puta, Terapontidae, Tetrodon manilensis, Arothron manilensis,

Tetraodontidae, Teuthis concatenate, Siganus guttatus, Teuthis javus, Siganus javus, Teuthis rostrata, Siganus argenteus, Teuthis sp., Acanthurus sp., Teuthis virgata, Siganus virgatus, Thysanophrys nematophthalmus, Cymbacephalus nematophthalmus "tilapia", Tilapia mossambica, Oreochromis mossambicus, Tilapia nilotica, Oreochromis niloticus niloticus, Tilapia sp., Tilapia zillii, "top minnow", Trichiuridae, Trichiurus haumela, Trichiurus lepturus, Trichiurus lepturus, Trichogaster lalia, Trichogaster pectoralis, Trichogaster trichopterus, Tylosurus acus, Tylosurus acus acus, Tylosurus acus melanotus, Tylosurus crocodilus, Tylosurus crocodilus crocodilus, Tylosurus crocodilus crocodilus, Tylosurus punctulatus, Tylosurus sp., Xiphophorus maculates, Xiphophorus sp., Xyrichtys sp. There are many more fishes that are cared for in captivity including numerous species of baitfish for recreational fishing and ornamental species. Seahorses are also an object of the present invention; these fish are used as an ornamental species and as ingredient in traditional herbology.

Commonly farmed shellfish and crustaceans which are preferred species of the present invention include; Blue Mussels, Cray Fish, Crabs, Green Lip Mussels, Lobster, Spiny lobster, crabs, shells, mussels, molluscs, echinoderms, Oysters, Clams, Shrimps, Scallops, and Clams.

The aquatic animal feed product, may also for example be feed for Crustacea, such as for Malacostraca, for example Eumalacostraca, such as Eucarida, such as Decapoda, for example Natantia, such as Penaeoidea, for example penaeidae, for example Penaeus. Preferably, the feed composition of the present invention is for feeding shrimp and most preferably for feeding shrimp larvae. Examples hereof include the most farmed shrimp such as the Penaeids (i.e., shrimp of the family Penaeidae), and of these especially Penaeus vannamei (Pacific white shrimp) and Penaeus monodon (giant tiger prawn) other species being Kuruma shrimp (P. japonicus), Western blue shrimp (P. stylirostris), Chinese white shrimp (P. chinensis, also known as the fleshy prawn), Indian white shrimp (P. indicus), Banana shrimp (P. merguiensis) and the

"Akiami paste shrimp" (Metapenaeus spp.) and freshwater shrimp (prawn) belonging to the genus Macrobrachium such as Giant river prawn (Macrobrachium rosenbergii, also known as the Malaysian prawn), Oriental river prawn (M. nipponense) and Monsoon river prawn (M. malcolmsonii). Most preferably, the feed composition of the present invention is for feeding shrimp larvae, such as marine shrimp larvae, such as larvae of the family Penaeidae.

The feed composition is also applicable for feeding insects and arachnids. It is thus an object of the present invention to provide a feed composition for feeding any species of insect. Insects may serve multiple purposes such as being a food source themselves, producing useful substances such as honey, wax, lacquer and silk, they may be used for biocontrol purposes and as pollinators. Insects and arachnids commonly eaten by humans include grasshoppers, crickets, termites, ants, beetle larvae (grubs), moth caterpillars and pupae, spiders, tarantulas, earthworms, bees and scorpions. Examples of insects used for biocontrol purposes include ladybirds and their larvae, hoverflies, dragonflies, lacewings, Anthrocorid bugs, rove and ground beetles, aphid midge, centipedes, predatory mites, and parasitic wasps such as Ichneumon flies, Braconid wasps, and Chalcid wasps. Insects commonly bred for pollination primarily include asps, bees, butterflies, and ants. Examples of insects of other relevance include bees for their honey, wax and propolis production and use in medicine, crop pollination, and as exotic food; silk worms mainly for their silk production; fly maggots for use in medicine (debridement of wounds and other); larvae, worms, and crickets for use af fishing bait. Bees are of special interest as the recipients of the feed composition of the present invention. Examples of types of bees include, but are not limited to bumblebees, stingless bees, and honey bees such as the common honey bee (Apis mellifera), the dwarf and eastern honey bees (Apis florae and Apis cerana) and the giant honey bee (Apis dorsata).

Developmental stages An object of the present invention is to provide a feed composition suitable for young / sensitive and or undeveloped or immature animals according to the above. The present feed composition is especially suitable for immature marine organisms which are known to go through several developmental stages prior to reaching full maturity.

As an example of the various stages of development of a marine organism are the developmental stages of shrimp: Depending on a number of variables (temperature, species, size, wild/captive and number of times previously spawned), shrimp produce between 50,000 and 1 ,000,000 eggs, which are always spawned at night (this may be altered by photo manipulation). After one day, the eggs hatch into nauplii (a nauplius), the first larval stage. Nauplii feed on their egg-yoke reserves for a couple of days, and then metamorphose into zoeae, the second larval stage. Zoeae in the wild feed on algae and in hatcheries typically on algae in combination with a variety of formulated feeds for three to five days and then metamorphose into myses, the third and final larval stage. Myses have many of the characteristics of adult shrimp, like segmented bodies, eyestalks and shrimp-like tails. They feed in hatcheries on a combination of algae, formulated feeds and zooplankton. This stage lasts another three or four days, and then the myses metamorphose into post larvae. Post larvae look like adult shrimp and feed on zooplankton, detritus and commercial feeds. Post larvae are referred to as "PLs", and as each day passes, the stages are numbered PL-1 , PL-2, and so on. When their gills become branched (PL-13 to PL-17), they can be moved to a farm. From hatching, it takes about 25 days to produce a PL-15.

It is an object of the present invention to provide a feed composition which in ingredients and particle size is especially well suited for the various developmental stages of any organism, such as an aquatic organism, and most preferably a marine organism.

Production process Several of the parameters whereby the feed of the present invention is characterized depend upon the method whereby the feed is produced. These parameters include floatation, leakage, consistency, shape and particle size. Furthermore, it is essential that the ingredients of the feed are well mixed to ensure that each feed particle to a high degree comprises all the nutrients and other additives of the feed. Generally, the production of a feed composition comprises the steps of mixing the ingredients, heating the mixture, and generating the particles by extrusion, grinding or other. Additional steps that may be inserted at the appropriate points of the production process include and are not limited to saponification, melt extrusion (with or without a solvent), cross linking, solubilizing, baking, compacting, pressing, freeze-drying or deep freezing, freezing, melting, crushing, milling, grinding, kneading, and sieving. Several process steps are needed before the final product is reached. Any of at least two of the following steps may be used in combination, such as at least three, four, five or more of the following process steps. In one preferred embodiment the production of a feed composition comprises the steps of mixing the ingredients, heating the mixture, solubilising the ingredients and generating the particles. In another preferred embodiment the production of a feed composition comprises the steps of mixing the ingredients, heating the mixture, solubilising the ingredients, freezing of the mixture and generating the particles.

Pre-reparation of dry ingredients

Commercial fish meal of described quality is milled in a jet-mill to a particle size of 1 - 4 microns. All other dry ingredients are milled in a Retsch mill with a sold of 0.5 mm.

Mixing A thorough mixing of the ingredients may be obtained by separately mixing all wet and all dry ingredients prior to their joint admixture. This reduces the tendency of the feed components to clump together. A heating step may be employed at this point to facilitate the admixture or to remove excess water. A heating step may be carried out such that the dry ingredients may be heated and/or the liquid ingredients may be heated separately or after their admixture. A combined method of heating and mixing is obtained by melt extrusion, a method known in the art. Melt extrusion may be performed with or with the presence of a solvent to further facilitate the mixing and extrusion process. If employing a binder, it may be beneficial to melt the binder prior to adding the other ingredients of the feed. Examples of binders are given in the above. Other solids or semi-solids may also be melted in this manner prior to admixture, such components may include sugars, fats, lipids and more. Certain ingredients may be left out of the initial mixture and not added until further downstream in the production process, examples of such later added components include any coating materials such as water insoluble polymers, gelatine and oligosaccharides and/or heat sensitive components such as lipids, sugars, vitamins, pharmaceuticals, live organisms as listed in the above and others. Another method of combining the elements of the feed is the process of saponification, wherein fatty acids are esterified and subsequently mixed with a salt, thus obtaining a fatty acid salts. Examples hereof are long chain fatty acid calcium salt, sodium salts, potassium salt and magnesium salts. In one embodiment of the present invention, dry ingredients and liquid ingredients are initially mixed separately prior to being mixed together. This mixture is further treated as described in the below prior to the addition of further components such as heat sensitive vitamins and/or gelatine.

In one preferred embodiment the dry ingredients including high quality fish meal, krill meal, starch such as Suprex, Algae meal, Mineral mix, Vitamin mix, Betafin, Raw wheat, Dicalciumphosphate and Immune stimulant such as Macro quard are mixed as follows: abo one half of the 'large-volume' dry ingredients are mixed with the 'small-volume' ingredients i kneader. The rest of the dry ingredients are added and the blender is run 15-20 min.

In one preferred embodiment the lipid solution is prepared by mixing fish oil, soy lecithin am cholesterol in a beaker. The solution is heated to 60-80 QC in a boiling water bath and mixec hand, such as from 60-62 QC, for example from 62-64 QC, such as from 64-66 QC, for examp from 66-68 QC, such as from 68-70 QC, for example from 70-72 QC, such as from 72-74 QC, f example from 74-76 QC, such as from 76-78 QC, for example from 78-80 QC,.

In one preferred embodiment the water soluble solution is prepared by mixing Stick-water, astaxanthin, vitamin C, yeast extract, ionsitol and fish hydrolysate (Primex) in a beaker. The solution is heated to 80-90 QC in boiling water bath and mixed by hand, such as from 80-81 for example from 81 -82 QC, such as from 82-83 QC, for example from 83-84 QC, such as fror 84-85 QC, for example from 85-86 QC, such as from 86-87 QC, for example from 87-88 QC, si as from 88-89 QC, for example from 89-90 QC.

In one preferred embodiment the gelatine solution is prepared as follows: a volume of watei corresponding to 10 times the amount of gelatine to be solubilised is preheated in water-boi The water is transferred to a mixing chamber equipped with a heating cap and the pre-weig gelatine is slowly added to the mixing chamber to obtain a totally clear solution of solubilise gelatine. The temperature in the mixing chamber is kept constant between 80-90 QC, such ∑ from 80-81 QC, for example from 81 -82 QC, such as from 82-83 QC, for example from 83-84 ' such as from 84-85 QC, for example from 85-86 QC, such as from 86-87 QC, for example fror 87-88 QC, such as from 88-89 QC, for example from 89-90 QC. The solution is further stirred 15-20 min to secure total solubilisation.

In one preferred embodiment the hot solubilised gelatine is transferred to a kneafer chamber and the stirrer is started. About 80% of the pre-mixed dry ingredients (high quality fish meal, krill meal, Suprex, Algae meal, Mineral mix, Vitamin mix, Betafin, Raw wheat, Dicalciumphosphate and Immune stimulant Macro quard) is cautiously added to the gelatine solution. The lipid solution and the water solution are than cautiously added. The remaining 20% of the dry mix is added and the the mixture is stirred for 15 min after no visible particles is observed.

Heating Heating may be performed at any required temperature depending on the ingredients. It is an object of the present invention that the heating step does not unduly damage the nutrients and other ingredients of the feed. It is an object of the present invention that a heating step may be performed at temperatures ranging from 30 to 200 degrees, such as 40 to 190 degree, such as 50 to 180, such as 60 to 170, such as 70 to 160, such as 70 to 150, such as 80 to 140 such as 90 to 130, such as 100 to 120, such as at or around 1 10 degree Celsius, or such as 60 to 120, such as 70 to 1 10, such as 75 to 105, such as 75 to 95 degrees or such as 80 to 100, such as 85 to 95 degrees, such as at or around 90 degree Celsius. The heating step may be performed at a uniform heat or may be regulated such that the heat is intensified or reduced or both over time. In one embodiment of the present invention the mixture such as the admixture comprising both the wet and the dry ingredients or the subsequent complete mixture further comprising water insoluble polymers and/or gelatine and/or vitamins may be heated to a temperature of at least 40 degrees, such as at least 50 degrees, such as at least 60 degrees, such as at least 70 degrees, such as at least 75 degrees, such as at least 80 degrees, such as at least 85 degrees, such as at least 90 degrees, such as at least 95 degrees, such as at least 100 degrees, such as at least 105 degrees, such as at least 1 10 degrees, such as at least 120 degrees, such as at least 130 degrees, such as at least 140 degrees. It is an object of the present invention to heat the mixture of wet and dry ingredients to a temperature falling within the range of 75 to 95 degree Celsius. It is furthermore an object of the presenting invention to reheat the final mixture after any additional components are added, these additional components being gelatine, polymers, live organisms or others, this, second heating step achieving a temperature falling within the range of from 30 to 100 degrees, such as from 40 to 95 degrees such as from 75 to 95 degree, or such as from 35 to 65 degree Celsius.

Solubilizing

A solubilisation step may also be added at this point in the production process again to reduce the clumping tendency of the ingredients. Thus, each of the dry components may be solubilised prior to being mixed with other, solubilised, formerly dry components, or additional fluid such as water, a solvent, oil or other may be added to the mixture of liquid components to dilute these again to facilitate their mixing. Optionally, the dry and wet ingredients, whether solubilised prior to their admixture or not, may be solubilised during or after their joint admixture. The solubilised mixture has a consistency depending on the total water or solvent content and may be anywhere from liquid to paste-like, such as a slurry, an emulsion, or a syrup consistency. The consistency as said depends on the total amount of dry weight of the solubilised mixture which in an embodiment of the present invention is between 2 and 90%, such as between 3 and 85% such as between 4 and 80%, such as between 5 and 75%, such as between 6 and 70% such as between 7 and 60%, such as between 8 and 55% such as between 9 and 50%, such as between 10 and 49%, such as between 15 and 45% such as between 20 and 40%, such as between 25 and 35% such as at or around 30% or such as between 10 and 80% such as between 15 and 75%, such as between 20 and 70%, such as between 25 and 65% such as between 30 and 60%, such as between 40 and 55%, such as between 45 and 50%, such as at or around 50% of the total mixture.

It is an object of the present invention to ensure a proper mixing of the feed components as this is of special importance when producing feed for small aquatic organisms, such as marine larvae i.e. for shrimp larvae, as these feed particles must be very small and nevertheless contain all or nearly all the nutritional ingredients / components of the feed composition. It is therefore an aspect of the present invention to provide a method of manufacturing a feed composition as disclosed herein. In one embodiment of the invention, the desired product is obtained by solubilizing the majority of the ingredients during or after mixing, followed by water removal. Additional components are subsequently added, mixed into the existing admixture, re-solubilised and optionally again subjected to water removal. Water removal may be accomplished as mentioned by heating or by fluid bed drying, freezing, freeze-drying, distilling or evaporation or evaporation under pressure such as may be performed in a fluid bed. Preferably, water removal is accomplished by heating and/or freezing and/or freeze- drying.

Particle generation

Once all the components of the feed composition have been brought together, a satisfactory blend of the feed components may be achieved by chopping, grinding, kneading, mincing, blending, stirring or other to ensure a more or less homogenous mass. Ensuring a homogenous mass is of significance as the resulting particles, powder, pellets or flakes which otherwise will have a reduced tendency to comprise as many as possible of the feed components within each particle, pellet or flake. The blending of the final mixture may be performed in any device capable of one or more of the above actions as known in the art.

To obtain a satisfactory particle size the final mixture may be extruded through perforated plates giving rise to filaments, or "sausages" depending on the diameter and optionally chopping these filaments. The final mixture may also be pressed into any desired shape, be spray dried, coagulated, granulated, milled, ground, crushed, or co mm united in any way. A preliminary step of removing excess water from the final mixture maybe advantageous at this point to facilitate particle generation and general processing (the mixture does not stick to the equipment). For example, drying, freeze- drying or deep freezing may be used as a step to facilitate subsequent crushing / milling / grinding. An aspect of the freezing or freeze-drying step is the crystal formation inside the mixture, which improves the subsequent grinding process and thus assists in adjusting the particle size. Depending on the method of freeze or spray drying this step alone may be enough to determine the particle size and shape. Prior to the drying, freezing or freeze drying, the final mixture maybe subjected to some sort of shaping, i.e. pressing the blend into filaments or flat structures to increase the surface area and thus the evaporation rate which in turn facilitates the freezing/drying step. Once the final blend has reached a satisfactory water content (of importance for the final consistency of the feed particles) it may be subjected to any sort of milling, grinding or like process known in the art to achieve the desired particle shape and size. Sieving and/or sifting may be used as a process of separating the final particles according to size for the distribution to animals of different sizes.

An embodiment of the present invention relates to the method of manufacturing a feed composition as described herein wherein the desired product is obtained by mixing the ingredients, heating and solubilizing the admixture, melting binders or other solids /semi-solids adding these to the admixture and optionally further solubilizing the mixture with or without including a water removal step prior to this or hereafter. Subsequently the complete mixture is kneaded, minced, blended and/or ground and optionally shaped prior to an additional water removal step which preferably is performed by spray drying, freezing or freeze drying. Here after the mixture is ground, milled and or crushed optionally followed by a step of sieving and sorting of the resulting particles according to size. In this manner, it is ensured that the resulting feed particles comprise all or majority of the components of the feed and have the desired characteristics as described in the above.

In one preferred embodiment the mixture described above is transferred to boxes to obtain a layer of 1 -5 cm height, such as from 1 -2 cm, for example from 2-3 cm, such as from 3-4 cm, for example from 4-5 cm. The boxes are placed in a freezer at a temperature from -10 QC to -25 QC, such as from -10 QC to -1 1 QC, for example from - 1 1 QC to -12 QC, such as from -12 QC to -13 QC, for example from -13 QC to -14 QC, such as from -14 QC to -15 QC, for example from -15 QC to -16 QC, such as from -16 QC to -17 QC, for example from -17 QC to -18 QC, such as from -18 QC to -19 QC, for example from -19 QC to -20 QC, such as from - 20 QC to -21 QC, for example from -21 QC to -22 QC, such as from -22 QC to -23 QC, for example from -23 QC to -24 QC, such as from -24 QC to -25 QC. The boxes are placed in said freezer for 0.5-2.0 hours, such as from 0.5- 0.75 hours, for example from 0.75-1 hours, such as from 1 -1 .25 hours, for example from 1 .25-1 .5 hours, such as from 1 .5-1 .75 hours, for example from 1 .75-2 hours, such as about 0.5 hour, such as 35 minutes, for example 40 minutes, such as 45 minutes, for example 50 minutes, such as 55 minutes, for example 1 hour, such as 1 .5 hours, for example 2 hours. The boxes is placed in a cooled room until the mixture have a consistency to be cut by a knife e.g. the temperature is in the range from -25 QC to 20 QC, such as from -25 QC to -24 QC, for example -24 QC to -23 QC, such as from -23 QC to -22 QC, for example -22 QC to -21 QC, such as from -21 QC to -20 QC, for example -20 QC to -19 QC, such as from -19 QC to -18 QC, for example -18 QC to - 17 QC, such as from -17 QC to -16 QC, for example -16 QC to -15 QC, such as from -15

QC to -14 QC, for example -14 QC to -13 QC, such as from -13 QC to -12 QC, for example - 12 QC to -1 1 QC, such as from -1 1 QC to -10 QC, for example -10 QC to -9 QC, such as from -9 QC to -8 QC, for example -8 QC to -7 QC, such as from -7 QC to -6 QC, for example -6 QC to -5 QC, such as from -5 QC to -4 QC, for example -4 QC to -3 QC, such as from -3 QC to -2 QC, for example -2 QC to -1 QC, such as from -1 QC to 0 QC, for example 0 QC to 1 QC, such as from 1 QC to 2 QC, for example 2 QC to 3 QC, such as from 3 QC to 4 QC, for example 4 QC to 5 QC, such as from 5 QC to 6 QC, for example 6 QC to 7 QC, such as from 7 QC to 8 QC, for example 8 QC to 9 QC, such as from 9 QC to 10 QC, for example 10 0C to 1 1 QC, such as from 1 1 QC to 12 QC, for example 12 QC to 13 QC, such as from 13 QC to 14 QC, for example 14 QC to 15 QC, such as from 15 QC to 16 QC, for example 16 QC to 17 QC, such as from 17 QC to 18 QC, for example 18 QC to 19 QC, such as from 19 QC to 20 QC.

In one embodiment the mixture is subsequently cut in pieces of about 5 cm width and run through a mincer with 0.5 cm openings. The minced mass is spread in a layer of about 1 - 2 cm height in drying plates with perforated bottoms.

In one preferred embodiment the drying plates is placed in a heated air dryer with a distance of about 5 - 10 cm, such as from 5-6 cm, for axample from 6-7 cm, such as from 7-8 cm, for example from 8-9 cm, such from 9-10 cm. Heated air of about 40 QC is circulated for about 1 -2 days. Homogeneity in drying is evaluated after 1 day in each plate and dry matter content is analysed by IR- technology after 1 and 2 days. The drying is finished when dry matter is < 10 % in the expected less dried sample. Dried mass is in one preferred embodiment retrieved from the drier and milled in a Retsch mill with 2 mm sold. In a further preferred embodiment the feed particles from the mill are sieved in a Algier industrial sieve equipped with 0.1 , 0.3 mm, 0.6 mm and 1 .0 mm sieve to obtain specific fractions of appropriate particle sizes

Further aspects of the invention

In an embodiment of the present invention the feed composition is a substitute feed for aquatic organisms, preferably marine larvae, such as shrimp larvae. A substitute feed is a feed which makes any other type of feed or food stuff superfluous. This is especially relevant when feeding marine larvae such as shrimp larvae, as these are traditionally have been fed solely on live feed or on live feed in combination with feed supplements. The live feed often used comprises algae and zooplankton such as brine shrimp (artemia) and rotifers. The present invention thus terminates the need for live feed, which makes the feed composition of the present invention an inexpensive, labour extensive and nutritious choice.

In another embodiment the feed composition may be comprised within a living microorganism. Said living micro-organism may for example be plankton, such as zoo plankton, for example it may be selected from the group consisting of artemia, rotifers (rotatoria) and Calanus. Thus in on embodiment of the invention, the feed product is a zooplankton feed product, such as an artemia or rotifer or Calanus feed product wherein the zooplankton is fed on the feed composition of the present invention. Zooplankton are very small organisms and hence zoo plankton feed products in general consist of very small particles. Zooplankton feed products may be an emulsion of an organic phase in an aqueous phase into which minute feed particles are mixed. The organic phase may be any organic solvent, preferably an organic solvent which is not toxic to zooplankton. The organic phase may thus for example be marine oil, such as fish oil, krill oil, calanus oil or train oil, such as cod liver oil or whale oil or vegetable oil, such as soy oil or calamus oil. The aqueous phase may for example be water, such as sea water or lake water. In yet an embodiment the feed of the present invention is a supplemental feed product given in addition to another feed product or food stuff. Other feed products may be any commercially available feed product and other food stuffs include feed comprising whole organisms, these being dead or living. Thus in a preferred embodiment the present invention is a supplemental feed composition used in combination with additional food stuffs, such as algae and zooplankton e.g. artemia, and rotifers.

It is an object of the present invention that the feeding rate, frequency, and timing are adapted to suit the qualities of the present feed composition and the species to which it is fed. Feeding rates and frequencies are in part a function of animal size. Small larval organisms and fish fry need to be fed a high protein diet frequently and usually in excess. Small fish have a high energy demand and must eat nearly continuously and be fed almost hourly. Feeding small or young /immature animals in excess is not as much of a problem as overfeeding larger or mature organisms as the smaller organisms require only a small amount of feed relative to the volume of water in the culture system. As the animals grow, feeding rates and frequencies may have to be lowered, and the protein content reduced. However, rather than switching to a lower protein diet, feeding less allows the grower to use the same feed (protein level) throughout the grow-out period, thereby simplifying feed inventory and storage. Many factors affect the feeding rates of aquatic organisms. These include time of day, season, water temperature, dissolved oxygen levels, and other water quality variables. For example, feeding organisms grown in ponds early in the morning when the lowest dissolved oxygen levels occur is not advisable. In contrast, in recirculating aquaculture systems where oxygen is continuously supplied, organisms can be fed at nearly any time. At low water temperatures, feeding rates of warm water organisms decline and feeding rates should decrease proportionally. Aquacultured species are typically fed 1 - 4% of their body weight per day.

Aquatic animals can be fed by hand, by automatic feeders, and by demand feeders. There are a variety of automatic (timed) feeders ranging in design from belt feeders that work on wind-up springs, to electric vibrating feeders, to timed feeders that can be programmed to feed hourly and for extended periods. Demand feeders do not require electricity or batteries. They usually are suspended above tanks and raceways and work by allowing the animals to trigger feed release by striking a moving rod that extends into the water. Whenever a fish strikes the trigger, a small amount of feed is released into the tank. Automatic and demand feeders save time, labour and money. It is an object of the present invention to ensure, that the particles of the feed composition are adapted to fit several types of feeders by the particles hygroscopic and size features.

Detailed description of the drawings

Figure 1. Feed composition tested on shrimp larvae. The figure depicts an application test of the feed composition of the present invention (New Feed) tested on shrimp larvae. The feed composition (New feed) is compared to 1 ) a commercially available product (Old feed) which is given together with supplementary algae (A) and Artemia (Art); 2) New feed given together with algae (A) and Artemia (Art); 3) New feed given together with algae (A). As can be seen from the figure, new feed as a substitute feed compares extremely well with the old feed which must be given together with algae and artemia in order to ensure any survival of the shrimp larvae. Excellent survival rates are achieved with the feed of the present invention when the feed is given as a supplement feed together with algae (A) and Artemia (Art).

Figure 2. Feed composition tested on mussels. The mussels were in tank on land and not given feed for 7 days (start, Day 0). The mussels were then given feed for 5 days (Day 5), they were then starved for 6 days (Day 1 1 ) and subsequently given feed for 7 days (Day 16). Eating content is the soft content in the mussel in wet weight percentage of total weight after cooking (including the shell).

Figure 3. List of algae species.

Examples

Example 1

RESULTS FROM SHRIMP LARVAE (P. monodon) TRIAL 1 . 1000 nauplii stoked in 1001 purified sea water in glass tanks, following treatments were triplicate. New feed is the feed of the present invention.

Tank Treatment

A1 ,A2 ,A3 ^ Only new Feed (Amount equivalent to treatment B&C)

B1 ,B2 ,B3 p. Present feed + Artemia + Algae

C1 ,C2 ,C3 New feed + Artemia + Algae

D1 ,D2 , D3 Algae + New feed

Feed amount and feeding carried out based on existing feeding protocols of hatchery. After PL 5 (post larvae day 5) stage feed types changed to small to larger size. During the experiment probiotics were used.

Results:

After 15 days 500 PLs restocked in each tank, except E treatment and continued same treatment for another 10 days. Growth and behavior observed further. Above results were obtained. High rate of cannibalism observed in A tanks after PL 9.

Stress Tests :

Following standard stress tests carried out at PL 17 age for A, B, C and D treatments.

1. Formalin stress Test:

PLs are subject to 200ppm of formalin for one hr. and observed survival. A Tank,

No of Animals that used = 50 Survival % = 6/50 x 100 =12%

B Tank ,

Survival % = 27/50 x 100 = 54%

C Tank ,

Survival % = 22/50 x 100 = 44 %

D Tank,

Survival % = 5/50 x 100 =10%

2. Salinity stress Test :

Subject to sudden decrease of salinity by 60%, after 24 hrs. survivals observed.

B Tank,

Survival % = 33/50 x 100 = 66%

C Tank,

Survival % = 35/50 x 100 = 70%

D Tank,

Survival % = 13/50 x 100 = 26%

The animals in the tanks fed with only artificial feed (New feed) showed slow growth, specially at Zoea stage, it took 36 hrs. more than average to become Mysis, however it gradually improved when animals are growing. At PL stage animals accepted feed well but still the growth was slow compared with live feed. Example 2

RESULTS FROM SHRIMP LARVAE (P. monodon) TRIAL 2. 1000 nauplii were stocked in 100 liter purified sea water in glass tanks, following treatments were in triplicate. New feed is the feed of the present invention.

1 % Macro gard l Larvae diet

Feed amount and feeding were carried out based on existing feeding protocols for the hatchery. Only algae were added the first 4 days. Experimental feeds were introduced from Zoea-stage 3 (day 5), with increasing amounts the following days. No algae was added after day 7. Growth experiment was ended after post larvae stage (PL) 5 (16 days). Artemia was added from day 10. Probiotics was used until addition of experimental feed, but not during feeding experiment.

Results: After 16 days,

Stress Tests :

Following standard stress tests were carried out at PL 15 - 16. 3. Formalin stress Test:

PLs are subject to 200ppm of formalin for one hr. and observed survival. A Tanks,

No of Animals that used = 100

Survival % (72, 86, 80) = 79% B Tanks,

No of Animals that used = 100

Survival % (74, 64, 78) = 72% C Tanks,

No of Animals that used = 100 Survival % (70, 68, 72) = 70%

4. Salinity stress Test :

PLs 15 were subjected to sudden decrease of salinity by 60%. Survival was observed after 24 hours.

A Tanks,

No of Animals that used = 100

Survival % (88, 86, 94) = 89% B Tanks, No of Animals that used = 100

Survival % (84, 80, 86) = 83% C Tanks,

No of Animals that used = 100

Survival % (94, 96, 98) = 96%

5. Temperature stress Test :

PLs 15 were subjected to sudden change in temperature. A Tanks, No of Animals that used = 100

Survival % (88, 86, 94) = 96% B Tanks,

No of Animals that used = 100

Survival % (84, 80, 86) = 96% C Tanks,

No of Animals that used = 100

Survival % (94, 96, 98) = 99%

Claims

1 . A feed composition comprising: a. protein b. lipid c. carbohydrate d. moisture

2. The feed composition according to claim 1 , wherein the protein content of the feed is 60%.

3. The feed composition according to claim 1 , wherein the lipid content of the feed is 13.5%.

4. The feed composition according to claim 1 , wherein the carbohydrate content of the feed is 6%.

5. The feed composition according to claim 1 , wherein the moisture content of the feed is 7%.

6. The feed composition according to claim 1 , wherein the protein content of the feed is from 40 to 80% of protein, such as from 40-41%, for example 41 -42%, such as from 42-43%, for example 43-44%, such as from 44-45%, for example 45-46%, such as from 46-47%, for example 47-48%, such as from 48-49%, for example 49-50%, such as from 50-51%, for example 51 -52%, such as from 52-53%, for example 53-54%, such as from 54-55%, for example 55-56%, such as from 56-57%, for example 57- 58%, such as from 58-59%, for example 59-60%, such as from 60-61%, for example 61 -62%, such as from 62-63%, for example 63-64%, such as from 64-65%, for example 65-66%, such as from 66-67%, for example 67-68%, such as from 68-69%, for example 69-70%, such as from 70-71 %, for example 71 -72%, such as from 72- 73%, for example 73-74%, such as from 74-75%, for example 75-76%, such as from 76-77%, for example 77-78%, such as from 78-79%, for example 79-80%.

7. The feed composition according to claim 1 , wherein the lipid content from 0-20% lipid, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5- 0.75%, for example from 0.75%-1.0%, such as from 1.0-1.25%, for example from

1 .25%- 1.5%, such as from 1.5-1.75%, for example from 1 .75%-2.0%, such as from 2.0- 2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from

2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5- 6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0- 8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1.0%, such as from 1 1.0-1 1.25%, for example from 1 1.25%-1 1 .5%, such as from 1 1.5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%- 12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%- 19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

8. The feed composition according to claim 1 , wherein the carbohydrate content is from 1 -20% of carbohydrate, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1.0- 1.25%, for example from 1.25%-1.5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-

2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0- 4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0- 7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5- 8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-1 1 .0%, such as from 1 1.0-1 1 .25%, for example from 1 1.25%-1 1.5%, such as from 1 1.5-1 1 .75%, for example from 1 1.75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%- 13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from

13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5- 15.75%, for example from 15.75%- 16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%- 18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

9. The feed composition according to claim 1 , wherein the moisture content is from 1 -20% of moisture, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1 .0%, such as from 1.0-1.25%, for example from 1.25%-1 .5%, such as from 1.5-1.75%, for example from 1.75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%- 1 1.0%, such as from 1 1.0-1 1 .25%, for example from 1 1.25%-1 1.5%, such as from 1 1.5-1 1.75%, for example from 1 1 .75%-12.0%, such as from 12.0-12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%- 14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%-15.5%, such as from 15.5-15.75%, for example from 15.75%-16.0%, such as from 16.0-16.25%, for example from 16.25%-16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5-17.75%, for example from 17.75%- 18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

10. A feed composition comprising: a. at least one source of protein such as fish meal and/or yeast extract b. at least one source of lipids such as fish oil and/or cholesterol wherein the feed composition is manufactured in the form of particles ranging in size from 1 to 100 micron.

1 1. The feed composition according to claim 10, wherein the protein source is fish meal is a high quality fish meal.

12. The feed composition according to claim 10, wherein the fish meal is a fish meal from several species of fish.

13. The feed composition according to claim 10, wherein the fish meal is a fish meal from a single species of fish.

14. The feed composition according to claim 10, wherein the feed further comprises at least one additional protein source.

15. The feed composition according to claim 14, wherein the at least one additional protein source is krill meal.

16. The feed composition according to claim 14, wherein the at least one additional protein source is squid meal.

17. The feed composition according to claim 14, wherein the at least one additional protein source is fish hydrosylate.

18. The feed composition according to claim 14, wherein the at least one additional protein source is from live organisms.

19. The feed composition according to claim 14, wherein the at least one additional protein source is krill meal.

20. The feed composition according to claim 14, wherein the at least one additional protein source is yeast extract.

21. The feed composition according to claim 10, wherein the lipid source is high quality fish oil.

22. The feed composition according to claim 10, wherein the fish oil is from a single species of fish.

23. The feed composition according to claim 10, wherein the fish oil is from multiple species of fish.

24. The feed composition according to claim 10, wherein the feed comprises at least one additional lipid source.

25. The feed composition according to claim 24, wherein the additional lipid source is cholesterol.

26. The feed composition according to claim 24, wherein the additional lipid source is vegetable oil.

27. The feed composition according to claim 24, wherein the additional lipid source is lecithin.

28. The feed composition according to claim 27, wherein the additional lecithin is from egg yolk or soy bean.

29. The feed composition according to claim 10, wherein the particle size is between from about 2 micron (μm) to preferably less than 100 micron such as particles having an average diameter of for example about 4 micron, such as about 6 micron, for example about 8 micron, such as about 10 micron, for example about 12 micron, such as about 14 micron, for example about 16 micron, such as about 18 micron, for example about 20 micron, such as about 22 micron, for example about 24 micron, such as about 26 micron, for example about 28 micron, such as about 30 micron, for example about 32 micron, such as about 34 micron, for example about 36 micron, such as about 38 micron, for example about 40 micron, such as about 42 micron, for example about 44 micron, such as about 46 micron, for example about 48 micron, such as about 50 micron, for example about 52 micron, such as about 54 micron, for example about 56 micron, such as about 58 micron, for example about 60 micron, such as about 62 micron, for example about

64 micron, such as about 66 micron, for example about 68 micron, such as about 70 micron, for example about 72 micron, such as about 74 micron, for example about 76 micron, such as about 78 micron, for example about 80 micron, such as about 82 micron, for example about 84 micron, such as about 86 micron, for example about 88 micron, such as about 90 micron, for example about 92 micron, such as about 94 micron, for example about 96 micron, such as about 98 micron.

30. The feed composition according to claim 10, wherein the feed further comprises at least one mineral source.

31. The feed composition according to claim 30, wherein the at least one mineral source is a commercial mineral mix.

32. The feed composition according to claim 30, wherein the at least one mineral source is at least one trace element.

33. The feed composition according to claim 30, wherein the at least one mineral source is at least bulk mineral.

34. The feed composition according to claim 30, wherein the at least one mineral source is a calcium salt.

35. The feed composition according to claim 34, wherein the calcium salt is selected from calcium carbonate, and calcium phosphate, such tricalcium phosphate Ca3(PO4)2, calcium monohydrogenphosphate CaHPO4, calcium dihydrogen phosphate Ca(H2PO4)2 (also known as monocalciumphosphate), calcium pyrophosphate Ca2P2O7, hydroxyapatite Cai0(PO4)6(OH)2) and dicalcium dihydrogenphosphate Ca2H2(PO4)2.

36. The feed composition according to claim 10, wherein the feed further comprises at least one vitamin source.

37. The feed composition according to claim 36, wherein the at least one vitamin source is a commercial vitamin mix

38. The feed composition according to claim 36, wherein the at least one vitamin source is inositol.

39. The feed composition according to claim 36, wherein the at least one vitamin source is vitamin A.

40. The feed composition according to claim 36, wherein the at least one vitamin source is vitamin B complex.

41. The feed composition according to claim 36, wherein the at least one vitamin source is vitamin C.

42. The feed composition according to claim 36, wherein the at least one vitamin source is vitamin E.

43. The feed composition according to claim 10, wherein the feed further comprises at least one binder, such as two binders, such as three binders such as at least four or more binders.

44. The feed composition according to claim 43, wherein at least one binder is a protein binder.

45. The feed composition according to claim 44, wherein the at least one protein binder is a marine protein binder and/or stickwater.

46. The feed composition according to claim 43, wherein the feed further comprises at least one carbohydrate binder.

47. The feed composition according to claim 43, wherein the feed further comprises at least one gum binder.

48. The feed composition according to claim 43, wherein at least one binder is selected from wax, linseed oil, gum arabic, gum tragacanth, methyl cellulose, gums, or protein such as egg white or casein, flours of corn, wheat or other "breakfast" cereals, polysaccharide binders, plant gum agar-agar, tapioca flour (starch) cassava flour, lactose, sucrose, microcrystalline cellulose, pectin, poly vinyl pyrrolidone and various other starches, gelatinized starch, wheat, gum binders, plant gum, gum arabic, locust bean, agar carageenin and other alginates and gelatine from any animal source, preferably porcine and/or bovine, and beef heart.

49. The feed composition according to claim 10, wherein the feed further comprises at least one attractant.

50. The feed composition according to claim 49, wherein the at least one attractant is a chemoattractant.

51. The feed composition according to claim 49, wherein the at least one attractant is a flavoring.

52. The feed composition according to claim 49, wherein the at least one attractant is a fish hydrosylate.

53. The feed composition according to claim 49, wherein the at least one attractant is a condensed fish soluble.

54. The feed composition according to claim 49, wherein the at least one attractant is at least one amino acid.

55. The feed composition according to claim 54, wherein the at least one amino acid is selected from Alanine, Arginine, Betaine, Betafin, Cysteine, Glycine, Histidine, Isoleucine, Lysine, Methionine, Phenylalanine, Choline, Chloride, Proline, Serine, Threonine, Trytophan, Tyrosine, Valine, Taurine, Taurocholate and Hydroxyproline.

56. The feed composition according to claim 10, wherein the feed further comprises pigments.

57. The feed composition according to claim 56, wherein the pigments are natural pigments, synthetic pigments or a mixture of the two.

58. The feed composition according to claim 56, wherein the pigment is astaxanthin.

59. The feed composition according to to claim 56, wherein the pigment is derived from a natural source such as cyanobacteria, dried shrimp meal, shrimp oil, palm oils, and extracts from marigold, red peppers and Phaffia yeast.

60. The feed composition according to claim 10, wherein the feed further comprises at least one preservative.

61. The feed composition according to claim 60, wherein the preservative is Vitamin E.

62. The feed composition according to claim 60, wherein the preservative is BHT.

63. The feed composition according to claim 60, wherein the preservative is BHA.

64. The feed composition according to claim 60, wherein the preservative is ethoxyquin.

65. The feed composition according to claim 10, wherein the feed further comprises at least one special ingredient.

66. The feed composition according to claim 65, wherein the at least one special ingredient is an immunestimulant.

67. The feed composition according to claim 66, wherein the immunestimulant is a polysaccharide.

68. The feed composition according to claim 66, wherein the immunestimulant is a probiotic.

69. The feed composition according to claim 66, wherein the immunestimulant is a dietary essential fatty acid.

70. The feed composition according to claim 66, wherein the immunestimulant is a protease inhibitor.

71. The feed composition according to claim 66, wherein the immunestimulant is a growth hormone.

72. The feed composition according to claim 65, wherein the at least one special ingredient is a pharmaceutical.

73. The feed composition according to claim 65, wherein the at least one special ingredient is a complex additive.

74. The feed composition according to claim 73, wherein the complex additive is yeast extract.

75. The feed composition according to claim 73, wherein the complex additive is krill meal.

76. The feed composition according to claim 73, wherein the complex additive is algae meal.

77. The feed composition according to claim 65, wherein the at least one special ingredient is a filler.

78. The feed composition according to any of the preceding claims, wherein the feed has a high degree of digestibility.

79. The feed composition according to any of the preceding claims, wherein the feed has a consistency adapted to the species to which it is fed.

80. The feed composition according to any of the preceding claims, wherein the feed is hygroscopic.

81. The feed composition according to any of the preceding claims, wherein the feed is particulate.

82. The feed composition according to any of the preceding claims, wherein the feed is granular.

83. The feed composition according to any of the preceding claims, wherein the feed is in the shape of pellets.

84. The feed composition according to any of the preceding claims, wherein the feed is in a powder or flake form.

85. The feed composition according to any of the preceding claims, wherein the feed has a low degree of leakage.

86. The feed composition according to any of the preceding claims, wherein the feed has a high degree of leakage.

87. The feed composition according to any of the preceding claims, wherein the feed increases the growth rate of the animals to which it is fed.

88. The feed composition according to any of the preceding claims, wherein the feed increases the survival rate of the animals to which it is fed.

89. The feed composition according to any of the preceding claims, wherein the feed increases the robustness of the animals to which it is fed.

90. The feed composition according to any of the preceding claims, wherein the feed is suitable for any animal.

91. The feed composition according to claim 90, wherein the animal is an insect and/or an aquatic species.

92. The feed composition according to claim 91 , wherein the aquatic species is a marine species or a freshwater species.

93. The feed composition according to claim 92, wherein the aquatic species is a marine species.

94. The feed composition according to claim 93, wherein the marine species is a fish, crustacean, filter feeder, sea horse and or zooplankton.

95. The feed composition according to claim 90, wherein the animal is a fish.

96. The feed composition according to claim 95, wherein the fish is selected from Arctic Char, Atlantic Salmon, Atlantic Cod, Bass, such as Sea bass, Australian sea bass, black sea bass, giant sea bass, Chilean sea bass and European sea bass, striped bass (Morone saxatilis), white bass (M. chrysops), black basses such as the largemouth bass (Micropterus salmoides), smallmouth bass (M. dolomieu), spotted bass (M. punctulatus), Guadalupe bass (M. treculii) and rock bass (Ambloplites rupestris), Barramundi, Blue Gill, Brook Trout, Brown Trout, Carps, Catfish, Chinook Salmon, Crappie, Drum, Halibut, Flounders, Rainbow Trout, Sea horse,

Hybrid Striped Bass, Tilapias, Tunas, Walleye, Perch, Grouper, Cod, Turbot, Halibut, Sea bass, Sea bream, Perch, Grouper, Sturgeon, White fish, the Climbing perch family, Climbing gourami, Anabantidae, Albacore Tuna (Thunnus alalunga), Arrowtooth Flounder (Atheresthes stomias), Atlantic Cod {Gadus morhua), Atlantic Cutlassfish ( Trichiurus lepturus), Atlantic Salmon (Salmo salaή, Atlantic Wolffish

(Anarhichas lupus), Black Drum (Pogonias cromis), Black Pomfret {Parastromateus nigeή, Blackback Flounder (Sole, Pleuronectes americanus), Blacktip Shark {Carcharhinus limbatus), Catfish (lctalurus furcatus), Crab, Blue {Callinectes sapidus), Marlin (Makaira nigricans), Rockfish (Sebastes auriculatus), Puffer {Sphoeroides annulatus), Scorpionfish (Scorpaena guttata), Sheephead

(Semicossyphus pulcheή, Rockfish (Sebastes pinnigeή, Snapper (Lutjanus purpureus), Catfish (lctalurus punctatus), Rockfish (Sebastes goodei, Sebastes nebulosus), Chinook (Oncorhynchus tshawytscha), Chub Mackerel (Scomber japonicus), Coho Salmon (Silver, Medium Red) (Oncorhynchus kisutch), Thresher Shark (Alopias vulpinus), Grouper (Epinephelus fulva), Cusk (Brosme brosme),

Mahi-mahi (Coryphaena hippurus), Sole (Microstomus pacificus), Sole (Pleuronectes vetulus), Escolar (Lepidocybium flavobrunneum), Dory (Zeus faber), Ocean Perch (Sebastes norvegicus), Snapper (Lutjanus griseus), Sole (Flounder) (Glyptocephalus cynoglossus), Barracuda (Sphyraena barracuda), Haddock (Melanogrammus aeglefinus), Tuna (Euthynnus affinis), Snapper (Lutjanus synagris), Lingcod (Ophiodon elongatus), Milkfish (Chanos chanos), Tilapia (Tilapia mossambica), Nile Tilapia (Tilapia nilotica), Puffer (Sphoeroides maculatus), Tilefish (Caulolatilus princeps), Oilfish (Ruvettus pretiosus), Orange Roughy (Hoplostethus atlanticus), Barracuda (Sphyraena argentea), (Bonito (Sarda chiliensis), Cod (Alaska Cod, Gadus macrocephalus), Jack (Caranx caninus), Jack

(Selene peruviana), Ocean Perch (Sebastes alutus), Mackerel (Scomber scombrus), Spanish (Scomberomorus sierra), Snapper (Lutjanus peru), Patagonian Toothfish (Dissostichus eleginoides), Sole (Flounder, Eopsettajordani), Pink Salmon (Humpback) (Oncorhynchus gorbuscha), Pollock (Pollachius virens), Rockfish (Sebastes maliger), Trout, Rainbow (Steelhead) (Oncorhynchus mykiss), Drum (Redfish) (Sciaenops ocellatus), Porgy (Chrysophrys auratus), Snapper (Lutjanus campechanus), Rockfish (Sebastes prorigeή, Sole (Flounder, Errex zachirus), Rockfish (Sebastes aleutianus), Schoolmaster (Lutjanus apodus), Sheepshead (Archosargus probatocephalus), Shark, Mako (Isurus oxyrinchus), Snapper (Lutjanus vivanus), Butterfish (Pampus argenteus), Rockfish (Sebastes brevispinis), Skipjack Tuna (Katsuwonus pelamis), Spinefoot (Siganusjavus), Croaker or Corvina (Roncador stearnsi), Flounder (Platichthys stellatus), Marlin (Tetrapturus audax), Bass (Morone chrysops x saxatilis), Swordfish (Xiphias gladius), Carp (Barbodes schwanefeldi), Pollock (Alaska Pollock, Theragra chalcogramma), Hake (Urophycis tenuis), Rockfish (Sebastes entomelas), Flounder

(Scophthalmus aquosus), Croaker (Yellowfish, Pseudosciaena manchurica), Rockfish (Sebastes ruberrimus), Tuna (Thunnus albacares), Yellowstripe Scad (Selaroides leptolepis), Yellowtail (Seriola lalandei), Flounder (Limanda ferruginea), Rockfish (Sebastes flavidus) and Snapper (Ocyurus chrysurus ) Arctic char (Salvelinus alpinus), Turbot, Greenland halibut (Reinhartdius hippoglossoides),

Halibut (Hippoglossus hippoglossus), Ablennes hians, Acanthopagrus berda, Acanthophthalmus semicinctus, Acanthuridae, Acanthurus lineatus, Acanthurus sp., Acanthurus triostegus, Acentrogobius janthinopterus, Alectis sp., Ambassidae, Ambassis buruensis, Ambassis commersoni auctorum, Ambassis miops, Ambassis miops, Amblygaster sirm, Amphacanthus oramin, Siganus canaliculars,

Anabantidae, Anabas testudineus, Anguilla bicolor pacifica, Anguilla celebensis, Anguilla marmorata, Anguilla mauritiana, Anguilla marmorata, Anguilla sp., Anguillidae, Anodontostoma chacunda, Anomalopidae, Anomalops katoptron, Anyperodon leucogrammicus, Apogon ellioti, Apogon sp. auctorum, Hypseleotris bipartite, Apogonichthys ellioti, Apogon ellioti, Apogonidae, Apolectus niger,

Parastromateus niger, Ariidae, Aristichthys nobilis, Arius manillensis, Arius sp., Arius thallassinus, Netuma thalassina, Arothron manilensis, Arothron mappa, Atherina balabacensis, Atherinidae, Atule mate, Bagridae, Balistes flavimarginatus, Pseudobalistes flavimarginatus, Balistidae, "banak", Belonidae, Belontiidae, Berycidae, Beryx splendens, Bodianus mesothorax, "boloan", Botia macracanthus,

Butts amboinensis, Caesio cuning, Caesio erythrogaster, Caesio cuning, Caesio lunaris, Caesionidae, Capoeta tetrazona, Puntius tetrazona, Carangidae, Carangoides armatus, Caranx affinis, Atule mate, Caranx armatus, Carangoides armatus, Caranx sexfasciatus, Caranx sp., Caranx speciosus, Gnathanodon speciosus, Carassius auratus, Carassius carassius, Carassius sp., "catfish", Centropomidae, Cephalopholis sonnerati, Chaetodon collare, Chaetodontidae, Chanidae, Channa striata, Channidae, Chanos chanos, Characidae, Cheilinus diagrammus, Oxycheilinus diagrammus, Cheilio inermis, Choerodon anchorago, Chonophorus melanocephalus, Cichlidae, Cirrhina mrigala, Cirrhinus mrigala, Cirrhinus mrigala, Clarias batrachus, Clarias macrocephalus, Clariidae, Clupeidae,

Cobitidae, Colisa lalia, Trichogaster lalia "colored tilapia", Creisson validus, Acentrogobius janthinopterus, Ctenopharyngodon idella, Cymbacephalus nematophthalmus, Cyprinidae, Cyprinus carpio, Cyprinus carpio carpio, Cyprinus carpio carpio, Cyprinus sp., Decapterus macrosoma, Decapterus sp., Dipterygonotus balteatus, Dischistodus fasciatus, "eel", Eleotridae, Eleotris fusca,

Eleotris melanosoma, Eleutheronema tetradactylum, Engraulidae, Epalzeorhynchos bicolour, Epalzeorhynchos frenatum, Ephippidae, Epinephelus bleekeri, Epinephelus malabaricus, Epinephelus sp., Epinephelus undulosus, Erythrichthys leucogrammicus, Dipterygonotus balteatus, Euthynnus affinis, Euthunnus yaito, Euthynnus affinis, Gazza minuta, Gerreidae, Gerres filamentosus,

Gerres kapas, Glossogobius biocellatus, Glossogobius giuris, Gnathanodon speciosus, Gobiidae, "grouper", Gymnocranius griseus, Haemulidae, Harengula dispilonotus, Herklotsichthys dispilonotus, Hemiramphidae, Hemiramphus dussumieri, Hyporhamphus dussumieri, Hemiramphus georgii, Rhynchorhamphus georgii, Hepsetia balabacensis, Atherina balabacensis, Herklotsichthys dispilonotus, Holocentridae, Holocentrus samara, Neoniphon samara, Holocentrus violaceus, Sargocentron violaceum, Hypophthalmichthys molitrix, Hyporhamphus dussumieri, Hypseleotris bipartite, "igat", lniistius sp., Xyrichtys sp., Labeo bicolour, Epalzeorhynchos bicolour, Labeo frenatus, Epalzeorhynchos frenatum, Labridae, Lactariidae, Lactarius lactarius, Lates calcarifer, Leiocassis siamensis,

Leiognathidae, Leiognathus equulus, Leiognathus sp., Lepidaplois mesothorax, Bodianus mesothorax, Lethrinidae, Lethrinus erythropterus, Lethrinus hypselopterus, Lethrinus erythropterus, Lethrinus nebulosus, Liza subviridis, Lutjanidae, Lutjanus bohar, Lutjanus dodecacanthus, Lutjanus malabaricus, Lutjanus fulviflamma, Lutjanus gibbus, Lutjanus malabaricus, Lutjanus rangus,

Lutjanus bohar, Lutjanus sp., Lutjanus vitta, Megalaspis cordyla, Megalopidae, Megalops cyprinoides, Mene maculate, Menidae, Moenkhausia collettii, Mollienesia latipinna, Poecilia latipinna, Monocentridae, Monocentris sp., Monopterus albus, Mugil cephalus, Mugil dussumieri, Liza subviridis, Mugil sp., Mugilidae, "mullet", Mullidae, Muraenesocidae, Muraenesox cinereus, Mylopharyngodon piceus, Naso hexacanthus, Naso unicornis, Naso vlamingii, Nematabramis verecundus, Nemipteridae, Nemipterus sp., Neoniphon samara, Netuma thalassina, Ophicephalus striatus, Channa striata, Ophieleotris aporos, Ophiocara aporos, Ophieleotris aporos, Oreochromis mossambicus, Oreochromis mossambicus x O. niloticus, Oreochromis niloticus niloticus, Otolithes rubber, Oxycheilinus diagrammus, Oxyurichthys microlepis, Pangasiidae, Pangasius sutchi, Pantodon buchholzi, Pantodontidae, Parachaetodon ocellatus, Paracheirodon simulans, Paralichthyidae, Parastromateus niger, Parupeneus barberinus, Parupeneus indicus, Parupeneus macronema, Pelates quadrilineatus, Pennahia anea, Petrochromis orthognathus, Pinjalo pinjalo, Platax orbicularis, Platybelone sp.,

Platycephalidae, Platycephalus indicus, Plotosidae, Plotosus anguillaris, Plotosus lineatus, Plotosus lineatus, Poecilia latipinna, Poecilia reticulate, Poeciliidae, Polymixia japonica, Polymixiidae, Polynemidae, Pomacentridae, Pomacentrus fasciatus, Dischistodus fasciatus, Pomadasys argenteus, Pomadasys hasta, Pomadasys argenteus, Priacanthidae, Priacanthus tayenus, Pristipoma hasta,

Pomadasys argenteus, Psettodes erumei, Psettodidae, Pseudobalistes flavimarginatus, Pseudorhombus javanicus, Pseudosciaena anea, Pennahia anea, Puntius binotatus, Puntius manalak, Puntius palata, Spratellicypris palata, Puntius tetrazona, Rasbora kalochroma, Rastrelliger brachysoma, Rastrelliger chrysozonus, Rastrelliger kanagurta, Rastrelliger faughni, Rastrelliger kanagurta,

Rhynchorhamphus georgii, Sardinella albella, Sardinella Iongiceps, Sardinella perforate, Sardinella albella, Sardinella sirm, Amblygaster sirm, Sargocentron violaceum, Saurida tumbil, Scaridae, Scarus festivus, Scarus lunula, Scarus festivus, Scatophagidae, Scatophagus argus, Sciaenidae, Scolopsis sp., Scomberoides lysan, Scomberoides sp., Scomberomorus commerson,

Scombridae, Selar crumenophthalmus, Selaroides leptolepsis, Seriola nigrofasciata, Seriolina nigrofasciata, Seriolina nigrofasciata, Serranidae, Sicyopterus sp., Siganidae, Siganus argenteus, Siganus canaliculars, Siganus fuscescens, Siganus guttatus, Siganus javus, Siganus oramin, Siganus canaliculars, Siganus sp., Siganus spinus, Siganus striolatus, Siganus spinus,

Siganus virgatus, Sillaginidae, Sillago maculate, Sillago sihama, "snapper", Soleidae, Sparidae, Sparus berda, Acanthopagrus berda, Sphaerichthys osphromenoides, Sphyraena jello, Sphyraena langsar, Sphyraena sp., Sphyraenidae, Spratellicypris palata, Stolephorus commerson, Stolephorus sp., Strongylura incise, Strongylura leiura, Strongylura strongylura, Strongylura urvillii, Synaptura sorsogonensis, Synbranchidae, Synodontidae, "talilong" , Tanichthys albonubes, Terapon argenteus auctorum, Terapon plumbeus, Terapon jarbua, Terapon plumbeus, Terapon puta, Terapontidae, Tetrodon manilensis, Arothron manilensis, Tetraodontidae, Teuthis concatenate, Siganus guttatus, Teuthis javus, Siganus javus, Teuthis rostrata, Siganus argenteus, Teuthis sp., Acanthurus sp.,

Teuthis virgata, Siganus virgatus, Thysanophrys nematophthalmus, Cymbacephalus nematophthalmus "tilapia", Tilapia mossambica, Oreochromis mossambicus, Tilapia nilotica, Oreochromis niloticus niloticus, Tilapia sp., Tilapia zillii, "top minnow", Trichiuridae, Trichiurus haumela, Trichiurus lepturus, Trichiurus lepturus, Trichogaster lalia, Trichogaster pectoralis, Trichogaster trichopterus,

Tylosurus acus, Tylosurus acus acus, Tylosurus acus melanotus, Tylosurus crocodilus, Tylosurus crocodilus crocodilus, Tylosurus crocodilus crocodilus, Tylosurus punctulatus, Tylosurus sp., Xiphophorus maculates, Xiphophorus sp., Xyrichtys sp.

97. The feed composition according to claim 90, wherein the animal is a crustacean and/or shellfish such as Blue Mussels, Cray Fish, Crabs, Green Lip Mussels, Lobster, Spiny lobster, crabs, shells, mussels, molluscs, echinoderms, Oysters, Clams, Shrimps, or Scallops.

98. The feed composition according to claim 97, wherein the crustacean is a shrimp and/or shrimp larvae.

99. The feed composition according to claim 98, wherein the shrimp and/or shrimp larvae is selected from Penaeus vannamei (Pacific white shrimp) and Penaeus monodon (giant tiger prawn) other species being Kuruma shrimp (P. japonicus), Western blue shrimp (P. stylirostris), Chinese white shrimp (P. chinensis, also known as the fleshy prawn), Indian white shrimp (P. indicus), Banana shrimp (P. merguiensis) and the "Akiami paste shrimp" (Metapenaeus spp.) and freshwater shrimp (prawn) belonging to the genus Macrobrachium such as Giant river prawn

(Macrobrachium rosenbergii, also known as the Malaysian prawn), Oriental river prawn (M. nipponense) and Monsoon river prawn (M. malcolmsonii).

100. The feed composition according to claim 90, wherein the animal is an insect.

101 . The feed composition according to claim 100, wherein the insect is a bee.

102. The feed composition according to any of the preceding claims, wherein the feed is an extruded feed.

103. The feed composition according to any of the preceding claims, wherein the feed sinks after a prolonged period in water.

104. The feed composition according to any of the preceding claims, wherein the feed is a substitute feed.

105. The feed composition according to any of the preceding claims, wherein the feed is a feed supplement.

106. The feed composition according to any of the preceding claims, wherein the feed comprises living organisms.

107. The feed composition according to claim 106, wherein the living organisms are zooplankton.

108. The feed composition according to claim 107, wherein the zooplankton is at least one of artemia, rotifers and calanus.

109. The feed composition according to claim 106, wherein the living organisms are bacteria.

1 10. The feed composition according to claim 106, wherein the living organisms are fungi.

1 1 1. A method of manufacturing a feed composition according to any of the preceding claims comprising the steps of a. Mixing ingredients, b. Heating the mixture, c. solubilising ingredients, d. removing water from mixture and e. generating particles

1 12. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method further comprises at least one additional mixing step.

1 13. The method of manufacturing a feed composition according to claim 1 1 1 , wherein solubles, dry matter and binders are admixed separately prior to a combined admixture.

1 14. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method further comprises at least one additional heating step.

1 15. The method of manufacturing a feed composition according to claim 1 12, wherein at least one of the separate admixtures is heated prior to the combined admixture.

1 16. The method of manufacturing a feed composition according to claim 1 14, wherein the at least one heating step is conducted at a temperature between 30 to 200 degrees, such as 40 to 190 degree, such as 50 to 180, such as 60 to 170, such as 70 to 160, such as 70 to 150, such as 80 to 140 such as 90 to 130, such as 100 to 120, such as at or around 1 10 degree Celsius, or such as 60 to 120, such as 70 to 1 10, such as 75 to 105, such as 75 to 95 degrees or such as 80 to 100, such as 85 to 95 degrees, such as at or around 90 degree Celsius.

1 17. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises at least one additional solubilization step

1 18. The method of manufacturing a feed composition according to claim 1 1 1 , wherein any of the ingredients alone or after admixture are solubilized.

1 19. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the dry weight of the at least one solubilized mixtures is between 2 and 90%, such as between 3 and 85% such as between 4 and 80%, such as between 5 and 75%, such as between 6 and 70% such as between 7 and 60%, such as between 8 and 55% such as between 9 and 50%, such as between 10 and 49%, such as between 15 and 45% such as between 20 and 40%, such as between 25 and 35% such as at or around 30% or such as between 10 and 80% such as between 15 and 75%, such as between 20 and

70%, such as between 25 and 65% such as between 30 and 60%, such as between 40 and 55%, such as between 45 and 50%, such as at or around 50% of the total mixture.

120. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises at least one additional water removal step.

121 . The method of manufacturing a feed composition according to claim 120, wherein any of the at least one water removal step is carried out by heating.

122. The method of manufacturing a feed composition according to claim 120, wherein any of the at least one water removal step is carried out by freezing.

123. The method of manufacturing a feed composition according to claim 120, wherein any of the at least one water removal step is carried out by freeze- drying.

124. The method of manufacturing a feed composition according to claim 120, wherein any of the at least one water removal step is carried out by distilling or evaporation or evaporation under pressure.

125. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises at least one step of chopping, grinding, kneading, mincing, blending and/or stirring.

126. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises at least one additional particle generation step.

127. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises pressing.

128. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises spray drying

129. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises coagulation.

130. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises granulation.

131 . The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises milling.

132. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises grinding.

133. The method of manufacturing a feed composition according to claim 126, wherein the at least one particle generation step comprises crushing.

134. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises at least one sifting and/or sieving step.

135. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the method comprises mixing of High Qulality Fish meal, Krill meal, Corn starch, Algae meal, Mineral mix, Vitamin mix, Betafin (betain), Raw wheat, Dicalsiumphosphate, Inositol, Yeast extract, Cholesterol, Vitamin C, Soya Lecitin, Fish oil, Stickwater, Astaxanthin, Fish hydrolysate (e.g. Primex), Gelatin and an Immune stimulant (e.g. Macro guard).

136. The method of manufacturing a feed composition according to claim 135, wherein the amount of added High quality fish meal compared to the total amount of ingredients is 46.1 %

137. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Krill meal compared to the total amount of ingredients is 5%

138. The method of manufacturing a feed composition according to claim 135, wherein the amount of added corn starch compared to the total amount of ingredients is 5%.

139. The method of manufacturing a feed composition according to claim 135, wherein the amount of added algae meal compared to the total amount of ingredients is 1%.

140. The method of manufacturing a feed composition according to claim 135, wherein the amount of added mineral mix compared to the total amount of ingredients is 0.5%.

141 . The method of manufacturing a feed composition according to claim 135, wherein the amount of added vitamin mix compared to the total amount of ingredients is 2%.

142. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Betafin compared to the total amount of ingredients is 3%.

143. The method of manufacturing a feed composition according to claim 135, wherein the amount of added raw wheat compared to the total amount of ingredients is 3%.

144. The method of manufacturing a feed composition according to claim 135, wherein the amount of added dicalsiumphosphate compared to the total amount of ingredients is 3%.

145. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Inositol compared to the total amount of ingredients is 0.05%.

146. The method of manufacturing a feed composition according to claim 135, wherein the amount of added yeast extract compared to the total amount of ingredients is 2%.

147. The method of manufacturing a feed composition according to claim 135, wherein the amount of added cholesterol compared to the total amount of ingredients is 1%.

148. The method of manufacturing a feed composition according to claim 135, wherein the amount of added vitamin c compared to the total amount of ingredients is 0.25%.

149. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Soya Lecitin compared to the total amount of ingredients is 2%.

150. The method of manufacturing a feed composition according to claim 135, wherein the amount of added fish oil compared to the total amount of ingredients is 3%.

151 . The method of manufacturing a feed composition according to claim 135, wherein the amount of added stickwater compared to the total amount of ingredients is 8%.

152. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Astaxanthin compared to the total amount of ingredients is 0.1 %.

153. The method of manufacturing a feed composition according to claim 135, wherein the amount of added fish hydrolysate such as Primex compared to the total amount of ingredients is 2%.

154. The method of manufacturing a feed composition according to claim 135, wherein the amount of added gelatine compared to the total amount of ingredients is 10%.

155. The method of manufacturing a feed composition according to claim 135, wherein the amount of added immunestimulant compared to the total amount of ingredients is 3%.

156. The method of manufacturing a feed composition according to claim 135, wherein the amount of added High quality fish meal compared to the total amount of ingredients is in the range from 30 to 60%, such as from 30-31%, for example 31 -32%, such as from 32-33%, for example 33-34%, such as from 34-35%, for example 35-36%, such as from 36-37%, for example 37- 38%, such as from 38-39%, for example 39-40%, such as from 40-41%, for example 41 -42%, such as from 42-43%, for example 43-44%, such as from

44-45%, for example 45-46%, such as from 46-47%, for example 47-48%, such as from 48-49%, for example 49-50%, such as from 50-51%, for example 51 -52%, such as from 52-53%, for example 53-54%, such as from 54-55%, for example 55-56%, such as from 56-57%, for example 57-58%, such as from 58-59%, for example 59-60%.

157. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Krill meal compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-

7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

158. The method of manufacturing a feed composition according to claim 135, wherein the amount of added corn starch compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5-

1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

159. The method of manufacturing a feed composition according to claim 135, wherein the amount of added algae meal compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-

5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

160. The method of manufacturing a feed composition according to claim 135, wherein the amount of added mineral mix compared to the total amount of ingredients is in the range from 0-5%, such as from 0-0.1%, for example from 0.1 -0.2%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4-0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7-0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%, such as from 1.0-1.1%, for example from 1.1 -1.2%, such as from 1 .2-1 .3%, for example from 1.3-1.4%, such as from 1.4-1.5%, for example from 1.5-1.6%, such as from 1 .6-1 .7%, for example from 1.7-1.8%, such as from 1.8-1.9%, for example from 1.9-2.0%, such as from 2.0-2.2%, for example from 2.2- 2.4%, such as from 2.4-2.6%, for example from 2.6-2.8%, such as from 2.8- 3.0%, for example from 3.0-3.2%, such as from 3.2-3.4%, for example from

3.4-3.6%, such as from 3.6-3.8%, for example from 3.8-4.0%, such as from 4.0-4.2%, for example from 4.2-4.4%, such as from 4.4-4.6%, for example from 4.6-4.8%, such as from 4.8-5.0%.

161 . The method of manufacturing a feed composition according to claim 135, wherein the amount of added vitamin mix compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-

5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

162. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Betafin compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-

9.75%, for example from 9.75%-10.0%.

163. The method of manufacturing a feed composition according to claim 135, wherein the amount of added raw wheat compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-

3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

164. The method of manufacturing a feed composition according to claim 135, wherein the amount of added dicalsiumphosphate compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-

1.0%, such as from 1 .0-1.25%, for example from 1.25%-1 .5%, such as from 1.5-1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%- 3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%- 5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%- 7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from

7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%- 9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

165. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Inositol compared to the total amount of ingredients is in the range from 0-1%, such as from 0-0.01%, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from 0.04-0.05%, for example from 0.05-0.06%, such as from 0.06-

0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1%, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14- 0.15%, for example from 0.15-0.16%, such as from 0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4-0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7- 0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%.

166. The method of manufacturing a feed composition according to claim 135, wherein the amount of added yeast extract compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%- 1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-

5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

167. The method of manufacturing a feed composition according to claim 135, wherein the amount of added cholesterol compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-

9.75%, for example from 9.75%-10.0%.

168. The method of manufacturing a feed composition according to claim 135, wherein the amount of added vitamin c compared to the total amount of ingredients is in the range from 0-2%, such as from 0-0.01%, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from 0.04-0.05%, for example from 0.05-0.06%, such as from 0.06- 0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1%, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14-

0.15%, for example from 0.15-0.16%, such as from 0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.20-0.21%, for example from 0.21 -0.22%, such as from 0.22- 0.23%, for example from 0.23-0.24%, such as from 0.24-0.25%, for example from 0.25-0.26%, such as from 0.26-0.27%, for example from 0.27-0.28%, such as from 0.28-0.29%, for example from 0.29-0.30%, such as from 0.30- 0.32%, for example from 0.32-0.34%, such as from 0.34-0.36%, for example from 0.36-0.38%, such as from 0.38-0.40%, for example from 0.40-0.5%, such as from 0.5-0.6%, for example from 0.6-0.7%, such as from 0.7-0.8%, for example from 0.8-0.9%, such as from 0.9-1.0%, for example from 1.0-

1.1 %, such as from 1 .1 -1.2%, for example from 1.2-1.3%, such as from 1.3- 1.4%, for example from 1 .4-1.5%, such as from 1.5-1.6%, for example from 1.6-1.7%, such as from 1.7-1.8%, for example from 1.8-1.9%, such as from 1.9-2.0%.

169. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Soya Lecitin compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5-

1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

170. The method of manufacturing a feed composition according to claim 135, wherein the amount of added fish oil compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%-1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-

5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

171 . The method of manufacturing a feed composition according to claim 135, wherein the amount of added stickwater compared to the total amount of ingredients is in the range from 0-20%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%-1.0%, such as from 1 .0-1 .25%, for example from 1 .25%- 1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5- 7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-

9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%- 1 1 .0%, such as from 1 1 .0-1 1.25%, for example from 1 1.25%-1 1 .5%, such as from 1 1.5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0- 12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%- 15.5%, such as from 15.5-15.75%, for example from 15.75%-16.0%, such as from 16.0-16.25%, for example from 16.25%- 16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5- 17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from

18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

172. The method of manufacturing a feed composition according to claim 135, wherein the amount of added Astaxanthin compared to the total amount of ingredients is in the range from 0-1%, such as from 0-0.01%, for example from 0.01 -0.02%, such as from 0.02-0.03%, for example from 0.03-0.04%, such as from 0.04-0.05%, for example from 0.05-0.06%, such as from 0.06- 0.07%, for example from 0.07-0.08%, such as from 0.08-0.09%, for example from 0.09-0.10%, such as from 0.10-0.1 1%, for example from 0.1 1 -0.12%, such as from 0.12-0.13%, for example from 0.13-0.14%, such as from 0.14- 0.15%, for example from 0.15-0.16%, such as from 0.16-0.17%, for example from 0.17-0.18%, such as from 0.18-0.19%, for example from 0.19-0.20%, such as from 0.2-0.3%, for example from 0.3-0.4%, such as from 0.4-0.5%, for example from 0.5-0.6%, such as from 0.6-0.7%, for example from 0.7-

0.8%, such as from 0.8-0.9%, for example from 0.9-1.0%.

173. The method of manufacturing a feed composition according to claim 135, wherein the amount of added fish hydrolysate such as Primex compared to the total amount of ingredients is in the range from 0-10%, such as from 0-

0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1.0-1.25%, for example from 1.25%- 1.5%, such as from 1 .5-1 .75%, for example from 1 .75%-2.0%, such as from 2.0- 2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5-3.75%, for example from 3.75%-4.0%, such as from 4.0- 4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5-5.75%, for example from 5.75%-6.0%, such as from 6.0- 6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-7.75%, for example from 7.75%-8.0%, such as from 8.0- 8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5-9.75%, for example from 9.75%-10.0%.

174. The method of manufacturing a feed composition according to claim 135, wherein the amount of added gelatine compared to the total amount of ingredients is in the range from 0-20%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1 .0-1 .25%, for example from 1 .25%- 1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-

7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%, such as from 10-10.25%, for example from 10.25%-10.5%, such as from 10.5-10.75%, for example from 10.75%-

1 1 .0%, such as from 1 1 .0-1 1.25%, for example from 1 1.25%-1 1 .5%, such as from 1 1.5-1 1.75%, for example from 1 1.75%-12.0%, such as from 12.0- 12.25%, for example from 12.25%-12.5%, such as from 12.5-12.75%, for example from 12.75%-13.0%, such as from 13.0-13.25%, for example from 13.25%-13.5%, such as from 13.5-13.75%, for example from 13.75%-14.0%, such as from 14.0-14.25%, for example from 14.25%-14.5%, such as from 14.5-14.75%, for example from 14.75%-15.0%, %, such as from 15.0-15.25%, for example from 15.25%- 15.5%, such as from 15.5-15.75%, for example from 15.75%-16.0%, such as from 16.0-16.25%, for example from 16.25%- 16.5%, such as from 16.5-16.75%, for example from 16.75%-17.0%, such as from 17.0-17.25%, for example from 17.25%-17.5%, such as from 17.5- 17.75%, for example from 17.75%-18.0%, such as from 18.0-18.25%, for example from 18.25%-18.5%, such as from 18.5-18.75%, for example from 18.75%-19.0%, such as from 19.0-19.25%, for example from 19.25%-19.5%, such as from 19.5-19.75%, for example from 19.75%-20.0%.

175. The method of manufacturing a feed composition according to claim 135, wherein the amount of added immunestimulant compared to the total amount of ingredients is in the range from 0-10%, such as from 0-0.25%, for example from 0.25%-0.5%, such as from 0.5-0.75%, for example from 0.75%- 1.0%, such as from 1 .0-1 .25%, for example from 1 .25%- 1 .5%, such as from 1.5- 1.75%, for example from 1 .75%-2.0%, such as from 2.0-2.25%, for example from 2.25%-2.5%, such as from 2.5-2.75%, for example from 2.75%-3.0%, such as from 3.0-3.25%, for example from 3.25%-3.5%, such as from 3.5- 3.75%, for example from 3.75%-4.0%, such as from 4.0-4.25%, for example from 4.25%-4.5%, such as from 4.5-4.75%, for example from 4.75%-5.0%, %, such as from 5.0-5.25%, for example from 5.25%-5.5%, such as from 5.5- 5.75%, for example from 5.75%-6.0%, such as from 6.0-6.25%, for example from 6.25%-6.5%, such as from 6.5-6.75%, for example from 6.75%-7.0%, such as from 7.0-7.25%, for example from 7.25%-7.5%, such as from 7.5-

7.75%, for example from 7.75%-8.0%, such as from 8.0-8.25%, for example from 8.25%-8.5%, such as from 8.5-8.75%, for example from 8.75%-9.0%, such as from 9.0-9.25%, for example from 9.25%-9.5%, such as from 9.5- 9.75%, for example from 9.75%-10.0%.

176. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the mixing comprises mixing of the following dry ingredients: high quality fish meal, krill meal, corn starch, Algae meal, Mineral mix, Vitamin mix, Betafin, Raw wheat, Dicalciumphosphate and Immune stimulant.

177. The method of manufacturing a feed composition according to claim 1 12, wherein the at least one additional mixing step comprises generation of a lipid solution by mixing fish oil, soy lecithin and cholesterol in a beaker; said solution is heated to 60-80 QC such as from 60-62 QC, for example from 62-64 QC, such as from 64-66 QC, for example from 66-68 QC, such as from 68-70

QC, for example from 70-72 QC, such as from 72-74 QC, for example from 74- 76 QC, such as from 76-78 QC, for example from 78-80 QC in a boiling water bath and mixed by hand.

178. The method of manufacturing a feed composition according to claim 1 12, wherein the at least one additional mixing step comprises generation of a water soluble solution by mixing Stick-water, astaxanthin, vitamin C, yeast extract, ionsitol and fish hydrolysate (Primex) in a beaker; said solution is heated to 80-90 QC such as from 80-81 QC, for example from 81 -82 QC, such as from 82-83 QC, for example from 83-84 QC, such as from 84-85 QC, for example from 85-86 QC, such as from 86-87 QC, for example from 87-88 QC, such as from 88-89 QC, for example from 89-90 QC in boiling water bath and mixed by hand.

179. The method of manufacturing a feed composition according to claim 1 12, wherein the at least one additional mixing step comprises generation of the gelatine solution as follows: a volume of water corresponding to 10 times the amount of gelatine to be solubilised is preheated in water-boilers; said water is transferred to a mixing chamber equipped with a heating cap and the pre- weighed gelatine is slowly added to the mixing chamber to obtain a totally clear solution of solubilised gelatine; the temperature in the said mixing chamber is kept constant between 80-90 QC, such as from 80-81 QC, for example from 81 -82 QC, such as from 82-83 QC, for example from 83-84 QC, such as from 84-85 QC, for example from 85-86 QC, such as from 86-87 QC, for example from 87-88 QC, such as from 88-89 QC, for example from 89-90 QC; said solution is further stirred for 15-20 minutes.

180. The method of manufacturing a feed composition according to claim 1 12, wherein the at least one additional mixing step comprises the steps of :

a. transfer of a hot solubilised gelatine solution to a kneafer chamber; the stirrer of said kneafer chamber is started. b. About 80% of a pre-mix of dry ingredients (high quality fish meal, krill meal, Suprex, Algae meal, Mineral mix, Vitamin mix, Betafin, Raw wheat, Dicalciumphosphate and Immune stimulant Macro quard) is cautiously added to said gelatine solution. c. A lipid solution ( and a water solution are than cautiously added. d. The remaining 20% of the dry mix is added and the the mixture is stirred for 15 min after no visible particles is observed.

181 . The method of manufacturing a feed composition according to claim 1 1 1 , whe the generation of particles comprises the steps of a. transferred of a feed composition to boxes to obtain a layer of 1 -5 cm height, such as from 1 -2 cm, for example from 2-3 cm, such as from 3-

4 cm, for example from 4-5 cm b. said boxes are placed in a freezer at a temperature from -10 QC to -25 QC, such as from -10 QC to -1 1 QC, for example from -1 1 QC to -12 QC, such as from -12 QC to -13 QC, for example from -13 QC to -14 QC, such as from - 14 QC to -15 QC, for example from -15 QC to -16 QC, such as from -16 QC to -17 QC, for example from -17 QC to -18 QC, such as from -18 QC to -19 QC, for example from -19 QC to -20 QC, such as from - 20 QC to -21 QC, for example from -21 QC to -22 QC, such as from -22 QC to -23 QC, for example from -23 QC to -24 QC, such as from -24 QC to -25 QC. c. said boxes are placed in said freezer for 0.5-2.0 hours, such as from

0.5-0.75 hours, for example from 0.75-1 hours, such as from 1 -1 .25 hours, for example from 1 .25-1 .5 hours, such as from 1 .5-1 .75 hours, for example from 1 .75-2 hours, such as about 0.5 hour, such as 35 minutes, for example 40 minutes, such as 45 minutes, for example 50 minutes, such as 55 minutes, for example 1 hour, such as 1 .5 hours, for example 2 hours. d. said boxes is placed in a cooled room until the mixture have a consistency to be cut by a knife e.g. the temperature is in the range from -25 QC to 20 QC, such as from -25 QC to -24 QC, for example -24 QC to -23 QC, such as from -23 QC to -22 QC, for example -22 QC to -21 QC, such as from -21 QC to -20 QC, for example -20 QC to -19 QC, such as from -19 QC to -18 QC, for example -18 QC to -17 QC, such as from -17 QC to -16 QC, for example -16 QC to -15 QC, such as from -15 QC to -14 QC, for example -14 QC to -13 QC, such as from -13 QC to -12 QC, for example -12 QC to -1 1 QC, such as from -1 1 QC to -10 QC, for example -

10 QC to -9 QC, such as from -9 QC to -8 QC, for example -8 QC to -7 QC, such as from -7 QC to -6 QC, for example -6 QC to -5 QC, such as from -5 QC to -4 QC, for example -4 QC to -3 QC, such as from -3 QC to -2 QC, for example -2 QC to -1 QC, such as from -1 QC to 0 QC, for example 0 QC to 1 QC, such as from 1 QC to 2 QC, for example 2 QC to 3 QC, such as from 3 QC to 4 QC, for example 4 QC to 5 QC, such as from 5 QC to 6 QC, for example 6 QC to 7 QC, such as from 7 QC to 8 QC, for example 8 QC to 9 QC, such as from 9 QC to 10 QC, for example 10 QC to 1 1 QC, such as from 1 1 QC to 12 QC, for example 12 QC to 13 QC, such as from 13 QC to 14 QC, for example 14 QC to 15 QC, such as from 15 QC to 16 QC, for example 16 QC to 17 QC, such as from 17 QC to 18 QC, for example 18 QC to 19 QC, such as from 19 QC to 20 QC.

182. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the generation of particles comprises the steps a. that the feed composition is cut in pieces of about 5 cm width and run through a mincer with 0.5 cm openings. b. Said minced mass is spread in a layer of about 1 - 2 cm height in drying plates with perforated bottoms.

183. The method of manufacturing a feed composition according to claim 1 1 1 , wherein the heating comprises the steps a. a drying plates is placed in a heated air dryer with a distance of about 5 - 10 cm, such as from 5-6 cm, for axample from 6-7 cm, such as from 7-8 cm, for example from 8-9 cm, such from 9-10 cm. b. Heated air of about 40 QC is circulated in said dryer for about 1 -2 days. c. Homogeneity in drying is evaluated after 1 day in each plate and dry matter content is analysed by IR- technology after 1 and 2 days. d. said drying is finished when dry matter is < 10 % in the expected less dried sample. e. Dried mass is optionally retrieved from the drier and milled in a Retsch mill with 2 mm sold. f. the feed particles from the mill are optionally sieved in a Algier industrial sieve equipped with 0.1 , 0.3 mm, 0.6 mm and 1 .0 mm sieve to obtain specific fractions of appropriate particle sizes.

184. A feed composition manufactured according to any of claims 1 1 1 to 183 for feeding one or more living organisms. Use of the feed composition as defined in any of claims 1 to 1 10 and manufactured according to any of claims 1 1 1 to 183 for feeding one or more living organisms.

Sign in to the Lens

Feedback